dCDP (CHEBI:28846)

ChEBI > Main

CHEBI:28846 - dCDP

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	dCDP

ChEBI ID	CHEBI:28846

Definition	A 2'-deoxycytidine phosphate that is the 2'- deoxy derivative of cytidine 5'-diphosphate (CDP).

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:49966, CHEBI:19241, CHEBI:10492

Supplier Information	ZINC000008216241

Download	Molfile XML SDF

more structures >>

Molfile

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__0902682083822435__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__0902682083822435__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:19241","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__0902682083822435__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"0902682083822435","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__0902682083822435__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Mrv0541 05221414163D

starting HoverWatcher_5

Time for openFile(

Mrv0541 05221414163D

39 40 0 0 0 0 999 V2000

-5.4580 -4.4040 1.7230 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.1130 -3.0930 0.8420 P 0 0 2 0 0 0 0 0 0 0 0 0

-6.2840 -2.2110 0.5230 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.3310 -3.6940 -0.4390 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.9410 -2.3770 1.6930 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.9620 -1.6860 3.1550 P 0 0 2 0 0 0 0 0 0 0 0 0

-4.3600 -2.6130 4.2670 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.9510 -0.4220 2.9530 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.4930 -1.0280 3.3150 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.0050 -0.1360 2.3270 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.6110 0.3280 2.7280 C 0 0 1 0 0 0 0 0 0 0 0 0

0.2470 -0.8290 2.7640 O 0 0 0 0 0 0 0 0 0 0 0 0

0.0080 1.2860 1.7200 C 0 0 1 0 0 0 0 0 0 0 0 0

0.9650 2.1210 2.3680 O 0 0 0 0 0 0 0 0 0 0 0 0

0.7100 0.3600 0.7540 C 0 0 1 0 0 0 0 0 0 0 0 0

1.1570 -0.7780 1.6570 C 0 0 2 0 0 0 0 0 0 0 0 0

1.1640 -2.0470 0.9890 N 0 0 0 0 0 0 0 0 0 0 0 0

2.3280 -2.5610 0.3670 C 0 0 0 0 0 0 0 0 0 0 0 0

3.3860 -1.9290 0.3790 O 0 0 0 0 0 0 0 0 0 0 0 0

2.2600 -3.7940 -0.2590 N 0 0 0 0 0 0 0 0 0 0 0 0

1.1470 -4.4790 -0.2820 C 0 0 0 0 0 0 0 0 0 0 0 0

1.1010 -5.7020 -0.9100 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.0940 -3.9720 0.3590 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.0080 -2.7850 0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.9710 -0.6540 1.3660 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6830 0.7180 2.2540 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6440 0.7530 3.7360 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.7220 1.9410 1.2360 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1630 -0.6040 2.0540 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7430 3.0420 2.1460 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0030 -0.0010 0.0030 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5560 0.8180 0.2320 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8670 -2.3410 1.4490 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3490 -6.3100 -0.6910 H 0 0 0 0 0 0 0 0 0 0 0 0

1.8220 -5.9230 -1.5530 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0050 -4.5540 0.3300 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.2130 -4.9700 1.4560 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.8490 -4.1180 -1.1550 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2400 0.0850 3.7420 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 37 1 0 0 0 0

2 3 2 0 0 0 0

2 4 1 0 0 0 0

2 5 1 0 0 0 0

4 38 1 0 0 0 0

5 6 1 0 0 0 0

6 7 2 0 0 0 0

6 8 1 0 0 0 0

6 9 1 0 0 0 0

8 39 1 0 0 0 0

9 10 1 0 0 0 0

10 11 1 0 0 0 0

10 25 1 0 0 0 0

10 26 1 0 0 0 0

11 12 1 0 0 0 0

11 13 1 0 0 0 0

11 27 1 0 0 0 0

12 16 1 0 0 0 0

13 14 1 0 0 0 0

13 15 1 0 0 0 0

13 28 1 0 0 0 0

14 30 1 0 0 0 0

15 16 1 0 0 0 0

15 31 1 0 0 0 0

15 32 1 0 0 0 0

16 17 1 0 0 0 0

16 29 1 0 0 0 0

17 18 1 0 0 0 0

17 24 1 0 0 0 0

18 19 2 0 0 0 0

18 20 1 0 0 0 0

20 21 2 0 0 0 0

21 22 1 0 0 0 0

21 23 1 0 0 0 0

22 34 1 0 0 0 0

22 35 1 0 0 0 0

23 24 2 0 0 0 0

23 36 1 0 0 0 0

24 33 1 0 0 0 0

M END): 17 ms

reading 39 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

39 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Deoxycytidine diphosphate is a nucleoside diphosphate. It is related to the common nucleic acid CTP, or cytidine triphosphate, with the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose removed (hence the deoxy- part of the name), and with one fewer phosphoryl group than CTP . 2'-Deoxycytidine diphosphate is abbreviated as dCDP.
Read full article at Wikipedia

Formula

C9H15N3O10P2

Net Charge

Average Mass

387.17700

Monoisotopic Mass

387.02327

InChI

InChI=1S/C9H15N3O10P2/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(21-8)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1

InChIKey

FTDHDKPUHBLBTL-SHYZEUOFSA-N

SMILES

Nc1ccn([C@H]2C[C@H](O)[C@@H](COP(O)(=O)OP(O)(O)=O)O2)c(=O)n1

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Mycoplasma genitalium (NCBI:txid2097)	See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). (via nucleoside 5'-diphosphate ) human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	dCDP (CHEBI:28846) has functional parent CDP (CHEBI:17239) dCDP (CHEBI:28846) has role Escherichia coli metabolite (CHEBI:76971) dCDP (CHEBI:28846) has role Mycoplasma genitalium metabolite (CHEBI:131604) dCDP (CHEBI:28846) has role human metabolite (CHEBI:77746) dCDP (CHEBI:28846) has role mouse metabolite (CHEBI:75771) dCDP (CHEBI:28846) is a 2'-deoxycytidine phosphate (CHEBI:37092) dCDP (CHEBI:28846) is a pyrimidine 2'-deoxyribonucleoside 5'-diphosphate (CHEBI:37037) dCDP (CHEBI:28846) is conjugate acid of dCDP(3−) (CHEBI:58593)

Incoming	dCDP(3−) (CHEBI:58593) is conjugate base of dCDP (CHEBI:28846)

IUPAC Name

2'-deoxycytidine 5'-(trihydrogen diphosphate)

Synonyms	Sources
2'-Deoxycytidine 5'-diphosphate	KEGG COMPOUND
2'-Deoxycytidine diphosphate	KEGG COMPOUND
D-1beta-Ribofuranosylcytosine diphosphate	ChemIDplus
dCDP	KEGG COMPOUND
deoxycytidine diphosphate	ChEBI

Manual Xrefs	Databases
C00705	KEGG COMPOUND
DCDP	MetaCyc
Deoxycytidine_diphosphate	Wikipedia
HMDB0001245	HMDB
YYY	PDBeChem
View more database links

Registry Numbers	Types	Sources
60648	Reaxys Registry Number	Reaxys
800-73-7	CAS Registry Number	ChemIDplus

Citations

Karr JR, Sanghvi JC, Macklin DN, Gutschow MV, Jacobs JM, Bolival B, Assad-Garcia N, Glass JI, Covert MW (2012)
A whole-cell computational model predicts phenotype from genotype.
Cell 150, 389-401 [PubMed:22817898]
[show Abstract]

Huang SW, Tzeng HF (2012)
Simultaneous determination of deoxycytidine diphosphate and deoxycytidine triphosphate by capillary electrophoresis with transient isotachophoretic stacking: a sensitive monitoring method for ribonucleotide reductase activity.
Electrophoresis 33, 536-542 [PubMed:22212996]
[show Abstract]

Narine DR, Bacchetti S, Chan WW (1985)
An assay for ribonucleotide reductase based on ion-exchange chromatography of the reaction product.
Analytical biochemistry 145, 331-338 [PubMed:2990252]
[show Abstract]

Last Modified

22 April 2016

CHEBI:28846 - dCDP

ChEBI is part of the ELIXIR infrastructure