D-arginine (CHEBI:15816)

ChEBI > Main

CHEBI:15816 - D-arginine

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	D-arginine

ChEBI ID	CHEBI:15816

ChEBI ASCII Name	D-arginine

Definition	A D-α-amino acid that is the D-isomer of arginine.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:41855, CHEBI:4106, CHEBI:12917, CHEBI:20917

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__240109062047633__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__240109062047633__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:20917","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__240109062047633__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"240109062047633","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__240109062047633__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 06261213483D

starting HoverWatcher_5

Time for openFile(

Marvin 06261213483D

27 26 0 0 0 0 999 V2000

-2.3180 1.7860 -0.3080 N 0 0 0 0 0 0 0 0 0 0 0 0

-2.2600 0.4860 0.3730 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.0230 -0.2820 -0.0990 C 0 0 0 0 0 0 0 0 0 0 0 0

0.2380 0.4630 0.3420 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4750 -0.3050 -0.1300 C 0 0 0 0 0 0 0 0 0 0 0 0

2.6830 0.4090 0.2920 N 0 0 0 0 0 0 0 0 0 0 0 0

3.9170 -0.0930 -0.0190 C 0 0 0 0 0 0 0 0 0 0 0 0

4.0200 -1.2290 -0.7050 N 0 0 0 0 0 0 0 0 0 0 0 0

5.0150 0.5560 0.3650 N 0 3 0 0 0 0 0 0 0 0 0 0

-3.4990 -0.3080 0.0470 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.8700 -1.3270 0.8380 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.1570 -0.0280 -0.9260 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.3710 1.5930 -1.2970 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1960 2.2100 -0.0480 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2010 0.6420 1.4500 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6080 1.2360 0.7930 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.8332 -1.6490 0.6794 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0270 -1.2810 0.3380 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0370 -0.3610 -1.1860 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2420 1.4620 -0.0950 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2530 0.5420 1.4290 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4710 -1.3030 0.3070 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4610 -0.3830 -1.2170 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2210 -1.7010 -0.9850 H 0 0 0 0 0 0 0 0 0 0 0 0

4.8960 -1.5840 -0.9260 H 0 0 0 0 0 0 0 0 0 0 0 0

5.8900 0.2000 0.1450 H 0 0 0 0 0 0 0 0 0 0 0 0

4.9400 1.3840 0.8650 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 13 1 0 0 0 0

1 14 1 0 0 0 0

2 3 1 0 0 0 0

2 10 1 0 0 0 0

2 15 1 0 0 0 0

3 4 1 0 0 0 0

3 18 1 0 0 0 0

3 19 1 0 0 0 0

4 5 1 0 0 0 0

4 20 1 0 0 0 0

4 21 1 0 0 0 0

5 6 1 0 0 0 0

5 22 1 0 0 0 0

5 23 1 0 0 0 0

6 7 1 0 0 0 0

6 16 1 0 0 0 0

7 8 1 0 0 0 0

7 9 2 0 0 0 0

8 24 1 0 0 0 0

8 25 1 0 0 0 0

9 26 1 0 0 0 0

9 27 1 0 0 0 0

10 11 2 0 0 0 0

10 12 1 0 0 0 0

12 17 1 0 0 0 0

M CHG 1 9 1

M END): 24 ms

reading 27 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

27 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C6H14N4O2

Net Charge

Average Mass

174.20100

Monoisotopic Mass

174.11168

InChI

InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m1/s1

InChIKey

ODKSFYDXXFIFQN-SCSAIBSYSA-N

SMILES

N[C@H](CCCNC(N)=N)C(O)=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed

Roles Classification
Chemical Role(s):	Bronsted base A molecular entity capable of accepting a hydron from a donor (Bronsted acid). (via organic amino compound ) Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). EC 4.1.1.19 (arginine decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of arginine decarboxylase (EC 4.1.1.19). fundamental metabolite Any metabolite produced by all living cells. (via arginine )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	D-arginine (CHEBI:15816) has role EC 4.1.1.19 (arginine decarboxylase) inhibitor (CHEBI:65053) D-arginine (CHEBI:15816) has role mouse metabolite (CHEBI:75771) D-arginine (CHEBI:15816) is a D-α-amino acid (CHEBI:16733) D-arginine (CHEBI:15816) is a arginine (CHEBI:29016) D-arginine (CHEBI:15816) is conjugate acid of D-argininate (CHEBI:32688) D-arginine (CHEBI:15816) is conjugate base of D-argininium(1+) (CHEBI:32689) D-arginine (CHEBI:15816) is enantiomer of L-arginine (CHEBI:16467)

Incoming	D-arginine derivative (CHEBI:83966) has functional parent D-arginine (CHEBI:15816) vanchrobactin (CHEBI:157682) has functional parent D-arginine (CHEBI:15816) D-argininium(1+) (CHEBI:32689) is conjugate acid of D-arginine (CHEBI:15816) D-argininate (CHEBI:32688) is conjugate base of D-arginine (CHEBI:15816) L-arginine (CHEBI:16467) is enantiomer of D-arginine (CHEBI:15816) N^ω-D-arginino group (CHEBI:32694) is substituent group from D-arginine (CHEBI:15816) N²-D-arginino group (CHEBI:32693) is substituent group from D-arginine (CHEBI:15816) D-arginine residue (CHEBI:29953) is substituent group from D-arginine (CHEBI:15816) D-arginyl group (CHEBI:32691) is substituent group from D-arginine (CHEBI:15816)

IUPAC Name

D-arginine

Synonyms	Sources
(2R)-2-amino-5-(carbamimidamido)pentanoic acid	IUPAC
(2R)-2-amino-5-guanidinopentanoic acid	JCBN
(R)-2-amino-5-guanidinopentanoic acid	ChEBI
D-2-Amino-5-guanidinovaleric acid	KEGG COMPOUND
D-Arginin	ChEBI
D-Arginine	KEGG COMPOUND
DAR	PDBeChem

Manual Xrefs	Databases
C00792	KEGG COMPOUND
CPD-220	MetaCyc
DAR	PDBeChem
DB04027	DrugBank
HMDB0003416	HMDB
View more database links

Registry Numbers	Types	Sources
157-06-2	CAS Registry Number	KEGG COMPOUND
157-06-2	CAS Registry Number	ChemIDplus
157-06-2	CAS Registry Number	NIST Chemistry WebBook
1725412	Reaxys Registry Number	Reaxys
364938	Gmelin Registry Number	Gmelin

Citations

Last Modified

25 January 2021

CHEBI:15816 - D-arginine

ChEBI is part of the ELIXIR infrastructure