2'-deoxyuridine (CHEBI:16450)

ChEBI > Main

CHEBI:16450 - 2'-deoxyuridine

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	2'-deoxyuridine

ChEBI ID	CHEBI:16450

Definition	A pyrimidine 2'-deoxyribonucleoside having uracil as the nucleobase.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:11398, CHEBI:42178, CHEBI:46165, CHEBI:46289, CHEBI:46293, CHEBI:4434, CHEBI:11572, CHEBI:14123, CHEBI:19261, CHEBI:23640, CHEBI:29113

Supplier Information	ChemicalBook:CB4919515, ZINC000004228260

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__448856917842826__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__448856917842826__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:16450","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__448856917842826__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"448856917842826","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__448856917842826__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 02091110563D

starting HoverWatcher_5

Time for openFile(

Marvin 02091110563D

27 28 0 0 0 0 999 V2000

0.4064 -1.3956 1.4804 H 0 0 0 0 0 0 0 0 0 0 0 0

3.5992 0.3236 -1.3100 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8160 -2.5465 0.1627 H 0 0 0 0 0 0 0 0 0 0 0 0

4.5413 0.5315 0.1858 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4731 -0.4899 -0.5150 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.4768 0.1682 0.7787 C 0 0 0 0 0 0 0 0 0 0 0 0

0.9353 -1.5296 0.5368 C 0 0 0 0 0 0 0 0 0 0 0 0

2.4378 -1.1577 0.6808 C 0 0 2 0 0 0 0 0 0 0 0 0

-3.6308 0.2139 -0.1254 C 0 0 0 0 0 0 0 0 0 0 0 0

2.4142 0.3739 0.4883 C 0 0 1 0 0 0 0 0 0 0 0 0

-3.1079 -0.2285 -1.3644 C 0 0 0 0 0 0 0 0 0 0 0 0

3.6264 0.8121 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7809 -0.4515 -1.4754 C 0 0 0 0 0 0 0 0 0 0 0 0

0.7154 -0.8350 -1.5201 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1458 0.7061 1.7678 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8092 -1.4206 1.6712 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4291 0.8688 1.4594 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.7617 -0.3853 -2.2096 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3737 2.4635 -1.0362 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.3639 -0.7889 -2.4128 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9667 -0.2475 -0.3948 N 0 0 0 0 0 0 0 0 0 0 0 0

-2.7950 0.4031 0.9157 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.7352 0.3432 1.7263 O 0 0 0 0 0 0 0 0 0 0 0 0

3.2177 -1.7891 -0.3365 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.8243 0.4213 -0.0009 O 0 0 0 0 0 0 0 0 0 0 0 0

1.2073 0.7060 -0.2079 O 0 0 0 0 0 0 0 0 0 0 0 0

3.5947 2.2297 -0.5131 O 0 0 0 0 0 0 0 0 0 0 0 0

5 7 1 0 0 0 0

5 14 1 0 0 0 0

5 21 1 0 0 0 0

5 26 1 0 0 0 0

6 23 2 0 0 0 0

7 1 1 0 0 0 0

7 3 1 0 0 0 0

7 8 1 0 0 0 0

8 10 1 0 0 0 0

8 16 1 0 0 0 0

8 24 1 0 0 0 0

9 11 1 0 0 0 0

9 25 2 0 0 0 0

10 12 1 0 0 0 0

10 17 1 0 0 0 0

10 26 1 0 0 0 0

11 13 2 0 0 0 0

11 18 1 0 0 0 0

12 2 1 0 0 0 0

12 4 1 0 0 0 0

12 27 1 0 0 0 0

13 20 1 0 0 0 0

21 6 1 0 0 0 0

21 13 1 0 0 0 0

22 6 1 0 0 0 0

22 9 1 0 0 0 0

22 15 1 0 0 0 0

27 19 1 0 0 0 0

M END): 18 ms

reading 27 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

27 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Flavin mononucleotide (FMN), or riboflavin-5′-phosphate, is a biomolecule produced from riboflavin (vitamin B2) by the enzyme riboflavin kinase and functions as the prosthetic group of various oxidoreductases, including NADH dehydrogenase, as well as a cofactor in biological blue-light photo receptors. During the catalytic cycle, various oxidoreductases induce reversible interconversions between the oxidized (FMN), semiquinone (FMNH•), and reduced (FMNH2) forms of the isoalloxazine core. FMN is a stronger oxidizing agent than NAD and is particularly useful because it can take part in both one- and two-electron transfers. In its role as blue-light photo receptor, (oxidized) FMN stands out from the 'conventional' photo receptors as the signaling state and not an E/Z isomerization. It is the principal form in which riboflavin is found in cells and tissues. It requires more energy to produce, but is more soluble than riboflavin. In cells, FMN occurs freely circulating but also in several covalently bound forms. Covalently or non-covalently bound FMN is a cofactor of many enzymes playing an important pathophysiological role in cellular metabolism. For example dissociation of flavin mononucleotide from mitochondrial complex I has been shown to occur during ischemia/reperfusion brain injury during stroke.
Read full article at Wikipedia

Formula

C9H12N2O5

Net Charge

Average Mass

228.20200

Monoisotopic Mass

228.07462

InChI

InChI=1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1

InChIKey

MXHRCPNRJAMMIM-SHYZEUOFSA-N

SMILES

OC[C@H]1O[C@H](C[C@@H]1O)n1ccc(=O)[nH]c1=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Saccharomyces cerevisiae (NCBI:txid4932)	Source: yeast.sf.net See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: DOI

Roles Classification
Biological Role(s):	mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	2'-deoxyuridine (CHEBI:16450) has functional parent uracil (CHEBI:17568) 2'-deoxyuridine (CHEBI:16450) has role Escherichia coli metabolite (CHEBI:76971) 2'-deoxyuridine (CHEBI:16450) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) 2'-deoxyuridine (CHEBI:16450) has role human metabolite (CHEBI:77746) 2'-deoxyuridine (CHEBI:16450) has role mouse metabolite (CHEBI:75771) 2'-deoxyuridine (CHEBI:16450) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255)

Incoming	2'-deoxy-5-(4,5-dihydroxypentyl)uridine (CHEBI:132191) has functional parent 2'-deoxyuridine (CHEBI:16450) 5,6-dihydroxy-2'-deoxyuridine (CHEBI:132189) has functional parent 2'-deoxyuridine (CHEBI:16450) 5-(2-aminoethyl)-2'-deoxyuridine (CHEBI:142166) has functional parent 2'-deoxyuridine (CHEBI:16450)

IUPAC Name

1-(2-deoxy-β-D-erythro-pentofuranosyl)uracil

Synonyms	Sources
2'-Deoxyuridine	KEGG COMPOUND
2'-deoxyuridine	UniProt
2-Deoxyuridine	KEGG COMPOUND
Deoxyuridine	KEGG COMPOUND
dU	ChEBI

Manual Xrefs	Databases
C00019697	KNApSAcK
C00526	KEGG COMPOUND
DB02256	DrugBank
Deoxyuridine	Wikipedia
DEOXYURIDINE	MetaCyc
DUR	PDBeChem
HMDB0000012	HMDB
View more database links

Registry Numbers	Types	Sources
24433	Reaxys Registry Number	Reaxys
951-78-0	CAS Registry Number	KEGG COMPOUND

Citation	Type	Source
24463401	PubMed citation	Europe PMC

Last Modified

11 January 2019

CHEBI:16450 - 2'-deoxyuridine

ChEBI is part of the ELIXIR infrastructure