(2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:15607)

ChEBI > Main

CHEBI:15607 - (2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	(2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid

ChEBI ID	CHEBI:15607

ChEBI ASCII Name	(2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid

Definition	A 3-hydroxybutane-1,2,3-tricarboxylic acid which has (2S,3R) configuration.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:10869, CHEBI:43909, CHEBI:189, CHEBI:18550

Supplier Information	ZINC000000902108

Download	Molfile XML SDF

more structures >>

Molfile

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__2158042426096145__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__2158042426096145__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:18550","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__2158042426096145__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"2158042426096145","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__2158042426096145__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09130719353D

starting HoverWatcher_5

Time for openFile(

Marvin 09130719353D

24 23 0 0 0 0 999 V2000

0.0480 -0.3950 2.3050 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.4740 0.3210 3.1250 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0470 -1.7280 2.4200 O 0 0 0 0 0 0 0 0 0 0 0 0

0.8070 0.2090 1.1520 C 0 0 2 0 0 0 0 0 0 0 0 0

2.2620 -0.2630 1.1960 C 0 0 0 0 0 0 0 0 0 0 0 0

0.7660 1.6340 1.2490 O 0 0 0 0 0 0 0 0 0 0 0 0

0.1680 -0.2310 -0.1660 C 0 0 2 0 0 0 0 0 0 0 0 0

0.9390 0.3820 -1.3360 C 0 0 0 0 0 0 0 0 0 0 0 0

0.4260 -0.1920 -2.6320 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.3560 -1.1120 -2.6160 O 0 0 0 0 0 0 0 0 0 0 0 0

0.8390 0.3180 -3.8020 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.2640 0.2340 -0.2090 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7250 0.8580 0.7160 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.0280 -0.0440 -1.2770 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.5340 -2.1160 3.1600 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2930 -1.3500 1.1220 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8110 0.1730 0.3620 H 0 0 0 0 0 0 0 0 0 0 0 0

2.7170 0.0500 2.1350 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1650 1.8890 1.2170 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1990 -1.3180 -0.2400 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7980 1.4630 -1.3370 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0000 0.1530 -1.2320 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5100 -0.0500 -4.6340 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9470 0.2540 -1.3050 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

3 15 1 0 0 0 0

4 5 1 0 0 0 0

4 6 1 0 0 0 0

4 7 1 0 0 0 0

5 16 1 0 0 0 0

5 17 1 0 0 0 0

5 18 1 0 0 0 0

6 19 1 0 0 0 0

7 8 1 0 0 0 0

7 12 1 0 0 0 0

7 20 1 0 0 0 0

8 9 1 0 0 0 0

8 21 1 0 0 0 0

8 22 1 0 0 0 0

9 10 2 0 0 0 0

9 11 1 0 0 0 0

11 23 1 0 0 0 0

12 13 2 0 0 0 0

12 14 1 0 0 0 0

14 24 1 0 0 0 0

M END): 17 ms

reading 24 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

24 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C7H10O7

Net Charge

Average Mass

206.150

Monoisotopic Mass

206.04265

InChI

InChI=1S/C7H10O7/c1-7(14,6(12)13)3(5(10)11)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t3-,7-/m1/s1

InChIKey

HHKPKXCSHMJWCF-WVBDSBKLSA-N

SMILES

C([C@@H]([C@](C)(C(=O)O)O)C(=O)O)C(=O)O

Metabolite of Species	Details
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Chemical Role(s):	Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	(2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:15607) has role Escherichia coli metabolite (CHEBI:76971) (2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:15607) is a 3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:142525) (2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:15607) is conjugate acid of (2S,3R)-3-hydroxybutane-1,2,3-tricarboxylate (CHEBI:57429)

Incoming	(2S,3R)-3-hydroxybutane-1,2,3-tricarboxylate (CHEBI:57429) is conjugate base of (2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:15607)

IUPAC Name

(2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid

Synonyms	Sources
(2S,3R)-3-Hydroxybutane-1,2,3-tricarboxylate	KEGG COMPOUND
3-carboxy-2,3-dideoxy-4-C-methyl-L-threo-pentaric acid	PDBeChem
Methylisocitric acid	KEGG COMPOUND

Manual Xrefs	Databases
C04593	KEGG COMPOUND
LMFA01050444	LIPID MAPS
MIC	PDBeChem
View more database links

Registry Number	Type	Source
71183-66-9	CAS Registry Number	PubChem

Last Modified

09 November 2018

CHEBI:15607 - (2S,3R)-3-hydroxybutane-1,2,3-tricarboxylic acid

ChEBI is part of the ELIXIR infrastructure