2'-deoxyadenosine 5'-monophosphate (CHEBI:17713)

ChEBI > Main

CHEBI:17713 - 2'-deoxyadenosine 5'-monophosphate

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	2'-deoxyadenosine 5'-monophosphate

ChEBI ID	CHEBI:17713

Definition	A purine 2'-deoxyribonucleoside 5'-monophosphate having adenine as the nucleobase.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:40419, CHEBI:40544, CHEBI:40499, CHEBI:40607, CHEBI:40614, CHEBI:40505, CHEBI:41864, CHEBI:41870, CHEBI:41815, CHEBI:10490, CHEBI:19236, CHEBI:14068

Supplier Information	ZINC000003831401

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__592447964881012__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__592447964881012__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:14068","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__592447964881012__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"592447964881012","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__592447964881012__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 07260819223D

starting HoverWatcher_5

Time for openFile(

Marvin 07260819223D

36 38 0 0 0 0 999 V2000

-1.6325 -0.3639 -0.5159 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.4233 -1.0930 -0.4021 C 0 0 0 0 0 0 0 0 0 0 0 0

0.3071 -1.0376 -1.7372 C 0 0 1 0 0 0 0 0 0 0 0 0

0.6145 0.3434 -2.0212 O 0 0 0 0 0 0 0 0 0 0 0 0

1.6340 -1.7885 -1.7136 C 0 0 1 0 0 0 0 0 0 0 0 0

1.9413 -2.2568 -3.0243 O 0 0 0 0 0 0 0 0 0 0 0 0

2.6318 -0.7146 -1.3441 C 0 0 0 0 0 0 0 0 0 0 0 0

2.0443 0.5031 -2.0429 C 0 0 2 0 0 0 0 0 0 0 0 0

2.4120 1.7784 -1.4381 N 0 0 0 0 0 0 0 0 0 0 0 0

1.7628 2.4006 -0.4027 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3288 3.5430 -0.0733 N 0 0 0 0 0 0 0 0 0 0 0 0

3.3923 3.6695 -0.9320 C 0 0 0 0 0 0 0 0 0 0 0 0

4.3641 4.6525 -1.0824 C 0 0 0 0 0 0 0 0 0 0 0 0

4.3694 5.7893 -0.2561 N 0 0 0 0 0 0 0 0 0 0 0 0

5.3111 4.5010 -2.0394 N 0 0 0 0 0 0 0 0 0 0 0 0

5.2544 3.3844 -2.8056 C 0 0 0 0 0 0 0 0 0 0 0 0

4.3668 2.3673 -2.7558 N 0 0 0 0 0 0 0 0 0 0 0 0

3.4611 2.5822 -1.7895 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6024 -0.2694 0.7771 P 0 0 2 0 0 0 0 0 0 0 0 0

-3.8605 0.5214 0.5690 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.6279 0.2767 1.9466 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.8278 -1.8204 1.1745 O 0 0 0 0 0 0 0 0 0 0 0 0

1.7886 -1.5127 -3.6260 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6456 -2.6488 -1.0391 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6392 -0.5664 -0.2570 H 0 0 0 0 0 0 0 0 0 0 0 0

3.6537 -0.9180 -1.6772 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3636 0.5634 -3.0887 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3563 -1.4015 -2.5293 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1920 -0.6473 0.3801 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6518 -2.1278 -0.1427 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0115 0.4830 2.8261 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.4647 -2.0396 1.8872 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8872 1.9736 0.0679 H 0 0 0 0 0 0 0 0 0 0 0 0

6.0271 3.2966 -3.5612 H 0 0 0 0 0 0 0 0 0 0 0 0

4.8234 5.7477 0.6365 H 0 0 0 0 0 0 0 0 0 0 0 0

3.8408 6.5970 -0.5267 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 19 1 0 0 0 0

2 3 1 0 0 0 0

2 29 1 0 0 0 0

2 30 1 0 0 0 0

3 4 1 0 0 0 0

3 5 1 0 0 0 0

3 28 1 0 0 0 0

4 8 1 0 0 0 0

5 6 1 0 0 0 0

5 7 1 0 0 0 0

5 24 1 0 0 0 0

6 23 1 0 0 0 0

7 8 1 0 0 0 0

7 25 1 0 0 0 0

7 26 1 0 0 0 0

8 9 1 0 0 0 0

8 27 1 0 0 0 0

9 10 4 0 0 0 0

9 18 4 0 0 0 0

10 11 4 0 0 0 0

10 33 1 0 0 0 0

11 12 4 0 0 0 0

12 13 4 0 0 0 0

12 18 4 0 0 0 0

13 14 1 0 0 0 0

13 15 4 0 0 0 0

14 35 1 0 0 0 0

14 36 1 0 0 0 0

15 16 4 0 0 0 0

16 17 4 0 0 0 0

16 34 1 0 0 0 0

17 18 4 0 0 0 0

19 20 2 0 0 0 0

19 21 1 0 0 0 0

19 22 1 0 0 0 0

21 31 1 0 0 0 0

22 32 1 0 0 0 0

M END): 19 ms

reading 36 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

36 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Pyrvinium (Viprynium) is an anthelmintic effective for pinworms. Several forms of pyrvinium have been prepared with variable counter anions, such as halides, tosylate, triflate and pamoate. Pyrvinium was identified as a potent Wnt inhibitor, acting through activation of Casein kinase CK1α. Pyrvinium salts can also inhibit the growth of cancer cells. More specifically, the pamoate salt has been shown to have preferential toxicity for various cancer cell lines during glucose starvation.
Read full article at Wikipedia

Formula

C10H14N5O6P

Net Charge

Average Mass

331.22202

Monoisotopic Mass

331.06817

InChI

InChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1

InChIKey

KHWCHTKSEGGWEX-RRKCRQDMSA-N

SMILES

Nc1ncnc2n(cnc12)[C@H]1C[C@H](O)[C@@H](COP(O)(O)=O)O1

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	fundamental metabolite Any metabolite produced by all living cells.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) has role fundamental metabolite (CHEBI:78675) 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) is a 2'-deoxyadenosine 5'-phosphate (CHEBI:19237) 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) is a purine 2'-deoxyribonucleoside 5'-monophosphate (CHEBI:36993) 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) is conjugate acid of 2'-deoxyadenosine 5'-monophosphate(2−) (CHEBI:58245)

Incoming	8,5'-cyclo-2'-deoxyadenosine monophosphate (CHEBI:131827) has functional parent 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) 8-hydroxy-dAMP (CHEBI:70964) has functional parent 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) 8-oxo-dAMP (CHEBI:71403) has functional parent 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) N⁶-carbamoylmethyl-2'-deoxyadenosine 5'-monophosphate (CHEBI:103067) has functional parent 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) 2'-deoxyadenosine 5'-monophosphate(2−) (CHEBI:58245) is conjugate base of 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) 2'-deoxyadenosine 5'-monophosphate residue (CHEBI:50323) is substituent group from 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) dAMP 3'-end residue (CHEBI:53113) is substituent group from 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) dAMP 5'-end residue (CHEBI:53099) is substituent group from 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713)

IUPAC Name

2'-deoxy-5'-adenylic acid

Synonyms	Sources
2'-dAMP	ChemIDplus
2'-deoxy-5'-adenosine monophosphate	ChemIDplus
2'-deoxy-AMP	ChemIDplus
2'-deoxyadenosine 5'-(dihydrogen phosphate)	ChemIDplus
2'-deoxyadenosine 5'-monophosphate	ChEBI
2'-Deoxyadenosine 5'-monophosphate	KEGG COMPOUND
2'-Deoxyadenosine 5'-phosphate	KEGG COMPOUND
2'-deoxyadenosine monophosphate	ChemIDplus
2'-DEOXYADENOSINE-5'-MONOPHOSPHATE	PDBeChem
2'-deoxyadenylic acid	ChemIDplus
dAMP	KEGG COMPOUND
deoxy-5'-adenylic acid	ChemIDplus
deoxy-AMP	ChemIDplus
deoxyadenosine 5'-monophosphate	ChemIDplus
deoxyadenosine 5'-phosphate	ChemIDplus
Deoxyadenosine monophosphate	KEGG COMPOUND
Deoxyadenylic acid	KEGG COMPOUND

Manual Xrefs	Databases
A3A	PDBeChem
C00360	KEGG COMPOUND
DAMP	MetaCyc
Deoxyadenosine_monophosphate	Wikipedia
HMDB0000905	HMDB
View more database links

Registry Numbers	Types	Sources
56028	Reaxys Registry Number	Reaxys
653-63-4	CAS Registry Number	ChemIDplus

Citation	Type	Source
8645724	PubMed citation	Europe PMC

Last Modified

13 November 2017

CHEBI:17713 - 2'-deoxyadenosine 5'-monophosphate

ChEBI is part of the ELIXIR infrastructure