biliverdin (CHEBI:17033)

ChEBI > Main

CHEBI:17033 - biliverdin

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	biliverdin

ChEBI ID	CHEBI:17033

Definition	A linear tetrapyrrole produced in the reticuloendothelial system by the first step of heme degradation, catalysed by heme oxygenase.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:41124, CHEBI:3102, CHEBI:13901, CHEBI:13902, CHEBI:22875

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

Molfile

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__7005547052204406__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__7005547052204406__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:13901","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__7005547052204406__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"7005547052204406","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__7005547052204406__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 07220623403D

starting HoverWatcher_5

Time for openFile(

Marvin 07220623403D

77 80 0 0 0 0 999 V2000

1.1092 -1.7179 -0.7245 C 0 0 0 0 0 0 0 0 0 9 0 0

1.2984 -0.4078 -0.5193 N 0 0 0 0 0 0 0 0 0 22 0 0

3.2727 -1.2301 -1.0896 C 0 0 0 0 0 0 0 0 0 7 0 0

4.7118 -1.3093 -1.4343 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3447 -2.2753 -1.0775 C 0 0 0 0 0 0 0 0 0 8 0 0

3.5201 -5.5856 -4.1309 O 0 0 0 0 0 0 0 0 0 0 0 0

2.5762 -0.0672 -0.7288 C 0 0 0 0 0 0 0 0 0 6 0 0

-1.2910 -1.8998 -0.2431 C 0 0 0 0 0 0 0 0 0 11 0 0

-2.7370 -0.5454 0.4664 C 0 0 0 0 0 0 0 0 0 14 0 0

-1.5045 -0.7099 0.1806 N 0 0 0 0 0 0 0 0 0 23 0 0

-3.3900 -1.7034 0.2285 C 0 0 0 0 0 0 0 0 0 13 0 0

-4.8109 -1.9386 0.4584 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4682 -2.5643 -0.2182 C 0 0 0 0 0 0 0 0 0 12 0 0

-2.6820 -3.9666 -0.5598 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4600 -4.8541 0.6920 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7409 -6.9497 0.0019 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.6667 -6.2478 0.3819 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.7893 -6.7314 0.4493 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0988 -2.3760 -0.6379 C 0 0 0 0 0 0 0 0 0 10 0 0

2.6037 -3.6926 -1.4303 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3811 -3.9258 -2.9467 C 0 0 0 0 0 0 0 0 0 0 0 0

2.6313 -5.2942 -3.3414 C 0 0 0 0 0 0 0 0 0 0 0 0

1.9571 -6.2085 -2.8906 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.7232 1.6395 1.5710 C 0 0 0 0 0 0 0 0 0 16 0 0

-3.3551 2.7693 1.9805 C 0 0 0 0 0 0 0 0 0 17 0 0

-4.7597 3.0727 1.7121 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4506 3.5223 2.6257 C 0 0 0 0 0 0 0 0 0 18 0 0

-2.6639 4.7485 3.1811 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7764 5.7467 3.2737 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.4991 1.7343 1.9428 N 0 0 0 0 0 0 0 0 0 24 0 0

-1.3084 2.8104 2.5958 C 0 0 0 0 0 0 0 0 0 19 0 0

-0.2307 3.0834 3.1066 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.2846 0.6079 0.9163 C 0 0 0 0 0 0 0 0 0 15 0 0

1.0042 3.8088 0.0221 C 0 0 0 0 0 0 0 0 0 1 0 0

1.2518 2.5756 -0.1722 N 0 0 0 0 0 0 0 0 0 21 0 0

2.1588 4.4847 0.0241 C 0 0 0 0 0 0 0 0 0 2 0 0

2.2994 5.9076 0.2793 C 0 0 0 0 0 0 0 0 0 0 0 0

3.1242 3.5897 -0.2393 C 0 0 0 0 0 0 0 0 0 3 0 0

4.4701 3.8136 -0.3550 C 0 0 0 0 0 0 0 0 0 0 0 0

5.0728 4.8579 -0.9364 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.1212 4.2667 0.1607 O 0 0 0 0 0 0 0 0 0 0 0 0

2.5109 2.3785 -0.3487 C 0 0 0 0 0 0 0 0 0 4 0 0

3.1070 1.1997 -0.6138 C 0 0 0 0 0 0 0 0 0 5 0 0

0.5977 0.2102 -0.2640 H 0 0 0 0 0 0 0 0 0 0 0 0

5.3090 -0.9989 -0.5758 H 0 0 0 0 0 0 0 0 0 0 0 0

5.0453 -2.3041 -1.7235 H 0 0 0 0 0 0 0 0 0 0 0 0

4.9239 -0.6474 -2.2752 H 0 0 0 0 0 0 0 0 0 0 0 0

4.0300 -4.9578 -4.4793 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.3997 -1.2768 -0.1791 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1461 -2.9540 0.2573 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.0525 -1.7329 1.5027 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0248 -4.2829 -1.3732 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.6755 -4.1228 -0.9833 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4486 -4.7113 1.0880 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1423 -4.5510 1.4934 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9335 -7.5689 0.2250 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0690 -3.3222 -0.9193 H 0 0 0 0 0 0 0 0 0 0 0 0

1.9621 -4.3520 -0.8415 H 0 0 0 0 0 0 0 0 0 0 0 0

3.6143 -3.9840 -1.1399 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3535 -3.6726 -3.2247 H 0 0 0 0 0 0 0 0 0 0 0 0

3.0304 -3.2462 -3.5091 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.9313 3.0721 0.6334 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1021 4.0374 2.0805 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.3963 2.3104 2.1664 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.5700 4.9449 3.5400 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0376 6.6114 3.6848 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8510 5.6645 2.9281 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8323 1.0997 1.7720 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.2560 0.6848 0.7336 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5899 1.9155 -0.1953 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4923 6.3030 0.8977 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3044 6.4416 -0.6720 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2280 6.1211 0.8124 H 0 0 0 0 0 0 0 0 0 0 0 0

5.0847 3.1213 0.0089 H 0 0 0 0 0 0 0 0 0 0 0 0

6.0628 4.9141 -0.9653 H 0 0 0 0 0 0 0 0 0 0 0 0

4.5616 5.5928 -1.3597 H 0 0 0 0 0 0 0 0 0 0 0 0

4.0855 1.2245 -0.7565 H 0 0 0 0 0 0 0 0 0 0 0 0

7 2 1 0 0 0 0

7 3 2 0 0 0 0

5 1 2 0 0 0 0

2 1 1 0 0 0 0

1 19 1 0 0 0 0

3 5 1 0 0 0 0

3 4 1 0 0 0 0

5 20 1 0 0 0 0

7 43 1 0 0 0 0

8 19 2 0 0 0 0

10 8 1 0 0 0 0

13 8 1 0 0 0 0

33 9 1 0 0 0 0

10 9 2 0 0 0 0

11 9 1 0 0 0 0

11 13 2 0 0 0 0

11 12 1 0 0 0 0

13 14 1 0 0 0 0

14 15 1 0 0 0 0

15 17 1 0 0 0 0

17 16 2 0 0 0 0

17 18 1 0 0 0 0

20 21 1 0 0 0 0

21 22 1 0 0 0 0

22 6 1 0 0 0 0

22 23 2 0 0 0 0

24 30 1 0 0 0 0

25 24 1 0 0 0 0

27 25 2 0 0 0 0

25 26 1 0 0 0 0

27 31 1 0 0 0 0

27 28 1 0 0 0 0

28 29 2 0 0 0 0

30 31 1 0 0 0 0

31 32 2 0 0 0 0

33 24 2 0 0 0 0

41 34 2 0 0 0 0

34 35 1 0 0 0 0

36 34 1 0 0 0 0

35 42 1 0 0 0 0

36 38 2 0 0 0 0

36 37 1 0 0 0 0

38 42 1 0 0 0 0

38 39 1 0 0 0 0

39 40 2 0 0 0 0

42 43 2 0 0 0 0

2 44 1 0 0 0 0

4 45 1 0 0 0 0

4 46 1 0 0 0 0

4 47 1 0 0 0 0

6 48 1 0 0 0 0

12 49 1 0 0 0 0

12 50 1 0 0 0 0

12 51 1 0 0 0 0

14 52 1 0 0 0 0

14 53 1 0 0 0 0

15 54 1 0 0 0 0

15 55 1 0 0 0 0

18 56 1 0 0 0 0

19 57 1 0 0 0 0

20 58 1 0 0 0 0

20 59 1 0 0 0 0

21 60 1 0 0 0 0

21 61 1 0 0 0 0

26 62 1 0 0 0 0

26 63 1 0 0 0 0

26 64 1 0 0 0 0

28 65 1 0 0 0 0

29 66 1 0 0 0 0

29 67 1 0 0 0 0

30 68 1 0 0 0 0

33 69 1 0 0 0 0

35 70 1 0 0 0 0

37 71 1 0 0 0 0

37 72 1 0 0 0 0

37 73 1 0 0 0 0

39 74 1 0 0 0 0

40 75 1 0 0 0 0

40 76 1 0 0 0 0

43 77 1 0 0 0 0

M END): 23 ms

reading 77 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

77 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License

Read full article at Wikipedia

Formula

C33H34N4O6

Net Charge

Average Mass

582.64642

Monoisotopic Mass

582.24783

InChI

InChI=1S/C33H34N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-15,35H,1-2,9-12H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14-,28-15-

InChIKey

QBUVFDKTZJNUPP-BBROENKCSA-N

SMILES

CC1=C(CCC(O)=O)\C(/N=C1/C=C1NC(=O)C(C=C)=C/1C)=C\c1[nH]c(\C=C2NC(=O)C(C)=C/2C=C)c(C)c1CCC(O)=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Homo sapiens (NCBI:txid9606)	See: PubMed

Roles Classification
Biological Role(s):	human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	biliverdin (CHEBI:17033) has role human metabolite (CHEBI:77746) biliverdin (CHEBI:17033) has role mouse metabolite (CHEBI:75771) biliverdin (CHEBI:17033) is a bilins (CHEBI:22869) biliverdin (CHEBI:17033) is conjugate acid of biliverdin(2−) (CHEBI:57991)

Incoming	15,16-dihydrobiliverdin (CHEBI:16790) has functional parent biliverdin (CHEBI:17033) biliverdin hydrochloride (CHEBI:91027) has part biliverdin (CHEBI:17033) biliverdin(2−) (CHEBI:57991) is conjugate base of biliverdin (CHEBI:17033)

IUPAC Name

biliverdin

Synonyms	Sources
8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-3,18-divinylbilin-1(19)(21H,24H)-dione	JCBN
Biliverdin	KEGG COMPOUND
Biliverdin IX alpha	KEGG COMPOUND
Biliverdin IXalpha	KEGG COMPOUND
Biliverdine	ChemIDplus
BILIVERDINE IX ALPHA	PDBeChem

Manual Xrefs	Databases
Biliverdin	Wikipedia
BLA	PDBeChem
C00500	KEGG COMPOUND
DB02073	DrugBank
HMDB0001008	HMDB
View more database links

Registry Numbers	Types	Sources
114-25-0	CAS Registry Number	KEGG COMPOUND
114-25-0	CAS Registry Number	ChemIDplus
74351	Reaxys Registry Number	Reaxys

Citations	Types	Sources
14977878	PubMed citation	Europe PMC
19617398	PubMed citation	Europe PMC

Last Modified

06 December 2017

CHEBI:17033 - biliverdin

ChEBI is part of the ELIXIR infrastructure