InChI=1S/C20H28O2/c1- 15(8- 6- 9- 16(2) 14- 19(21) 22) 11- 12- 18- 17(3) 10- 7- 13- 20(18,4) 5/h6,8- 9,11- 12,14H,7,10,13H2,1- 5H3,(H,21,22) |
SHGAZHPCJJPHSC-UHFFFAOYSA-N |
CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(O)=O |
|
Bronsted acid
A molecular entity capable of donating a hydron to an acceptor (Bronsted base).
(via oxoacid )
|
|
human metabolite
Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens).
|
|
View more via ChEBI Ontology
3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid
|
24506204
|
PubMed citation
|
Europe PMC
|
|