octanoyl-CoA (CHEBI:15533)

ChEBI > Main

CHEBI:15533 - octanoyl-CoA

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	octanoyl-CoA

ChEBI ID	CHEBI:15533

Definition	A medium-chain fatty acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of octanoic acid.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:41542, CHEBI:7724, CHEBI:14681, CHEBI:25651

Supplier Information	ZINC000096014975

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__9469709893509943__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__9469709893509943__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:15533","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__9469709893509943__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"9469709893509943","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__9469709893509943__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

CO8 - Ideal conformer

Mrv1927 06092110113D

starting HoverWatcher_5

Time for openFile(CO8 - Ideal conformer

Mrv1927 06092110113D

107109 0 0 0 0 999 V2000

2.4480 -4.7780 -12.2760 N 0 0 0 0 0 0 0 0 0 0 0 0

3.2150 -3.7180 -12.0990 C 0 0 0 0 0 0 0 0 0 0 0 0

2.9210 -2.7700 -11.2340 N 0 0 0 0 0 0 0 0 0 0 0 0

1.8170 -2.8440 -10.4970 C 0 0 0 0 0 0 0 0 0 0 0 0

0.9710 -3.9560 -10.6450 C 0 0 0 0 0 0 0 0 0 0 0 0

1.3270 -4.9420 -11.5810 C 0 0 0 0 0 0 0 0 0 0 0 0

0.5300 -6.0560 -11.7740 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.0610 -3.7880 -9.7850 N 0 0 0 0 0 0 0 0 0 0 0 0

0.0950 -2.6740 -9.1310 C 0 0 0 0 0 0 0 0 0 0 0 0

1.2420 -2.0560 -9.5320 N 0 0 0 0 0 0 0 0 0 0 0 0

1.7610 -0.7820 -9.0300 C 0 0 1 0 0 0 0 0 0 0 0 0

1.1310 0.4080 -9.7970 C 0 0 2 0 0 0 0 0 0 0 0 0

1.8640 0.6910 -10.9900 O 0 0 0 0 0 0 0 0 0 0 0 0

1.2730 1.5650 -8.7730 C 0 0 2 0 0 0 0 0 0 0 0 0

2.4250 2.3560 -9.0690 O 0 0 0 0 0 0 0 0 0 0 0 0

1.9070 3.8610 -9.3110 P 0 0 1 0 0 5 0 0 0 0 0 0

1.2320 4.3530 -8.0880 O 0 0 0 0 0 0 0 0 0 0 0 0

3.1610 4.8120 -9.6510 O 0 0 0 0 0 0 0 0 0 0 0 0

0.8690 3.8810 -10.5410 O 0 0 0 0 0 0 0 0 0 0 0 0

1.4350 0.8480 -7.4190 C 0 0 2 0 0 0 0 0 0 0 0 0

1.3420 -0.5640 -7.6660 O 0 0 0 0 0 0 0 0 0 0 0 0

0.3220 1.2830 -6.4630 C 0 0 2 0 0 0 0 0 0 0 0 0

0.4770 0.6090 -5.2130 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.7190 1.1110 -4.2620 P 0 0 1 0 0 5 0 0 0 0 0 0

-0.6250 2.5770 -4.0820 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.1330 0.7440 -4.9380 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.6060 0.3870 -2.8280 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.8270 0.9330 -1.9330 P 0 0 1 0 0 5 0 0 0 0 0 0

-1.7160 2.4020 -1.7890 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.2230 0.5690 -2.6490 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7750 0.2460 -0.4780 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.8870 0.1530 1.6650 C 0 0 2 0 0 0 0 0 0 0 0 0

-2.8780 0.7690 0.2650 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.5800 0.4980 2.3820 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.0220 -1.3660 1.5540 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.0680 0.7130 2.4610 C 0 0 1 0 0 0 0 0 0 0 0 0

-5.2790 0.4920 1.7350 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.1490 0.0180 3.7960 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.0150 -0.8070 3.9980 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.2600 0.3130 4.7640 N 0 0 0 0 0 0 0 0 0 0 0 0

-3.3260 -0.3760 6.0550 C 0 0 2 0 0 0 0 0 0 0 0 0

-2.2120 0.1400 6.9680 C 0 0 2 0 0 0 0 0 0 0 0 0

-2.2810 -0.5690 8.2950 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.1360 -1.4060 8.4920 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.3920 -0.2740 9.2640 N 0 0 0 0 0 0 0 0 0 0 0 0

-1.4580 -0.9640 10.5540 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.3440 -0.4470 11.4670 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.4270 -1.2990 13.0620 S 0 0 0 0 0 0 0 0 0 0 0 0

0.8880 -0.5540 13.8650 C 0 0 0 0 0 0 0 0 0 0 0 0

1.5450 0.2920 13.2970 O 0 0 0 0 0 0 0 0 0 0 0 0

1.2300 -0.9510 15.2780 C 0 0 2 0 0 0 0 0 0 0 0 0

2.4360 -0.1410 15.7570 C 0 0 2 0 0 0 0 0 0 0 0 0

2.7840 -0.5440 17.1920 C 0 0 2 0 0 0 0 0 0 0 0 0

3.9900 0.2650 17.6710 C 0 0 2 0 0 0 0 0 0 0 0 0

4.3370 -0.1360 19.1060 C 0 0 2 0 0 0 0 0 0 0 0 0

5.5440 0.6720 19.5850 C 0 0 2 0 0 0 0 0 0 0 0 0

5.8910 0.2700 21.0200 C 0 0 0 0 0 0 0 0 0 0 0 0

4.1170 -3.6250 -12.6850 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7870 -6.7300 -12.4230 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2850 -6.1640 -11.2600 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.5820 -2.2950 -8.3810 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8480 -0.7550 -9.1070 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0830 0.2130 -10.0230 H 0 0 0 0 0 0 0 0 0 0 0 0

1.8130 -0.0990 -11.5440 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3760 2.1850 -8.7720 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8070 5.7020 -9.7880 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3470 3.5540 -11.3160 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4080 1.0860 -6.9880 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6450 1.0320 -6.8950 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3810 2.3600 -6.3040 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1540 -0.2170 -5.0370 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2550 -0.3940 -2.7230 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.8090 0.5230 -0.2450 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7830 1.8520 0.3440 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5460 1.5700 2.5790 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5280 -0.0450 3.3250 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.7360 0.2170 1.7530 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9530 -1.6110 1.0430 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1800 -1.7640 0.9870 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0280 -1.8040 2.5510 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9270 1.7830 2.6160 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.3650 -0.4630 1.6190 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5760 0.9820 4.6070 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2020 -1.4480 5.9010 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.2940 -0.1860 6.5190 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.3370 1.2120 7.1220 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2450 -0.0490 6.5030 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.7070 0.3950 9.1060 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.3340 -2.0360 10.4000 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4260 -0.7740 11.0190 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.4690 0.6240 11.6210 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6220 -0.6370 11.0030 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4700 -2.0140 15.3100 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3770 -0.7520 15.9280 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1960 0.9210 15.7260 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2890 -0.3400 15.1080 H 0 0 0 0 0 0 0 0 0 0 0 0

3.0240 -1.6060 17.2230 H 0 0 0 0 0 0 0 0 0 0 0 0

1.9310 -0.3440 17.8420 H 0 0 0 0 0 0 0 0 0 0 0 0

3.7500 1.3280 17.6400 H 0 0 0 0 0 0 0 0 0 0 0 0

4.8420 0.0660 17.0220 H 0 0 0 0 0 0 0 0 0 0 0 0

4.5770 -1.1990 19.1370 H 0 0 0 0 0 0 0 0 0 0 0 0

3.4850 0.0620 19.7560 H 0 0 0 0 0 0 0 0 0 0 0 0

5.3040 1.7350 19.5540 H 0 0 0 0 0 0 0 0 0 0 0 0

6.3960 0.4730 18.9360 H 0 0 0 0 0 0 0 0 0 0 0 0

6.7500 0.8470 21.3610 H 0 0 0 0 0 0 0 0 0 0 0 0

5.0390 0.4690 21.6690 H 0 0 0 0 0 0 0 0 0 0 0 0

6.1310 -0.7920 21.0510 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 6 1 0 0 0 0

2 3 1 0 0 0 0

2 58 1 0 0 0 0

3 4 2 0 0 0 0

4 5 1 0 0 0 0

4 10 1 0 0 0 0

5 6 2 0 0 0 0

5 8 1 0 0 0 0

6 7 1 0 0 0 0

7 59 1 0 0 0 0

7 60 1 0 0 0 0

8 9 2 0 0 0 0

9 10 1 0 0 0 0

9 61 1 0 0 0 0

10 11 1 0 0 0 0

11 12 1 0 0 0 0

11 21 1 0 0 0 0

11 62 1 1 0 0 0

12 13 1 0 0 0 0

12 14 1 0 0 0 0

12 63 1 6 0 0 0

13 64 1 0 0 0 0

14 15 1 0 0 0 0

14 20 1 0 0 0 0

14 65 1 1 0 0 0

15 16 1 0 0 0 0

16 17 2 0 0 0 0

16 18 1 0 0 0 0

16 19 1 0 0 0 0

18 66 1 0 0 0 0

19 67 1 0 0 0 0

20 21 1 0 0 0 0

20 22 1 0 0 0 0

20 68 1 1 0 0 0

22 23 1 0 0 0 0

22 69 1 0 0 0 0

22 70 1 0 0 0 0

24 23 1 6 0 0 0

24 25 2 0 0 0 0

24 26 1 0 0 0 0

24 27 1 0 0 0 0

26 71 1 0 0 0 0

28 27 1 6 0 0 0

28 29 2 0 0 0 0

28 30 1 0 0 0 0

28 31 1 0 0 0 0

30 72 1 0 0 0 0

31 33 1 0 0 0 0

32 33 1 0 0 0 0

32 34 1 0 0 0 0

32 35 1 0 0 0 0

32 36 1 0 0 0 0

33 73 1 0 0 0 0

33 74 1 0 0 0 0

34 75 1 0 0 0 0

34 76 1 0 0 0 0

34 77 1 0 0 0 0

35 78 1 0 0 0 0

35 79 1 0 0 0 0

35 80 1 0 0 0 0

36 37 1 0 0 0 0

36 38 1 0 0 0 0

36 81 1 1 0 0 0

37 82 1 0 0 0 0

38 39 2 0 0 0 0

38 40 1 0 0 0 0

40 41 1 0 0 0 0

40 83 1 0 0 0 0

41 42 1 0 0 0 0

41 84 1 0 0 0 0

41 85 1 0 0 0 0

42 43 1 0 0 0 0

42 86 1 0 0 0 0

42 87 1 0 0 0 0

43 44 2 0 0 0 0

43 45 1 0 0 0 0

45 46 1 0 0 0 0

45 88 1 0 0 0 0

46 47 1 0 0 0 0

46 89 1 0 0 0 0

46 90 1 0 0 0 0

47 48 1 0 0 0 0

47 91 1 0 0 0 0

47 92 1 0 0 0 0

48 49 1 0 0 0 0

49 50 2 0 0 0 0

49 51 1 0 0 0 0

51 52 1 0 0 0 0

51 93 1 0 0 0 0

51 94 1 0 0 0 0

52 53 1 0 0 0 0

52 95 1 0 0 0 0

52 96 1 0 0 0 0

53 54 1 0 0 0 0

53 97 1 0 0 0 0

53 98 1 0 0 0 0

54 55 1 0 0 0 0

54 99 1 0 0 0 0

54100 1 0 0 0 0

55 56 1 0 0 0 0

55101 1 0 0 0 0

55102 1 0 0 0 0

56 57 1 0 0 0 0

56103 1 0 0 0 0

56104 1 0 0 0 0

57105 1 0 0 0 0

57106 1 0 0 0 0

57107 1 0 0 0 0

M END): 26 ms

reading 107 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

107 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Octanoyl-coenzyme A is the endpoint of beta oxidation in peroxisomes. It is produced alongside acetyl-CoA and transferred to the mitochondria to be further oxidized into acetyl-CoA.
Read full article at Wikipedia

Formula

C29H50N7O17P3S

Net Charge

Average Mass

893.730

Monoisotopic Mass

893.21968

InChI

InChI=1S/C29H50N7O17P3S/c1-4-5-6-7-8-9-20(38)57-13-12-31-19(37)10-11-32-27(41)24(40)29(2,3)15-50-56(47,48)53-55(45,46)49-14-18-23(52-54(42,43)44)22(39)28(51-18)36-17-35-21-25(30)33-16-34-26(21)36/h16-18,22-24,28,39-40H,4-15H2,1-3H3,(H,31,37)(H,32,41)(H,45,46)(H,47,48)(H2,30,33,34)(H2,42,43,44)/t18-,22-,23-,24+,28-/m1/s1

InChIKey

KQMZYOXOBSXMII-CECATXLMSA-N

SMILES

CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)N1C=NC2=C1N=CN=C2N

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Chemical Role(s):	acyl donor Any donor that can transfer acyl groups between molecular entities. (via acyl-CoA )

Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	octanoyl-CoA (CHEBI:15533) has functional parent octanoic acid (CHEBI:28837) octanoyl-CoA (CHEBI:15533) has role Escherichia coli metabolite (CHEBI:76971) octanoyl-CoA (CHEBI:15533) has role mouse metabolite (CHEBI:75771) octanoyl-CoA (CHEBI:15533) is a medium-chain fatty acyl-CoA (CHEBI:61907) octanoyl-CoA (CHEBI:15533) is a saturated fatty acyl-CoA (CHEBI:231546) octanoyl-CoA (CHEBI:15533) is conjugate acid of octanoyl-CoA(4−) (CHEBI:57386)

Incoming	(R)-3-hydroxyoctanoyl-CoA (CHEBI:28573) has functional parent octanoyl-CoA (CHEBI:15533) (S)-3-hydroxyoctanoyl-CoA (CHEBI:28632) has functional parent octanoyl-CoA (CHEBI:15533) 3-oxooctanoyl-CoA (CHEBI:28264) has functional parent octanoyl-CoA (CHEBI:15533) 3-thiaoctanoyl-CoA (CHEBI:41611) has functional parent octanoyl-CoA (CHEBI:15533) 7-methyl-3-oxooctanoyl-CoA (CHEBI:15506) has functional parent octanoyl-CoA (CHEBI:15533) octanoyl-CoA(4−) (CHEBI:57386) is conjugate base of octanoyl-CoA (CHEBI:15533)

IUPAC Name

3'-phosphoadenosine 5'-(3-{(3R)-3-hydroxy-2,2-dimethyl-4-[(3-{[2-(octanoylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-4-oxobutyl} dihydrogen diphosphate)

Synonyms	Sources
8:0-CoA	ChEBI
C8:0-CoA	ChEBI
capryloyl-CoA	ChEBI
capryloyl-coenzyme A	ChEBI
Coenzyme A, S-octanoate	ChemIDplus
n-octanoyl-CoA	ChEBI
Octanoyl-CoA	KEGG COMPOUND
Octanoyl-coa	ChemIDplus
Octanoyl-coenzyme A	ChemIDplus
octanoylcoenzyme A	ChEBI
octylyl-CoA	ChEBI
octylyl-coenzyme A	ChEBI

Manual Xrefs	Databases
393007	ChemSpider
c0048	UM-BBD
C01944	KEGG COMPOUND
CO8	PDBeChem
DB02910	DrugBank
FDB022409	FooDB
HMDB0001070	HMDB
Octanoyl-CoA	Wikipedia
View more database links

Registry Numbers	Types	Sources
1264-52-4	CAS Registry Number	ChemIDplus
6562085	Beilstein Registry Number	Beilstein
8033230	Reaxys Registry Number	Reaxys

Citations

Aso Y, Nomura Y, Sano M, Sato R, Tanaka T, Ohara H, Matsumoto K, Wada K (2021)
Caprylic acid enhances hydroxyhexylitaconic acid production in Aspergillus niger S17-5.
Journal of applied microbiology 130, 1972-1980 [PubMed:33064909]
[show Abstract]

Zhong L, Diao X, Zhang N, Li F, Zhou H, Chen H, Bai X, Ren X, Zhang Y, Wu D, Bian X (2021)
Engineering and elucidation of the lipoinitiation process in nonribosomal peptide biosynthesis.
Nature communications 12, 296 [PubMed:33436600]
[show Abstract]

Huang CM, Lyu SY, Lin KH, Chen CL, Chen MH, Shih HW, Hsu NS, Lo IW, Wang YL, Li YS, Wu CJ, Li TL (2019)
Teicoplanin Reprogrammed with the N-Acyl-Glucosamine Pharmacophore at the Penultimate Residue of Aglycone Acquires Broad-Spectrum Antimicrobial Activities Effectively Killing Gram-Positive and -Negative Pathogens.
ACS infectious diseases 5, 430-442 [PubMed:30599088]
[show Abstract]

Sathyanarayanan N, Cannone G, Gakhar L, Katagihallimath N, Sowdhamini R, Ramaswamy S, Vinothkumar KR (2019)
Molecular basis for metabolite channeling in a ring opening enzyme of the phenylacetate degradation pathway.
Nature communications 10, 4127 [PubMed:31511507]
[show Abstract]

Chacón MG, Kendrick EG, Leak DJ (2019)
Engineering Escherichia coli for the production of butyl octanoate from endogenous octanoyl-CoA.
PeerJ 7, e6971 [PubMed:31304053]
[show Abstract]

Kiema TR, Thapa CJ, Laitaoja M, Schmitz W, Maksimainen MM, Fukao T, Rouvinen J, Jänis J, Wierenga RK (2019)
The peroxisomal zebrafish SCP2-thiolase (type-1) is a weak transient dimer as revealed by crystal structures and native mass spectrometry.
The Biochemical journal 476, 307-332 [PubMed:30573650]
[show Abstract]

Onwukwe GU, Koski MK, Pihko P, Schmitz W, Wierenga RK (2015)
Structures of yeast peroxisomal Δ(3),Δ(2)-enoyl-CoA isomerase complexed with acyl-CoA substrate analogues: the importance of hydrogen-bond networks for the reactivity of the catalytic base and the oxyanion hole.
Acta crystallographica. Section D, Biological crystallography 71, 2178-2191 [PubMed:26527136]
[show Abstract]

Lyu SY, Liu YC, Chang CY, Huang CJ, Chiu YH, Huang CM, Hsu NS, Lin KH, Wu CJ, Tsai MD, Li TL (2014)
Multiple complexes of long aliphatic N-acyltransferases lead to synthesis of 2,6-diacylated/2-acyl-substituted glycopeptide antibiotics, effectively killing vancomycin-resistant enterococcus.
Journal of the American Chemical Society 136, 10989-10995 [PubMed:25095906]
[show Abstract]

Ohgusu H, Shirouzu K, Nakamura Y, Nakashima Y, Ida T, Sato T, Kojima M (2009)
Ghrelin O-acyltransferase (GOAT) has a preference for n-hexanoyl-CoA over n-octanoyl-CoA as an acyl donor.
Biochemical and biophysical research communications 386, 153-158 [PubMed:19501572]
[show Abstract]

Partanen ST, Novikov DK, Popov AN, Mursula AM, Hiltunen JK, Wierenga RK (2004)
The 1.3 A crystal structure of human mitochondrial Delta3-Delta2-enoyl-CoA isomerase shows a novel mode of binding for the fatty acyl group.
Journal of molecular biology 342, 1197-1208 [PubMed:15351645]
[show Abstract]

Hashimoto F, Furuya Y, Hayashi H (2001)
Accumulation of medium chain acyl-CoAs during beta-oxidation of long chain fatty acid by isolated peroxisomes from rat liver.
Biological & pharmaceutical bulletin 24, 600-606 [PubMed:11411544]
[show Abstract]

Engel CK, Kiema TR, Hiltunen JK, Wierenga RK (1998)
The crystal structure of enoyl-CoA hydratase complexed with octanoyl-CoA reveals the structural adaptations required for binding of a long chain fatty acid-CoA molecule.
Journal of molecular biology 275, 847-859 [PubMed:9480773]
[show Abstract]

Engel CK, Kiema TR, Hiltunen JK, Wierenga RK (1998)
The Crystal Structure of Enoyl-CoA Hydratase Complexed with Octanoyl-CoA Reveals the Structural Adaptations Required for Binding of a Long Chain Fatty Acid-CoA Molecule
Journal of molecular biology 275, 859-847 [PubMed:9514714]
[show Abstract]

Lee HJ, Wang M, Paschke R, Nandy A, Ghisla S, Kim JJ (1996)
Crystal structures of the wild type and the Glu376Gly/Thr255Glu mutant of human medium-chain acyl-CoA dehydrogenase: influence of the location of the catalytic base on substrate specificity.
Biochemistry 35, 12412-12420 [PubMed:8823176]
[show Abstract]

Kumar NR, Srivastava DK (1994)
Reductive half-reaction of medium-chain fatty acyl-CoA dehydrogenase utilizing octanoyl-CoA/octenoyl-CoA as a physiological substrate/product pair: similarity in the microscopic pathways of octanoyl-CoA oxidation and octenoyl-CoA binding.
Biochemistry 33, 8833-8841 [PubMed:8038175]
[show Abstract]

Cummings JG, Thorpe C (1993)
Stereoselective interaction of 2-halo-acyl-CoA derivatives with medium chain acyl-CoA dehydrogenase from pig kidney.
Archives of biochemistry and biophysics 302, 85-91 [PubMed:8470910]
[show Abstract]

Kim JJ, Wang M, Paschke R (1993)
Crystal structures of medium-chain acyl-CoA dehydrogenase from pig liver mitochondria with and without substrate.
Proceedings of the National Academy of Sciences of the United States of America 90, 7523-7527 [PubMed:8356049]
[show Abstract]

Moore KH, Decker BP, Schreefel FP (1988)
Hepatic hydrolysis of octanoyl-CoA and valproyl-CoA in control and valproate-fed animals.
The International journal of biochemistry 20, 175-178 [PubMed:2895026]
[show Abstract]

Saggerson ED (1982)
Carnitine acyltransferase activities in rat liver and heart measured with palmitoyl-CoA and octanoyl-CoA. Latency, effects of K+, bivalent metal ions and malonyl-CoA.
The Biochemical journal 202, 397-405 [PubMed:7092822]
[show Abstract]

Kunau WH, Dommes P (1978)
Degradation of unsaturated fatty acids. Identification of intermediates in the degradation of cis-4-decenoly-CoA by extracts of beef-liver mitochondria.
European journal of biochemistry 91, 533-544 [PubMed:729581]
[show Abstract]

Stewart HB, Tubbs PK, Stanley KK (1973)
Intermediates in fatty acid oxidation.
The Biochemical journal 132, 61-76 [PubMed:4722901]
[show Abstract]

Graham AB, Park MV (1969)
A product-inhibition study of the mechanism of mitochondrial octanoly-coenzyme A synthetase.
The Biochemical journal 111, 257-262 [PubMed:4304157]
[show Abstract]

Kusaka T, Goldman DS (1967)
Column chromatographic purification of octanoyl-CoA.
Analytical biochemistry 19, 294-299 [PubMed:6048700]

Last Modified

07 June 2024

ChEBI

CHEBI:15533 - octanoyl-CoA

Aim

Methods and results

Conclusions

Significance and impact of the study

ChEBI is part of the ELIXIR infrastructure