4-guanidinobutanoic acid (CHEBI:15728)

ChEBI > Main

CHEBI:15728 - 4-guanidinobutanoic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	4-guanidinobutanoic acid

ChEBI ID	CHEBI:15728

Definition	The 4-guanidino derivative of butanoic acid.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:1834, CHEBI:11991, CHEBI:20372

Supplier Information	ChemicalBook:CB5246481, eMolecules:515655, ZINC000001532820

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__913549334119881__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__913549334119881__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:20372","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__913549334119881__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"913549334119881","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__913549334119881__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

ALG - Ideal conformer

RDKit 3D

starting HoverWatcher_5

Time for openFile(ALG - Ideal conformer

RDKit 3D

21 20 0 0 0 0 0 0 0 0999 V2000

-3.0870 -0.0460 0.0020 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.0850 -1.2550 0.0010 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7840 0.7100 0.0020 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.6190 -0.2830 0.0010 C 0 0 0 0 0 0 0 0 0 0 0 0

0.7050 0.4850 0.0010 C 0 0 0 0 0 0 0 0 0 0 0 0

1.8200 -0.4650 -0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0

3.1150 -0.0040 -0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0

3.3510 1.2770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0

4.1620 -0.8960 -0.0010 N 0 0 0 0 0 0 0 0 0 0 0 0

-4.2510 0.6230 -0.0030 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7270 1.3370 -0.8880 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7270 1.3360 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6750 -0.9100 0.8900 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6760 -0.9090 -0.8900 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7610 1.1120 -0.8890 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7620 1.1110 0.8910 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6440 -1.4190 -0.0010 H 0 0 0 0 0 0 0 0 0 0 0 0

4.2650 1.6020 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0

3.9860 -1.8500 -0.0020 H 0 0 0 0 0 0 0 0 0 0 0 0

5.0760 -0.5710 -0.0010 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.0610 0.0940 -0.0070 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0

1 3 1 0

1 10 1 0

3 4 1 0

3 11 1 0

3 12 1 0

4 5 1 0

4 13 1 0

4 14 1 0

5 6 1 0

5 15 1 0

5 16 1 0

6 7 1 0

6 17 1 0

7 8 2 0

7 9 1 0

8 18 1 0

9 19 1 0

9 20 1 0

10 21 1 0

M END): 17 ms

reading 21 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

21 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C5H11N3O2

Net Charge

Average Mass

145.162

Monoisotopic Mass

145.08513

InChI

InChI=1S/C5H11N3O2/c6-5(7)8-3-1-2-4(9)10/h1-3H2,(H,9,10)(H4,6,7,8)

InChIKey

TUHVEAJXIMEOSA-UHFFFAOYSA-N

SMILES

C(=N)(N)NCCCC(O)=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Saccharomyces cerevisiae (NCBI:txid4932)	Source: yeast.sf.net See: PubMed

Roles Classification
Biological Role(s):	Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	4-guanidinobutanoic acid (CHEBI:15728) has functional parent butyric acid (CHEBI:30772) 4-guanidinobutanoic acid (CHEBI:15728) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) 4-guanidinobutanoic acid (CHEBI:15728) has role fungal metabolite (CHEBI:76946) 4-guanidinobutanoic acid (CHEBI:15728) has role mouse metabolite (CHEBI:75771) 4-guanidinobutanoic acid (CHEBI:15728) is a guanidines (CHEBI:24436) 4-guanidinobutanoic acid (CHEBI:15728) is conjugate acid of 4-guanidinobutanoate (CHEBI:86392) 4-guanidinobutanoic acid (CHEBI:15728) is tautomer of 4-guanidinobutanoic acid zwitterion (CHEBI:57486)

Incoming	4-guanidinobutanoate (CHEBI:86392) is conjugate base of 4-guanidinobutanoic acid (CHEBI:15728) 4-guanidinobutanoic acid zwitterion (CHEBI:57486) is tautomer of 4-guanidinobutanoic acid (CHEBI:15728)

IUPAC Name

4-(carbamimidamido)butanoic acid

Synonyms	Sources
4-carbamimidamidobutanoic acid	IUPAC
4-Guanidinobutanoate	KEGG COMPOUND
4-Guanidinobutyric acid	ChemIDplus
4-Guanidinobutyric acid	KEGG COMPOUND
gamma-Guanidinobutyrate	ChemIDplus
gamma-Guanidinobutyric acid	HMDB

Manual Xrefs	Databases
ALG	PDBeChem
C01035	KEGG COMPOUND
HMDB0003464	HMDB
View more database links

Registry Numbers	Types	Sources
1766447	Reaxys Registry Number	Reaxys
463-00-3	CAS Registry Number	ChemIDplus

Citation

Bordbar A, Mo ML, Nakayasu ES, Schrimpe-Rutledge AC, Kim YM, Metz TO, Jones MB, Frank BC, Smith RD, Peterson SN, Hyduke DR, Adkins JN, Palsson BO (2012)
Model-driven multi-omic data analysis elucidates metabolic immunomodulators of macrophage activation.
Molecular systems biology 8, 558 [PubMed:22735334]
[show Abstract]

Last Modified

07 April 2021

CHEBI:15728 - 4-guanidinobutanoic acid

ChEBI is part of the ELIXIR infrastructure