ATP (CHEBI:15422)

ChEBI > Main

CHEBI:15422 - ATP

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	ATP

ChEBI ID	CHEBI:15422

Definition	An adenosine 5'-phosphate in which the 5'-phosphate is a triphosphate group. It is involved in the transportation of chemical energy during metabolic pathways.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:40938, CHEBI:10841, CHEBI:10789, CHEBI:2359, CHEBI:13236, CHEBI:22249

Supplier Information	ChemicalBook:CB5338946, eMolecules:515191

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__023813162657643__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__023813162657643__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:22249","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__023813162657643__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"023813162657643","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__023813162657643__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 01220711453D

starting HoverWatcher_5

Time for openFile(

Marvin 01220711453D

47 49 0 0 1 0 999 V2000

2.5266 -1.6026 0.0476 N 0 0 0 0 0 0 0 0 0 0 0 0

2.7303 -0.5393 0.8487 C 0 0 0 0 0 0 0 0 0 0 0 0

4.0980 -0.2595 0.8503 C 0 0 0 0 0 0 0 0 0 0 0 0

4.7244 -1.1654 0.0883 N 0 0 0 0 0 0 0 0 0 0 0 0

3.7553 -1.9731 -0.3772 C 0 0 0 0 0 0 0 0 0 0 0 0

4.5658 0.8418 1.5905 C 0 0 0 0 0 0 0 0 0 0 0 0

1.8699 0.2219 1.5750 N 0 0 0 0 0 0 0 0 0 0 0 0

3.6597 1.5698 2.2980 N 0 0 0 0 0 0 0 0 0 0 0 0

2.3312 1.2717 2.3048 C 0 0 0 0 0 0 0 0 0 0 0 0

5.8314 1.1781 1.6099 N 0 0 0 0 0 0 0 0 0 0 0 0

1.2797 -2.2248 -0.3056 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.0424 -2.0625 -0.2315 C 0 0 1 0 0 0 0 0 0 0 0 0

0.1755 -1.3083 -0.2601 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.6891 -3.3976 0.4740 C 0 0 2 0 0 0 0 0 0 0 0 0

0.8410 -3.3439 0.6573 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.1709 -4.5018 -0.2879 O 0 0 0 0 0 0 0 0 0 0 0 0

1.4886 -4.5904 0.4143 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.1799 -1.3023 0.4911 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4964 -0.1429 -0.0908 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.7143 3.7513 -2.9345 P 0 0 1 0 0 0 0 0 0 0 0 0

-2.2727 3.9260 -1.5556 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.8249 5.0511 -3.5454 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7765 2.9865 -3.7178 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.0092 3.1168 -3.0147 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.0333 2.9144 -0.5354 P 0 0 1 0 0 0 0 0 0 0 0 0

-3.2396 2.1112 -0.3615 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.8730 2.1354 -0.8962 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7126 3.5845 0.7025 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.4464 0.8696 0.3614 P 0 0 2 0 0 0 0 0 0 0 0 0

-3.3543 1.1069 1.7812 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.7852 0.3999 0.0961 O 0 0 0 0 0 0 0 0 0 0 0 0

3.9487 -2.7691 -0.9886 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6831 1.8360 2.8547 H 0 0 0 0 0 0 0 0 0 0 0 0

6.1140 1.9204 2.1039 H 0 0 0 0 0 0 0 0 0 0 0 0

6.4583 0.6797 1.1264 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3533 -2.6220 -1.3262 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.3373 -2.2340 -1.2738 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1521 -3.4946 1.4609 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0699 -3.0451 1.6857 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1436 -4.3679 -0.3127 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4434 -4.4178 0.5521 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0610 -1.9516 0.5186 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.8474 -1.1220 1.5185 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1194 5.5745 -3.6034 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.3003 2.7886 -3.7778 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8911 3.8590 0.8630 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.4756 0.7435 0.5220 H 0 0 0 0 0 0 0 0 0 0 0 0

2 1 4 0 0 0 0

5 1 4 0 0 0 0

11 1 1 0 0 0 0

3 2 4 0 0 0 0

7 2 4 0 0 0 0

6 3 4 0 0 0 0

4 3 4 0 0 0 0

5 4 4 0 0 0 0

10 6 1 0 0 0 0

8 6 4 0 0 0 0

9 7 4 0 0 0 0

9 8 4 0 0 0 0

13 11 1 0 0 0 0

15 11 1 0 0 0 0

13 12 1 0 0 0 0

14 12 1 0 0 0 0

12 18 1 0 0 0 0

15 14 1 0 0 0 0

14 16 1 0 0 0 0

15 17 1 0 0 0 0

19 18 1 0 0 0 0

29 19 1 0 0 0 0

21 20 1 0 0 0 0

22 20 1 0 0 0 0

23 20 2 0 0 0 0

24 20 1 0 0 0 0

25 21 1 0 0 0 0

26 25 1 0 0 0 0

27 25 2 0 0 0 0

28 25 1 0 0 0 0

29 26 1 0 0 0 0

30 29 2 0 0 0 0

31 29 1 0 0 0 0

5 32 1 0 0 0 0

9 33 1 0 0 0 0

10 34 1 0 0 0 0

10 35 1 0 0 0 0

11 36 1 0 0 0 0

12 37 1 0 0 0 0

14 38 1 0 0 0 0

15 39 1 0 0 0 0

16 40 1 0 0 0 0

17 41 1 0 0 0 0

18 42 1 0 0 0 0

18 43 1 0 0 0 0

22 44 1 0 0 0 0

24 45 1 0 0 0 0

28 46 1 0 0 0 0

31 47 1 0 0 0 0

M END): 27 ms

reading 47 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

47 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Muscimol (also known as agarin or pantherine) is the principal psychoactive constituent of Amanita muscaria and Amanita pantherina. Muscimol is a potent and selective orthosteric agonist for the GABAA receptor and displays sedative-hypnotic, depressant and hallucinogenic psychoactivity. This colorless or white solid is classified as an isoxazole. Muscimol underwent a phase I clinical trial for epilepsy, but drug development was discontinued. Muscimol, an agonist for the GABAA receptor, was able to significantly alleviate pain in its peak effect, recent studies from 2023 show. It has since been federally banned in Australia and is pending FDA review in the United States, but scientists believe it may relieve pain as well as some opioids without much of the risk of addiction associated with opioids.
Read full article at Wikipedia

Formula

C10H16N5O13P3

Net Charge

Average Mass

507.18100

Monoisotopic Mass

506.99575

InChI

InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1

InChIKey

ZKHQWZAMYRWXGA-KQYNXXCUSA-N

SMILES

Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. fundamental metabolite Any metabolite produced by all living cells. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). (via nucleoside 5'-triphoshate )

Application(s):	nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	ATP (CHEBI:15422) has role cofactor (CHEBI:23357) ATP (CHEBI:15422) has role fundamental metabolite (CHEBI:78675) ATP (CHEBI:15422) has role micronutrient (CHEBI:27027) ATP (CHEBI:15422) has role nutraceutical (CHEBI:50733) ATP (CHEBI:15422) is a adenosine 5'-phosphate (CHEBI:37096) ATP (CHEBI:15422) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) ATP (CHEBI:15422) is conjugate acid of ATP(3−) (CHEBI:57299)

Incoming	2-hydroxy-ATP (CHEBI:65119) has functional parent ATP (CHEBI:15422) 3'-dehydro-ATP (CHEBI:27782) has functional parent ATP (CHEBI:15422) 8-hydroxy-ATP (CHEBI:189101) has functional parent ATP (CHEBI:15422) 8-oxo-ATP (CHEBI:189100) has functional parent ATP (CHEBI:15422) 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) has functional parent ATP (CHEBI:15422) N⁶-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) has functional parent ATP (CHEBI:15422) adenosine 5'-[γ-thio]triphosphate (CHEBI:27575) has functional parent ATP (CHEBI:15422) adenosine thiamine triphosphate (CHEBI:71394) has functional parent ATP (CHEBI:15422) ATP-sugar (CHEBI:20855) has functional parent ATP (CHEBI:15422) ethyl-ATP (CHEBI:62910) has functional parent ATP (CHEBI:15422) TNP-ATP (CHEBI:50104) has functional parent ATP (CHEBI:15422) adenosine triphosphate disodium (CHEBI:50732) has part ATP (CHEBI:15422) ATP(3−) (CHEBI:57299) is conjugate base of ATP (CHEBI:15422)

IUPAC Name

adenosine 5'-(tetrahydrogen triphosphate)

Synonyms	Sources
Adenosine 5'-triphosphate	KEGG COMPOUND
Adenosine triphosphate	ChemIDplus
ADENOSINE-5'-TRIPHOSPHATE	PDBeChem
ATP	KEGG COMPOUND
H₄atp	IUPAC

Brand Names	Sources
Adephos	DrugBank
Adetol	DrugBank
Adynol	DrugBank
Atipi	DrugBank
Atriphos	DrugBank
Cardenosine	DrugBank
Fosfobion	DrugBank
Glucobasin	DrugBank
Myotriphos	DrugBank
Triadenyl	DrugBank
Triphosphaden	DrugBank

Manual Xrefs	Databases
91	DrugCentral
Adenosine_triphosphate	Wikipedia
ATP	PDBeChem
C00001491	KNApSAcK
C00002	KEGG COMPOUND
D08646	KEGG DRUG
DB00171	DrugBank
HMDB0000538	HMDB
US3079379	Patent
View more database links

Registry Numbers	Types	Sources
34857	Gmelin Registry Number	Gmelin
56-65-5	CAS Registry Number	KEGG COMPOUND
56-65-5	CAS Registry Number	ChemIDplus
73010	Reaxys Registry Number	Reaxys

Last Modified

18 January 2022

CHEBI:15422 - ATP

ChEBI is part of the ELIXIR infrastructure