dTTP (CHEBI:18077)

ChEBI > Main

CHEBI:18077 - dTTP

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	dTTP

ChEBI ID	CHEBI:18077

Definition	A thymidine phosphate having a triphosphate group at the 5'-position.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:46175, CHEBI:14093, CHEBI:10530, CHEBI:27000

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__541024207223974__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__541024207223974__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:18077","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__541024207223974__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"541024207223974","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__541024207223974__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

TTP - Ideal conformer

Mrv1927 07272110573D

starting HoverWatcher_5

Time for openFile(TTP - Ideal conformer

Mrv1927 07272110573D

46 47 0 0 0 0 999 V2000

-0.7690 0.0020 1.5360 P 0 0 1 0 0 5 0 0 0 0 0 0

0.0460 -1.2090 1.2990 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.1940 -0.4220 2.1530 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0040 0.9700 2.5710 O 0 0 0 0 0 0 0 0 0 0 0 0

0.1880 0.1350 3.9340 P 0 0 1 0 0 5 0 0 0 0 0 0

-1.1370 -0.2570 4.4630 O 0 0 0 0 0 0 0 0 0 0 0 0

1.0590 -1.1840 3.6360 O 0 0 0 0 0 0 0 0 0 0 0 0

0.9500 1.0480 5.0190 O 0 0 0 0 0 0 0 0 0 0 0 0

1.1080 0.1550 6.3490 P 0 0 1 0 0 5 0 0 0 0 0 0

1.8950 -1.0580 6.0380 O 0 0 0 0 0 0 0 0 0 0 0 0

1.8670 1.0110 7.4830 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.3480 -0.2710 6.8850 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.9960 0.7770 0.1440 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.6750 -0.1290 -0.7270 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.9230 0.5480 -2.0760 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.6740 0.8180 -2.7510 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.6600 -0.4130 -3.0430 C 0 0 1 0 0 0 0 0 0 0 0 0

-4.0740 -0.3410 -2.8540 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.2580 0.1490 -4.4280 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.9780 0.9600 -4.1490 C 0 0 2 0 0 0 0 0 0 0 0 0

0.1280 0.4380 -4.9550 N 0 0 0 0 0 0 0 0 0 0 0 0

0.5130 -0.8420 -4.8090 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.0620 -1.5530 -4.0080 O 0 0 0 0 0 0 0 0 0 0 0 0

1.5260 -1.3470 -5.5360 N 0 0 0 0 0 0 0 0 0 0 0 0

2.1710 -0.5730 -6.4320 C 0 0 0 0 0 0 0 0 0 0 0 0

3.0880 -1.0300 -7.0910 O 0 0 0 0 0 0 0 0 0 0 0 0

1.7790 0.7770 -6.5930 C 0 0 0 0 0 0 0 0 0 0 0 0

2.4870 1.6640 -7.5840 C 0 0 0 0 0 0 0 0 0 0 0 0

0.7600 1.2580 -5.8500 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6930 0.3930 2.2920 H 0 0 0 0 0 0 0 0 0 0 0 0

1.9130 -0.8840 3.2930 H 0 0 0 0 0 0 0 0 0 0 0 0

1.9400 0.4410 8.2610 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8270 0.5460 7.0760 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6290 -0.4140 -0.2830 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0630 -1.0190 -0.8740 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4920 1.4680 -1.9430 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.3040 -1.4360 -2.9200 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.4760 -0.8880 -3.5430 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0420 0.7960 -4.8190 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0500 -0.6630 -5.1240 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1460 2.0110 -4.3870 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7900 -2.2730 -5.4180 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2740 1.0980 -8.0820 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7730 2.0220 -8.3260 H 0 0 0 0 0 0 0 0 0 0 0 0

2.9260 2.5140 -7.0620 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4450 2.2850 -5.9620 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 3 1 1 0 0 0

1 4 1 0 0 0 0

1 13 1 0 0 0 0

3 30 1 0 0 0 0

5 4 1 6 0 0 0

5 6 2 0 0 0 0

5 7 1 0 0 0 0

5 8 1 0 0 0 0

7 31 1 0 0 0 0

8 9 1 0 0 0 0

9 10 2 0 0 0 0

9 11 1 0 0 0 0

9 12 1 0 0 0 0

11 32 1 0 0 0 0

12 33 1 0 0 0 0

13 14 1 0 0 0 0

14 15 1 0 0 0 0

14 34 1 0 0 0 0

14 35 1 0 0 0 0

15 16 1 0 0 0 0

15 17 1 0 0 0 0

15 36 1 1 0 0 0

16 20 1 0 0 0 0

17 18 1 0 0 0 0

17 19 1 0 0 0 0

17 37 1 6 0 0 0

18 38 1 0 0 0 0

19 20 1 0 0 0 0

19 39 1 0 0 0 0

19 40 1 0 0 0 0

20 21 1 0 0 0 0

20 41 1 6 0 0 0

21 22 1 0 0 0 0

21 29 1 0 0 0 0

22 23 2 0 0 0 0

22 24 1 0 0 0 0

24 25 1 0 0 0 0

24 42 1 0 0 0 0

25 26 2 0 0 0 0

25 27 1 0 0 0 0

27 28 1 0 0 0 0

27 29 2 0 0 0 0

28 43 1 0 0 0 0

28 44 1 0 0 0 0

28 45 1 0 0 0 0

29 46 1 0 0 0 0

M END): 20 ms

reading 46 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

46 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Nitric acid is an inorganic compound with the formula HNO3. It is a highly corrosive mineral acid. The compound is colorless, but samples tend to acquire a yellow cast over time due to decomposition into oxides of nitrogen. Most commercially available nitric acid has a concentration of 68% in water. When the solution contains more than 86% HNO3, it is referred to as fuming nitric acid. Depending on the amount of nitrogen dioxide present, fuming nitric acid is further characterized as red fuming nitric acid at concentrations above 86%, or white fuming nitric acid at concentrations above 95%. Nitric acid is the primary reagent used for nitration – the addition of a nitro group, typically to an organic molecule. While some resulting nitro compounds are shock- and thermally-sensitive explosives, a few are stable enough to be used in munitions and demolition, while others are still more stable and used as synthetic dyes and medicines (e.g. metronidazole). Nitric acid is also commonly used as a strong oxidizing agent.
Read full article at Wikipedia

Formula

C10H17N2O14P3

Net Charge

Average Mass

482.167

Monoisotopic Mass

481.98926

InChI

InChI=1S/C10H17N2O14P3/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(24-8)4-23-28(19,20)26-29(21,22)25-27(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,19,20)(H,21,22)(H,11,14,15)(H2,16,17,18)/t6-,7+,8+/m0/s1

InChIKey

NHVNXKFIZYSCEB-XLPZGREQSA-N

SMILES

CC1=CN([C@H]2C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O2)C(=O)NC1=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Escherichia coli (NCBI:txid562)	Found in whole organism (UBERON:0000468). From MetaboLights See: MetaboLights Study

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). (via nucleoside 5'-triphoshate )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	dTTP (CHEBI:18077) has role Escherichia coli metabolite (CHEBI:76971) dTTP (CHEBI:18077) has role mouse metabolite (CHEBI:75771) dTTP (CHEBI:18077) is a pyrimidine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37043) dTTP (CHEBI:18077) is a thymidine phosphate (CHEBI:27001) dTTP (CHEBI:18077) is conjugate acid of dTTP(3−) (CHEBI:58370)

Incoming	ethyl-dTTP (CHEBI:62900) has functional parent dTTP (CHEBI:18077) dTTP(3−) (CHEBI:58370) is conjugate base of dTTP (CHEBI:18077)

IUPAC Name

thymidine 5'-(tetrahydrogen triphosphate)

Synonyms	Sources
2'-deoxythymidine 5'-triphosphate	ChEBI
2'-deoxythymidine triphosphate	ChemIDplus
5'-TTP	ChemIDplus
deoxy-TTP	ChemIDplus
deoxythymidine 5'-triphosphate	KEGG COMPOUND
deoxythymidine triphosphate	KEGG COMPOUND
dThd5'PPP	CBN
dTTP	KEGG COMPOUND
pppdT	CBN
thymidine 5'-triphosphate	ChemIDplus
THYMIDINE-5'-TRIPHOSPHATE	PDBeChem
TTP	KEGG COMPOUND

Manual Xrefs	Databases
58493	ChemSpider
C00019695	KNApSAcK
C00459	KEGG COMPOUND
DB02452	DrugBank
FDB030841	FooDB
HMDB0001342	HMDB
Thymidine_triphosphate	Wikipedia
TTP	PDBeChem
View more database links

Registry Numbers	Types	Sources
365-08-2	CAS Registry Number	ChemIDplus
71453	Beilstein Registry Number	Beilstein

Citations	Types	Sources
11952643	PubMed citation	Europe PMC
163227	PubMed citation	Europe PMC
17062140	PubMed citation	Europe PMC
18164314	PubMed citation	Europe PMC
2232707	PubMed citation	Europe PMC
26252214	PubMed citation	Europe PMC
2628074	PubMed citation	Europe PMC
26408413	PubMed citation	Europe PMC
29083013	PubMed citation	Europe PMC
30305373	PubMed citation	Europe PMC
31377845	PubMed citation	Europe PMC
33716755	PubMed citation	Europe PMC
34102282	PubMed citation	Europe PMC
34110794	PubMed citation	Europe PMC
4556566	PubMed citation	Europe PMC
7361458	PubMed citation	Europe PMC
8294419	PubMed citation	Europe PMC
89451	PubMed citation	Europe PMC
IND43614414	Agricola citation	Europe PMC

Last Modified

27 July 2021

CHEBI:18077 - dTTP

ChEBI is part of the ELIXIR infrastructure