all-trans-violaxanthin (CHEBI:35288)

ChEBI > Main

CHEBI:35288 - all-trans-violaxanthin

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	all-trans-violaxanthin

ChEBI ID	CHEBI:35288

ChEBI ASCII Name	all-trans-violaxanthin

Definition	The all-trans-stereoisomer of violaxanthin.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:46568, CHEBI:9993, CHEBI:22351

Supplier Information	ZINC000008221270

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__80437299173358__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__80437299173358__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:35288","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__80437299173358__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"80437299173358","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__80437299173358__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 03020612003D

starting HoverWatcher_5

Time for openFile(

Marvin 03020612003D

100103 0 0 0 0 999 V2000

-10.0350 5.0816 1.0456 C 0 0 1 0 0 0 0 0 0 0 0 0

-11.4430 4.4406 1.0812 C 0 0 2 0 0 0 0 0 0 0 0 0

-10.7023 4.5941 -0.1302 O 0 0 0 0 0 0 0 0 0 0 0 0

-9.8524 6.6532 1.1369 C 0 0 2 0 0 0 0 0 0 0 0 0

-9.0168 4.2236 1.6081 C 0 0 0 0 0 0 0 0 0 0 0 0

-12.5812 5.4504 1.3812 C 0 0 0 0 0 0 0 0 0 0 0 0

-11.6839 2.9341 1.3817 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.8711 7.2453 2.1843 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.0547 7.3025 -0.2772 C 0 0 0 0 0 0 0 0 0 0 0 0

-8.4010 7.0883 1.5617 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.8865 3.9029 0.9641 C 0 0 0 0 0 0 0 0 0 0 0 0

-12.1715 6.4427 2.4954 C 0 0 2 0 0 0 0 0 0 0 0 0

-6.8520 3.1454 1.4524 C 0 0 0 0 0 0 0 0 0 0 0 0

-12.0356 5.7044 3.7130 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.9577 2.6415 0.5702 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.7058 2.9081 2.9008 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.9309 1.8379 0.9060 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.6758 1.9539 0.4461 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6471 1.1878 0.9108 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7604 0.7006 0.0186 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.5237 0.9321 2.3517 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.7070 -0.0978 0.3100 C 0 0 0 0 0 0 0 0 0 0 0 0

0.4254 -0.1034 -0.4058 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4823 -0.9091 -0.1482 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3530 -1.3906 -1.0637 C 0 0 0 0 0 0 0 0 0 0 0 0

3.4230 -2.1419 -0.6260 C 0 0 0 0 0 0 0 0 0 0 0 0

2.1669 -1.1165 -2.5003 C 0 0 0 0 0 0 0 0 0 0 0 0

4.5563 -2.3463 -1.3182 C 0 0 0 0 0 0 0 0 0 0 0 0

5.6356 -3.0871 -0.9607 C 0 0 0 0 0 0 0 0 0 0 0 0

6.7262 -3.3428 -1.7262 C 0 0 0 0 0 0 0 0 0 0 0 0

7.7351 -4.1051 -1.1906 C 0 0 0 0 0 0 0 0 0 0 0 0

6.8322 -2.8166 -3.0989 C 0 0 0 0 0 0 0 0 0 0 0 0

8.7253 -4.7168 -1.8567 C 0 0 0 0 0 0 0 0 0 0 0 0

9.8231 -5.4207 -1.2385 C 0 0 2 0 0 0 0 0 0 0 0 0

9.9768 -6.8888 -1.6888 C 0 0 2 0 0 0 0 0 0 0 0 0

9.4384 -6.5180 -0.4082 O 0 0 0 0 0 0 0 0 0 0 0 0

11.0447 -4.5667 -0.7315 C 0 0 2 0 0 0 0 0 0 0 0 0

11.3499 -7.5907 -1.5198 C 0 0 0 0 0 0 0 0 0 0 0 0

8.8864 -7.6210 -2.5257 C 0 0 0 0 0 0 0 0 0 0 0 0

12.2202 -5.5037 -0.2818 C 0 0 0 0 0 0 0 0 0 0 0 0

10.6223 -3.6911 0.4970 C 0 0 0 0 0 0 0 0 0 0 0 0

11.5130 -3.5807 -1.8573 C 0 0 0 0 0 0 0 0 0 0 0 0

12.5605 -6.6575 -1.2592 C 0 0 2 0 0 0 0 0 0 0 0 0

13.0911 -6.1506 -2.4820 O 0 0 0 0 0 0 0 0 0 0 0 0

-9.1944 3.8989 2.5293 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.8527 5.9918 0.4731 H 0 0 0 0 0 0 0 0 0 0 0 0

-13.4861 4.9257 1.6979 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.0615 2.2821 0.7641 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.7221 2.6580 1.1954 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.4596 2.7239 2.4285 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.3799 7.4101 3.1484 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.1611 8.2543 1.8769 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.8742 8.3801 -0.2698 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.0684 7.1630 -0.6524 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.3742 6.8654 -1.0133 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.3093 8.1728 1.6591 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.1205 6.6655 2.5293 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.6446 6.7678 0.8413 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.8134 4.2667 0.0369 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.9979 7.1395 2.6620 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.8608 6.3742 4.4080 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.0191 2.8625 -0.4017 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.1241 1.9332 3.1581 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.6626 2.9342 3.2238 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.1730 3.6642 3.5328 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1320 1.1300 1.5773 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.4831 2.6352 -0.2594 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.8680 0.9362 -0.9477 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1322 1.5939 2.9725 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8207 -0.0959 2.5699 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4990 1.0854 2.6977 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.7781 -0.7117 1.0915 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4940 0.5235 -1.1774 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6039 -1.1488 0.8141 H 0 0 0 0 0 0 0 0 0 0 0 0

3.3788 -2.5644 0.2779 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1233 -1.0318 -2.8068 H 0 0 0 0 0 0 0 0 0 0 0 0

2.5413 -1.9170 -3.1409 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6824 -0.1888 -2.7591 H 0 0 0 0 0 0 0 0 0 0 0 0

4.6080 -1.8933 -2.1933 H 0 0 0 0 0 0 0 0 0 0 0 0

5.5892 -3.4681 -0.0378 H 0 0 0 0 0 0 0 0 0 0 0 0

7.7621 -4.2290 -0.2002 H 0 0 0 0 0 0 0 0 0 0 0 0

6.6078 -1.7502 -3.1481 H 0 0 0 0 0 0 0 0 0 0 0 0

6.1401 -3.3626 -3.7444 H 0 0 0 0 0 0 0 0 0 0 0 0

7.8162 -2.8580 -3.5617 H 0 0 0 0 0 0 0 0 0 0 0 0

8.7738 -4.6914 -2.8458 H 0 0 0 0 0 0 0 0 0 0 0 0

11.2607 -8.3073 -0.6988 H 0 0 0 0 0 0 0 0 0 0 0 0

11.5666 -8.1814 -2.4135 H 0 0 0 0 0 0 0 0 0 0 0 0

9.1843 -8.6380 -2.7833 H 0 0 0 0 0 0 0 0 0 0 0 0

8.7179 -7.0903 -3.4639 H 0 0 0 0 0 0 0 0 0 0 0 0

7.9312 -7.6873 -2.0000 H 0 0 0 0 0 0 0 0 0 0 0 0

11.9689 -5.9723 0.6755 H 0 0 0 0 0 0 0 0 0 0 0 0

13.1259 -4.9201 -0.0934 H 0 0 0 0 0 0 0 0 0 0 0 0

10.1823 -4.2995 1.2901 H 0 0 0 0 0 0 0 0 0 0 0 0

11.4751 -3.1583 0.9238 H 0 0 0 0 0 0 0 0 0 0 0 0

9.8862 -2.9281 0.2347 H 0 0 0 0 0 0 0 0 0 0 0 0

10.7688 -2.8066 -2.0623 H 0 0 0 0 0 0 0 0 0 0 0 0

12.4349 -3.0622 -1.5860 H 0 0 0 0 0 0 0 0 0 0 0 0

11.6796 -4.0897 -2.8067 H 0 0 0 0 0 0 0 0 0 0 0 0

13.3655 -7.2547 -0.8216 H 0 0 0 0 0 0 0 0 0 0 0 0

13.3119 -6.9379 -3.0222 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

2 6 1 0 0 0 0

2 7 1 0 0 0 0

4 8 1 0 0 0 0

4 9 1 0 0 0 0

4 10 1 0 0 0 0

6 12 1 0 0 0 0

12 14 1 0 0 0 0

34 35 1 0 0 0 0

34 36 1 0 0 0 0

34 37 1 0 0 0 0

35 38 1 0 0 0 0

35 39 1 0 0 0 0

37 40 1 0 0 0 0

37 41 1 0 0 0 0

37 42 1 0 0 0 0

38 43 1 0 0 0 0

43 44 1 0 0 0 0

2 3 1 0 0 0 0

8 12 1 0 0 0 0

35 36 1 0 0 0 0

40 43 1 0 0 0 0

25 27 1 0 0 0 0

1 5 1 0 0 0 0

5 11 2 0 0 0 0

11 13 1 0 0 0 0

13 15 2 0 0 0 0

13 16 1 0 0 0 0

15 17 1 0 0 0 0

17 18 2 0 0 0 0

18 19 1 0 0 0 0

19 20 2 0 0 0 0

19 21 1 0 0 0 0

20 22 1 0 0 0 0

22 23 2 0 0 0 0

24 25 2 0 0 0 0

23 24 1 0 0 0 0

25 26 1 0 0 0 0

26 28 2 0 0 0 0

28 29 1 0 0 0 0

29 30 2 0 0 0 0

30 31 1 0 0 0 0

30 32 1 0 0 0 0

31 33 2 0 0 0 0

34 33 1 0 0 0 0

5 45 1 0 0 0 0

6 46 1 0 0 0 0

6 47 1 0 0 0 0

7 48 1 0 0 0 0

7 49 1 0 0 0 0

7 50 1 0 0 0 0

8 51 1 0 0 0 0

8 52 1 0 0 0 0

9 53 1 0 0 0 0

9 54 1 0 0 0 0

9 55 1 0 0 0 0

10 56 1 0 0 0 0

10 57 1 0 0 0 0

10 58 1 0 0 0 0

11 59 1 0 0 0 0

12 60 1 0 0 0 0

14 61 1 0 0 0 0

15 62 1 0 0 0 0

16 63 1 0 0 0 0

16 64 1 0 0 0 0

16 65 1 0 0 0 0

17 66 1 0 0 0 0

18 67 1 0 0 0 0

20 68 1 0 0 0 0

21 69 1 0 0 0 0

21 70 1 0 0 0 0

21 71 1 0 0 0 0

22 72 1 0 0 0 0

23 73 1 0 0 0 0

24 74 1 0 0 0 0

26 75 1 0 0 0 0

27 76 1 0 0 0 0

27 77 1 0 0 0 0

27 78 1 0 0 0 0

28 79 1 0 0 0 0

29 80 1 0 0 0 0

31 81 1 0 0 0 0

32 82 1 0 0 0 0

32 83 1 0 0 0 0

32 84 1 0 0 0 0

33 85 1 0 0 0 0

38 86 1 0 0 0 0

38 87 1 0 0 0 0

39 88 1 0 0 0 0

39 89 1 0 0 0 0

39 90 1 0 0 0 0

40 91 1 0 0 0 0

40 92 1 0 0 0 0

41 93 1 0 0 0 0

41 94 1 0 0 0 0

41 95 1 0 0 0 0

42 96 1 0 0 0 0

42 97 1 0 0 0 0

42 98 1 0 0 0 0

43 99 1 0 0 0 0

44100 1 0 0 0 0

M END): 24 ms

reading 100 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

100 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Violaxanthin is a xanthophyll pigment with an orange color found in a variety of plants. Violaxanthin is the product of the epoxidation of zeaxanthin where the oxygen atoms are from reactive oxygen species (ROS). Such ROS's arise when a plant is subject to solar radiation so intense that the light cannot all be absorbed by the chlorophyll.
Read full article at Wikipedia

Formula

C40H56O4

Net Charge

Average Mass

600.87024

Monoisotopic Mass

600.41786

InChI

InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-23-39-35(5,6)25-33(41)27-37(39,9)43-39)15-11-12-16-30(2)18-14-20-32(4)22-24-40-36(7,8)26-34(42)28-38(40,10)44-40/h11-24,33-34,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t33-,34-,37+,38+,39-,40-/m0/s1

InChIKey

SZCBXWMUOPQSOX-WVJDLNGLSA-N

SMILES

CC(\C=C\C=C(C)\C=C\[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C

Roles Classification
Biological Role(s):	food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. (via violaxanthin )

Application(s):	food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	all-trans-violaxanthin (CHEBI:35288) has role food colouring (CHEBI:77182) all-trans-violaxanthin (CHEBI:35288) is a violaxanthin (CHEBI:27295)

IUPAC Name

(3S,3'S,5R,5'R,6S,6'S)-5,5',6,6'-tetrahydro-5,6:5',6'-diepoxy-β,β-carotene-3,3'-diol

Synonyms	Sources
(3S,3'S,5R,5'R,6S,6'S)-5,6:5',6'-diepoxy-5,5',6,6'-tetrahydro-β,β-carotene-3,3'-diol	ChemIDplus
(3S,5R,6S,3'S,5'R,6'S)-5,6,5',6'-DIEPOXY-5,6,5',6'-TETRAHYDRO-BETA,BETA-CAROTENE-3,3'-DIOL	PDBeChem
all-trans-Violaxanthin	KEGG COMPOUND
all-trans-violaxanthin	UniProt
E 161e	ChEBI
Violaxanthin	KEGG COMPOUND

Manual Xrefs	Databases
C00003787	KNApSAcK
C08614	KEGG COMPOUND
CPD1F-133	MetaCyc
HMDB0003101	HMDB
LMPR01070282	LIPID MAPS
MOL000096	COMe
Violaxanthin	Wikipedia
XAT	PDBeChem
View more database links

Registry Numbers	Types	Sources
101269	Reaxys Registry Number	Reaxys
126-29-4	CAS Registry Number	ChemIDplus

Citations

Pugliese A, O'Callaghan Y, Tundis R, Galvin K, Menichini F, O'Brien N, Loizzo MR (2014)
In vitro investigation of the bioaccessibility of carotenoids from raw, frozen and boiled red chili peppers (Capsicum annuum).
European journal of nutrition 53, 501-510 [PubMed:23820691]
[show Abstract]

Magney TS, Eusden SA, Eitel JUH, Logan BA, Jiang J, Vierling LA (2014)
Assessing leaf photoprotective mechanisms using terrestrial LiDAR: towards mapping canopy photosynthetic performance in three dimensions.
The New phytologist 201, 344-356 [PubMed:24032717]
[show Abstract]

Neuman H, Galpaz N, Cunningham FX, Zamir D, Hirschberg J (2014)
The tomato mutation nxd1 reveals a gene necessary for neoxanthin biosynthesis and demonstrates that violaxanthin is a sufficient precursor for abscisic acid biosynthesis.
The Plant journal : for cell and molecular biology 78, 80-93 [PubMed:24506237]
[show Abstract]

Last Modified

28 July 2014

ChEBI

CHEBI:35288 - all-trans-violaxanthin

Background

Purpose

Methods

Results

Conclusions

ChEBI is part of the ELIXIR infrastructure