ferrienterobactin(3-) (CHEBI:28199)

ChEBI > Main

CHEBI:28199 - ferrienterobactin(3−)

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	ferrienterobactin(3−)

ChEBI ID	CHEBI:28199

ChEBI ASCII Name	ferrienterobactin(3-)

Definition	Iron (Fe3+) siderophore

Stars	This entity has been manually annotated by the ChEBI Team.

Submitter	Sandra Orchard

Secondary ChEBI IDs	CHEBI:21133, CHEBI:144426, CHEBI:4993

Supplier Information	ChemicalBook:CB6438412, eMolecules:6885408, ZINC000004095501

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__122584281324394__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__122584281324394__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:28199","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__122584281324394__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"122584281324394","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__122584281324394__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 04240716493D

starting HoverWatcher_5

Time for openFile(

Marvin 04240716493D

70 78 0 0 1 0 999 V2000

2.8655 -2.2812 -0.8312 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.5760 -2.6464 1.8082 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.5571 -2.7030 2.8665 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.1393 -3.5495 0.6209 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.7609 -3.4143 3.8407 O 0 0 0 0 0 0 0 0 0 0 0 0

0.9937 -1.0306 2.2482 C 0 0 0 0 0 0 0 0 0 0 0 0

0.7078 -3.6840 -0.8518 C 0 0 0 0 0 0 0 0 0 0 0 0

2.5233 -0.8476 2.0379 C 0 0 2 0 0 0 0 0 0 0 0 0

1.6479 -2.8691 -1.6175 C 0 0 1 0 0 0 0 0 0 0 0 0

0.5877 -4.8721 -1.1300 O 0 0 0 0 0 0 0 0 0 0 0 0

2.6368 0.2273 1.1477 N 0 0 0 0 0 0 0 0 0 0 0 0

3.1910 -2.0449 1.5306 C 0 0 0 0 0 0 0 0 0 0 0 0

4.0194 -2.5911 2.2449 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0105 -3.1475 0.0139 O 0 0 0 0 0 0 0 0 0 0 0 0

0.5506 -2.1229 2.8912 O 0 0 0 0 0 0 0 0 0 0 0 0

3.3145 1.3340 1.1473 C 0 0 0 0 0 0 0 0 0 0 0 0

2.9622 2.4235 0.3255 C 0 0 0 0 0 0 0 0 0 0 0 0

4.2864 1.3815 1.8912 O 0 0 0 0 0 0 0 0 0 0 0 0

1.8798 2.4101 -0.6016 C 0 0 0 0 0 0 0 0 0 0 0 0

3.6823 3.6462 0.3995 C 0 0 0 0 0 0 0 0 0 0 0 0

1.5432 3.5118 -1.4068 C 0 0 0 0 0 0 0 0 0 0 0 0

1.1092 1.4465 -0.7859 O 0 0 0 0 0 0 0 0 0 0 0 0

3.3542 4.7668 -0.3881 C 0 0 0 0 0 0 0 0 0 0 0 0

2.2842 4.6999 -1.2963 C 0 0 0 0 0 0 0 0 0 0 0 0

0.5554 3.4026 -2.1834 O 0 0 0 0 0 0 0 0 0 0 0 0

0.9214 -1.8433 -2.2414 N 0 0 0 0 0 0 0 0 0 0 0 0

-1.1455 -1.2076 -2.9902 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.0037 -1.9650 -3.1458 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.3998 -1.8480 -2.8420 C 0 0 0 0 0 0 0 0 0 0 0 0

0.0621 -2.8095 -4.0308 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.5657 -1.1052 -2.5712 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.5043 0.2972 -2.4664 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.2633 0.9405 -2.6209 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.1069 0.2004 -2.8708 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.9297 -1.3363 1.4129 N 0 0 0 0 0 0 0 0 0 0 0 0

-2.5595 0.9667 1.7800 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.5328 -0.4039 2.1071 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.3470 1.8669 2.5553 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.0991 -0.7835 3.1280 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.4043 3.2498 2.3027 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6624 3.7956 1.2464 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.8738 2.9440 0.4598 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.2051 3.3987 -0.4905 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.8254 1.5626 0.7130 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.0778 0.9704 -0.1018 O 0 0 0 0 0 0 0 0 0 0 0 0

3.0642 -2.6416 0.4453 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0798 0.9081 -2.8903 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.4719 2.0424 -1.4887 Fe 0 7 0 0 0 0 0 0 0 0 0 0

-2.0495 2.1601 -2.4532 O 0 0 0 0 0 0 0 0 0 0 0 0

2.9467 -1.2014 -0.9719 H 0 0 0 0 0 0 0 0 0 0 0 0

3.7740 -2.6621 -1.3062 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5003 -3.1180 2.1658 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9433 -3.5803 -0.1214 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0184 -4.5739 0.9925 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6243 -0.1857 2.8387 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5290 -0.9577 1.2645 H 0 0 0 0 0 0 0 0 0 0 0 0

2.9435 -0.5773 3.0143 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0736 -3.4846 -2.4217 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0570 0.1323 0.4274 H 0 0 0 0 0 0 0 0 0 0 0 0

4.4698 3.7546 1.0436 H 0 0 0 0 0 0 0 0 0 0 0 0

3.8913 5.6321 -0.2975 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0453 5.5159 -1.8646 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0408 -0.9861 -1.8862 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4767 -2.8678 -2.8954 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.4557 -1.5887 -2.4334 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.3459 0.8364 -2.2536 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6514 -1.0929 0.5544 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9119 1.5386 3.3424 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9823 3.8604 2.8846 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7007 4.8003 1.0559 H 0 0 0 0 0 0 0 0 0 0 0 0

1 46 1 0 0 0 0

2 35 1 0 0 0 0

2 3 1 0 0 0 0

2 4 1 0 0 0 0

3 5 2 0 0 0 0

8 6 1 0 0 0 0

9 1 1 0 0 0 0

7 9 1 0 0 0 0

7 10 2 0 0 0 0

8 11 1 0 0 0 0

11 16 1 0 0 0 0

12 46 1 0 0 0 0

8 12 1 0 0 0 0

9 26 1 0 0 0 0

12 13 2 0 0 0 0

14 7 1 0 0 0 0

4 14 1 0 0 0 0

15 6 1 0 0 0 0

3 15 1 0 0 0 0

16 17 1 0 0 0 0

16 18 2 0 0 0 0

17 19 4 0 0 0 0

17 20 4 0 0 0 0

19 21 4 0 0 0 0

19 22 1 0 0 0 0

20 23 4 0 0 0 0

21 24 4 0 0 0 0

21 25 1 0 0 0 0

23 24 4 0 0 0 0

28 26 1 0 0 0 0

27 28 1 0 0 0 0

27 29 4 0 0 0 0

27 34 4 0 0 0 0

28 30 2 0 0 0 0

29 31 4 0 0 0 0

34 33 4 0 0 0 0

31 32 4 0 0 0 0

33 32 4 0 0 0 0

33 49 1 0 0 0 0

34 47 1 0 0 0 0

37 35 1 0 0 0 0

36 37 1 0 0 0 0

36 38 4 0 0 0 0

36 44 4 0 0 0 0

37 39 2 0 0 0 0

38 40 4 0 0 0 0

40 41 4 0 0 0 0

42 41 4 0 0 0 0

44 42 4 0 0 0 0

42 43 1 0 0 0 0

44 45 1 0 0 0 0

22 48 1 0 0 0 0

25 48 1 0 0 0 0

45 48 1 0 0 0 0

43 48 1 0 0 0 0

48 47 1 0 0 0 0

48 49 1 0 0 0 0

1 50 1 0 0 0 0

1 51 1 0 0 0 0

2 52 1 0 0 0 0

4 53 1 0 0 0 0

4 54 1 0 0 0 0

6 55 1 0 0 0 0

6 56 1 0 0 0 0

8 57 1 0 0 0 0

9 58 1 0 0 0 0

11 59 1 0 0 0 0

20 60 1 0 0 0 0

23 61 1 0 0 0 0

24 62 1 0 0 0 0

26 63 1 0 0 0 0

29 64 1 0 0 0 0

31 65 1 0 0 0 0

32 66 1 0 0 0 0

35 67 1 0 0 0 0

38 68 1 0 0 0 0

40 69 1 0 0 0 0

41 70 1 0 0 0 0

M CHG 1 48 -3

M END): 19 ms

reading 70 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

70 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C30H21FeN3O15

Net Charge

-3

Average Mass

719.351

Monoisotopic Mass

719.03385

InChI

InChI=1S/C30H27N3O15.Fe/c34-19-7-1-4-13(22(19)37)25(40)31-16-10-46-29(44)18(33-27(42)15-6-3-9-21(36)24(15)39)12-48-30(45)17(11-47-28(16)43)32-26(41)14-5-2-8-20(35)23(14)38;/h1-9,16-18,34-39H,10-12H2,(H,31,40)(H,32,41)(H,33,42);/q;+3/p-6/t16-,17-,18-;/m0./s1

InChIKey

NGILTSZTOFYVBF-UVJOBNTFSA-H

SMILES

[H][C@]12COC(=O)[C@]3([H])COC(=O)[C@]([H])(COC1=O)NC(=O)C1=C4O[Fe-3]56(OC7=CC=CC(=C7O5)C(=O)N2)(OC4=CC=C1)OC1=CC=CC(=C1O6)C(=O)N3

Metabolite of Species	Details
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	ferrienterobactin(3−) (CHEBI:28199) has part enterobactin(6−) (CHEBI:38150) ferrienterobactin(3−) (CHEBI:28199) has role Escherichia coli metabolite (CHEBI:76971) ferrienterobactin(3−) (CHEBI:28199) is a Fe(III)-complexed siderophore (CHEBI:84734) ferrienterobactin(3−) (CHEBI:28199) is a organic anion (CHEBI:25696) ferrienterobactin(3−) (CHEBI:28199) is conjugate base of ferrienterobactin (CHEBI:38151)

Incoming	ferrienterobactin (CHEBI:38151) is conjugate acid of ferrienterobactin(3−) (CHEBI:28199)

IUPAC Names

{N,N',N''-[(3S,7S,11S)-2,6,10-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris[2,3-di(hydroxy-κO)benzamidato](6−)}ferrate(3−)

{N,N',N''-[(3S,7S,11S)-2,6,10-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris[2,3-di(hydroxy-κO)benzamidato]}ferrate(3−)

Synonyms	Sources
[Fe(ent)]³⁻	ChEBI
Fe(III)-enterobactin	UniProt
Fe-enterobactin	KEGG COMPOUND
FeEnt	ChEBI
ferric enterobactin	ChEBI
ferric-enterobactin	ChEBI
ferrienterobactin	ChemIDplus
ferrienterochelin	ChemIDplus

Manual Xrefs	Databases
C06230	KEGG COMPOUND
FERRIC-ENTEROBACTIN-COMPLEX	MetaCyc
View more database links

Registry Numbers	Types	Sources
2494246	Gmelin Registry Number	Gmelin
61481-53-6	CAS Registry Number	ChemIDplus
885856	Gmelin Registry Number	Gmelin

Citations

Last Modified

12 July 2022

CHEBI:28199 - ferrienterobactin(3−)

ChEBI is part of the ELIXIR infrastructure