InChI=1S/C11H12N2O2/c12- 9(11(14) 15) 5- 7- 6- 13- 10- 4- 2- 1- 3- 8(7) 10/h1- 4,6,9,13H,5,12H2,(H,14,15) /p+1/t9- /m0/s1 |
QIVBCDIJIAJPQS-VIFPVBQESA-O |
[NH3+][C@@H](Cc1c[nH]c2ccccc12)C(O)=O |
|
animal metabolite
Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals.
plant metabolite
Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.
|
|
View more via ChEBI Ontology
(1S)-1-carboxy-2-(1H-indol-3-yl)ethanaminium
|
IUPAC
|
L-tryptophan cation
|
JCBN
|
|