alpha-D-glucosamine 1-phosphate (CHEBI:27625)

ChEBI > Main

CHEBI:27625 - α-D-glucosamine 1-phosphate

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	α-D-glucosamine 1-phosphate

ChEBI ID	CHEBI:27625

ChEBI ASCII Name	alpha-D-glucosamine 1-phosphate

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:42868, CHEBI:12316, CHEBI:4163, CHEBI:20994

Supplier Information	ZINC000004097029

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__95200210004335__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__95200210004335__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:20994","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__95200210004335__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"95200210004335","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__95200210004335__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 12110713353D

starting HoverWatcher_5

Time for openFile(

Marvin 12110713353D

30 30 0 0 1 0 999 V2000

0.9891 0.4069 0.7080 C 0 0 2 0 0 0 0 0 0 0 0 0

0.8738 -1.0050 1.3553 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.3207 0.9300 0.3867 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.1196 -1.9340 0.6032 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.1526 0.1389 -0.4873 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.4423 -1.2182 0.2106 C 0 0 1 0 0 0 0 0 0 0 0 0

1.8471 0.4839 -0.3292 O 0 0 0 0 0 0 0 0 0 0 0 0

2.1925 -1.6455 1.5016 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.4220 -3.0708 1.4133 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.2244 -2.0610 -0.6342 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.4204 0.9620 -0.8199 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.1039 2.1509 -1.5356 O 0 0 0 0 0 0 0 0 0 0 0 0

2.1813 1.6538 -1.1413 P 0 0 1 0 0 0 0 0 0 0 0 0

3.5089 1.5391 -1.6876 O 0 0 0 0 0 0 0 0 0 0 0 0

1.2310 1.7477 -2.2246 O 0 0 0 0 0 0 0 0 0 0 0 0

2.0975 2.8550 -0.3387 O 0 0 0 0 0 0 0 0 0 0 0 0

1.3833 1.0571 1.4972 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4813 -0.8686 2.3685 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3628 -2.3027 -0.3065 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6404 -0.0557 -1.4356 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0280 -1.0248 1.1143 H 0 0 0 0 0 0 0 0 0 0 0 0

2.7813 -1.0212 2.0570 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0705 -2.5014 2.0486 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8478 -2.7061 2.2197 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4175 -2.8581 -0.0976 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1068 0.3845 -1.4426 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9418 1.2482 0.0954 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9709 2.5847 -1.6863 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1521 2.4842 -2.7004 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0066 3.6462 -0.7119 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 3 1 0 0 0 0

2 4 1 0 0 0 0

3 5 1 0 0 0 0

4 6 1 0 0 0 0

5 6 1 0 0 0 0

1 7 1 0 0 0 0

2 8 1 0 0 0 0

4 9 1 0 0 0 0

6 10 1 0 0 0 0

5 11 1 0 0 0 0

12 11 1 0 0 0 0

14 13 2 0 0 0 0

15 13 1 0 0 0 0

16 13 1 0 0 0 0

7 13 1 0 0 0 0

1 17 1 0 0 0 0

2 18 1 0 0 0 0

4 19 1 0 0 0 0

5 20 1 0 0 0 0

6 21 1 0 0 0 0

8 22 1 0 0 0 0

8 23 1 0 0 0 0

9 24 1 0 0 0 0

10 25 1 0 0 0 0

11 26 1 0 0 0 0

11 27 1 0 0 0 0

12 28 1 0 0 0 0

15 29 1 0 0 0 0

16 30 1 0 0 0 0

M END): 18 ms

reading 30 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

30 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C6H14NO8P

Net Charge

Average Mass

259.15106

Monoisotopic Mass

259.04570

InChI

InChI=1S/C6H14NO8P/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2-,3-,4-,5-,6-/m1/s1

InChIKey

YMJBYRVFGYXULK-QZABAPFNSA-N

SMILES

N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(O)(O)=O

Metabolite of Species	Details
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	α-D-glucosamine 1-phosphate (CHEBI:27625) has functional parent α-D-glucosamine (CHEBI:44678) α-D-glucosamine 1-phosphate (CHEBI:27625) has role Escherichia coli metabolite (CHEBI:76971) α-D-glucosamine 1-phosphate (CHEBI:27625) is a glucosamine phosphate (CHEBI:24269) α-D-glucosamine 1-phosphate (CHEBI:27625) is conjugate acid of α-D-glucosamine 1-phosphate(1−) (CHEBI:58516)

Incoming	N-acetyl-α-D-glucosamine 1-phosphate (CHEBI:16446) has functional parent α-D-glucosamine 1-phosphate (CHEBI:27625) α-D-glucosamine 1-phosphate(1−) (CHEBI:58516) is conjugate base of α-D-glucosamine 1-phosphate (CHEBI:27625)

IUPAC Name

2-amino-2-deoxy-α-D-glucopyranose 1-(dihydrogen phosphate)

Synonyms	Sources
2-amino-2-deoxy-1-O-phosphono-α-D-glucopyranose	IUPAC
alpha-D-Glucosamine 1-phosphate	KEGG COMPOUND
D-Glucosamine 1-phosphate	KEGG COMPOUND
D-Glucosamine 1-phosphate	KEGG COMPOUND
GLUCOSAMINE 1-PHOSPHATE	PDBeChem

Manual Xrefs	Databases
C00019579	KNApSAcK
C06156	KEGG COMPOUND
DB03111	DrugBank
GP1	PDBeChem
View more database links

Registry Numbers	Types	Sources
2152-75-2	CAS Registry Number	KEGG COMPOUND
22947	Beilstein Registry Number	Beilstein

Last Modified

25 January 2016

CHEBI:27625 - α-D-glucosamine 1-phosphate

ChEBI is part of the ELIXIR infrastructure