erythro-5-hydroxy-L-lysine (CHEBI:18040)

ChEBI > Main

CHEBI:18040 - erythro-5-hydroxy-L-lysine

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	erythro-5-hydroxy-L-lysine

ChEBI ID	CHEBI:18040

ChEBI ASCII Name	erythro-5-hydroxy-L-lysine

Definition	A 5-hydroxylysine consisting of L-lysine having an (R)-hydroxy group at the 5-position.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:20576, CHEBI:43764, CHEBI:12132

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__026461864891055__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__026461864891055__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:18040","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__026461864891055__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"026461864891055","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__026461864891055__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09130719253D

starting HoverWatcher_5

Time for openFile(

Marvin 09130719253D

25 24 0 0 0 0 999 V2000

-1.8590 0.2610 -1.6660 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.4110 0.5040 -1.6130 C 0 0 2 0 0 0 0 0 0 0 0 0

0.2370 -0.0610 -2.8490 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.2430 -1.0250 -3.3970 O 0 0 0 0 0 0 0 0 0 0 0 0

0.1740 -0.1720 -0.3730 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.4850 0.4020 0.8810 C 0 0 0 0 0 0 0 0 0 0 0 0

0.1000 -0.2750 2.1210 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.5580 0.3000 3.3760 C 0 0 0 0 0 0 0 0 0 0 0 0

0.0030 -0.3500 4.5670 N 0 0 0 0 0 0 0 0 0 0 0 0

1.5090 -0.0380 2.1730 O 0 0 0 0 0 0 0 0 0 0 0 0

1.3500 0.5040 -3.3420 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.2360 0.5610 -0.7790 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9840 -0.7380 -1.7110 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2250 1.5770 -1.5640 H 0 0 0 0 0 0 0 0 0 0 0 0

1.2480 0.0070 -0.3340 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0120 -1.2450 -0.4220 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5590 0.2220 0.8420 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2980 1.4750 0.9310 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0860 -1.3470 2.0720 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6330 0.1190 3.3370 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3720 1.3720 3.4260 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.4570 0.0580 5.3660 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2800 -1.3170 4.5310 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6300 0.9200 2.2150 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7670 0.1400 -4.1350 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 12 1 0 0 0 0

1 13 1 0 0 0 0

2 3 1 0 0 0 0

2 5 1 0 0 0 0

2 14 1 0 0 0 0

3 4 2 0 0 0 0

3 11 1 0 0 0 0

5 6 1 0 0 0 0

5 15 1 0 0 0 0

5 16 1 0 0 0 0

6 7 1 0 0 0 0

6 17 1 0 0 0 0

6 18 1 0 0 0 0

7 8 1 0 0 0 0

7 10 1 0 0 0 0

7 19 1 0 0 0 0

8 9 1 0 0 0 0

8 20 1 0 0 0 0

8 21 1 0 0 0 0

9 22 1 0 0 0 0

9 23 1 0 0 0 0

10 24 1 0 0 0 0

11 25 1 0 0 0 0

M END): 19 ms

reading 25 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

25 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C6H14N2O3

Net Charge

Average Mass

162.18704

Monoisotopic Mass

162.10044

InChI

InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4-,5+/m1/s1

InChIKey

YSMODUONRAFBET-UHNVWZDZSA-N

SMILES

NC[C@H](O)CC[C@H](N)C(O)=O

Roles Classification
Chemical Role(s):	Bronsted base A molecular entity capable of accepting a hydron from a donor (Bronsted acid). (via organic amino compound ) Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	erythro-5-hydroxy-L-lysine (CHEBI:18040) has role human metabolite (CHEBI:77746) erythro-5-hydroxy-L-lysine (CHEBI:18040) is a 5-hydroxylysine (CHEBI:60175) erythro-5-hydroxy-L-lysine (CHEBI:18040) is a hydroxy-L-lysine (CHEBI:24661) erythro-5-hydroxy-L-lysine (CHEBI:18040) is conjugate base of erythro-5-hydroxy-L-lysinium(1+) (CHEBI:58357)

Incoming	erythro-5-hydroxy-L-lysinium(1+) (CHEBI:58357) is conjugate acid of erythro-5-hydroxy-L-lysine (CHEBI:18040)

IUPAC Name

(2S,5R)-2,6-diamino-5-hydroxyhexanoic acid

Synonyms	Sources
(2S,5R)-5-hydroxylysine	ChEBI
(5R)-5-Hydroxy-L-lysine	KEGG COMPOUND
5-HYDROXYLYSINE	PDBeChem
alpha,epsilon-diamino-delta-hydroxycaproic acid	ChEBI
erythro-5-Hydroxy-L-lysine	ChemIDplus
L-erythro-5-Hydroxylysine	KEGG COMPOUND
L-normal-5-hydroxylysine	ChEBI

Manual Xrefs	Databases
C16741	KEGG COMPOUND
CPD-14226	MetaCyc
HMDB0000450	HMDB
LYZ	PDBeChem
View more database links

Registry Numbers	Types	Sources
1190-94-9	CAS Registry Number	KEGG COMPOUND
1190-94-9	CAS Registry Number	ChemIDplus
1723696	Reaxys Registry Number	Reaxys

Last Modified

23 October 2015

General Comment
2005-10-13	The only naturally occurring isomer of the four possible ones, and exclusive to collagen protein; forms by post-translational hydroxylation of lysine (Allevi and Anastasia, Tetrahedron Asymmetry, 11 (2000) 3151-3160).

CHEBI:18040 - erythro-5-hydroxy-L-lysine

ChEBI is part of the ELIXIR infrastructure