2'-deoxyguanosine 5'-monophosphate (CHEBI:16192)

ChEBI > Main

CHEBI:16192 - 2'-deoxyguanosine 5'-monophosphate

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	2'-deoxyguanosine 5'-monophosphate

ChEBI ID	CHEBI:16192

Definition	A purine 2'-deoxyribonucleoside 5'-monophosphate having guanine as the nucleobase.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:42676, CHEBI:42733, CHEBI:42726, CHEBI:41902, CHEBI:41939, CHEBI:41944, CHEBI:47449, CHEBI:19246, CHEBI:10496, CHEBI:14074

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__42570815117148__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__42570815117148__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:41939","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__42570815117148__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"42570815117148","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__42570815117148__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 07260819143D

starting HoverWatcher_5

Time for openFile(

Marvin 07260819143D

37 39 0 0 0 0 999 V2000

-4.6360 3.5306 -0.3050 P 0 0 2 0 0 0 0 0 0 0 0 0

-5.7850 2.9768 0.4450 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.7796 4.4933 0.6600 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.1757 4.3767 -1.5640 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.7038 2.3259 -0.8270 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.3553 1.5480 0.3200 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.4646 0.3795 -0.1090 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.1549 0.8498 -0.4990 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.1730 -0.5541 1.0930 C 0 0 1 0 0 0 0 0 0 0 0 0

-3.2095 -1.5258 1.2480 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.8446 -1.2259 0.6670 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.2596 -0.2690 -0.3900 C 0 0 2 0 0 0 0 0 0 0 0 0

1.0642 0.1913 0.0350 N 0 0 0 0 0 0 0 0 0 0 0 0

1.3401 1.3460 0.7090 C 0 0 0 0 0 0 0 0 0 0 0 0

2.6200 1.4367 0.9230 N 0 0 0 0 0 0 0 0 0 0 0 0

3.2404 0.3514 0.4020 C 0 0 0 0 0 0 0 0 0 0 0 0

4.5869 -0.0779 0.3370 C 0 0 0 0 0 0 0 0 0 0 0 0

5.4809 0.5939 0.8230 O 0 0 0 0 0 0 0 0 0 0 0 0

4.8573 -1.2536 -0.2720 N 0 0 0 0 0 0 0 0 0 0 0 0

3.8513 -1.9942 -0.8170 C 0 0 0 0 0 0 0 0 0 0 0 0

4.1563 -3.1807 -1.4340 N 0 0 0 0 0 0 0 0 0 0 0 0

2.5965 -1.6071 -0.7630 N 0 0 0 0 0 0 0 0 0 0 0 0

2.2520 -0.4573 -0.1720 C 0 0 0 0 0 0 0 0 0 0 0 0

0.6049 2.0752 1.0180 H 0 0 0 0 0 0 0 0 0 0 0 0

5.7735 -1.5684 -0.3290 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0425 4.8323 0.1340 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.7279 5.0860 -1.2090 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.2617 1.1617 0.7860 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8177 2.1723 1.0330 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9292 -0.1765 -0.9240 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0413 0.0206 2.0090 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9245 -2.1290 1.9480 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0368 -2.2055 0.2300 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1712 -1.3124 1.5190 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1839 -0.7790 -1.3500 H 0 0 0 0 0 0 0 0 0 0 0 0

3.4503 -3.7212 -1.8230 H 0 0 0 0 0 0 0 0 0 0 0 0

5.0784 -3.4784 -1.4860 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

1 5 1 0 0 0 0

3 26 1 0 0 0 0

4 27 1 0 0 0 0

5 6 1 0 0 0 0

6 7 1 0 0 0 0

6 28 1 0 0 0 0

6 29 1 0 0 0 0

7 8 1 0 0 0 0

7 9 1 0 0 0 0

7 30 1 0 0 0 0

8 12 1 0 0 0 0

9 10 1 0 0 0 0

9 11 1 0 0 0 0

9 31 1 0 0 0 0

10 32 1 0 0 0 0

11 12 1 0 0 0 0

11 33 1 0 0 0 0

11 34 1 0 0 0 0

12 13 1 0 0 0 0

12 35 1 0 0 0 0

13 14 4 0 0 0 0

13 23 4 0 0 0 0

14 15 4 0 0 0 0

14 24 1 0 0 0 0

15 16 4 0 0 0 0

16 17 1 0 0 0 0

16 23 4 0 0 0 0

17 18 2 0 0 0 0

17 19 1 0 0 0 0

19 20 1 0 0 0 0

19 25 1 0 0 0 0

20 21 1 0 0 0 0

20 22 2 0 0 0 0

21 36 1 0 0 0 0

21 37 1 0 0 0 0

22 23 1 0 0 0 0

M END): 21 ms

reading 37 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

37 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Methane (US: METH-ayn, UK: MEE-thayn) is a chemical compound with the chemical formula CH4 (one carbon atom bonded to four hydrogen atoms). It is a group-14 hydride, the simplest alkane, and the main constituent of natural gas. The abundance of methane on Earth makes it an economically attractive fuel, although capturing and storing it is difficult because it is a gas at standard temperature and pressure. In the Earth's atmosphere methane is transparent to visible light but absorbs infrared radiation, acting as a greenhouse gas. Methane is an organic compound, and among the simplest of organic compounds. Methane is also a hydrocarbon. Naturally occurring methane is found both below ground and under the seafloor and is formed by both geological and biological processes. The largest reservoir of methane is under the seafloor in the form of methane clathrates. When methane reaches the surface and the atmosphere, it is known as atmospheric methane. The Earth's atmospheric methane concentration has increased by about 160% since 1750, with the overwhelming percentage caused by human activity. It accounted for 20% of the total radiative forcing from all of the long-lived and globally mixed greenhouse gases, according to the 2021 Intergovernmental Panel on Climate Change report. Strong, rapid and sustained reductions in methane emissions could limit near-term warming and improve air quality by reducing global surface ozone. Methane has also been detected on other planets, including Mars, which has implications for astrobiology research.
Read full article at Wikipedia

Formula

C10H14N5O7P

Net Charge

Average Mass

347.22142

Monoisotopic Mass

347.06308

InChI

InChI=1S/C10H14N5O7P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1

InChIKey

LTFMZDNNPPEQNG-KVQBGUIXSA-N

SMILES

Nc1nc2n(cnc2c(=O)[nH]1)[C@H]1C[C@H](O)[C@@H](COP(O)(O)=O)O1

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Saccharomyces cerevisiae (NCBI:txid4932)	See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) has role Escherichia coli metabolite (CHEBI:76971) 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) has role mouse metabolite (CHEBI:75771) 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) is a deoxyguanosine phosphate (CHEBI:23625) 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) is a guanyl deoxyribonucleotide (CHEBI:63573) 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) is a purine 2'-deoxyribonucleoside 5'-monophosphate (CHEBI:36993) 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) is conjugate acid of 2'-deoxyguanosine 5'-monophosphate(2−) (CHEBI:57673) 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) is enantiomer of 9-(2-deoxy-5-O-phosphono-β-L-ribofuranosyl)guanine (CHEBI:41945) 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) is tautomer of 2-amino-9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol (CHEBI:45049)

Incoming	8,5'-cyclo-2'-deoxyguanosine monophosphate (CHEBI:131829) has functional parent 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) cis-diammine[bis(dGMP)]platinum (CHEBI:76396) has functional parent 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) 2'-deoxyguanosine 5'-monophosphate(2−) (CHEBI:57673) is conjugate base of 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) 9-(2-deoxy-5-O-phosphono-β-L-ribofuranosyl)guanine (CHEBI:41945) is enantiomer of 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) 2'-deoxyguanosine 5'-monophosphate residue (CHEBI:50322) is substituent group from 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) dGMP 3'-end residue (CHEBI:53117) is substituent group from 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) dGMP 5'-end residue (CHEBI:53101) is substituent group from 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192) 2-amino-9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol (CHEBI:45049) is tautomer of 2'-deoxyguanosine 5'-monophosphate (CHEBI:16192)

IUPAC Name

2'-deoxy-5'-guanylic acid

Synonyms	Sources
2'-Deoxy-GMP	HMDB
2'-Deoxyguanosine 5'-(dihydrogen phosphate)	HMDB
2'-Deoxyguanosine 5'-monophosphate	KEGG COMPOUND
2'-deoxyguanosine 5'-monophosphate	ChEBI
2'-Deoxyguanosine 5'-phosphate	KEGG COMPOUND
2'-Deoxyguanylic acid	HMDB
2'-dGMP	HMDB
Deoxy-GMP	HMDB
Deoxyguanosine 5'-monophosphate	HMDB
Deoxyguanosine 5'-phosphate	HMDB
Deoxyguanosine monophosphate	KEGG COMPOUND
Deoxyguanylic acid	KEGG COMPOUND
dGMP	KEGG COMPOUND

Manual Xrefs	Databases
C00019356	KNApSAcK
C00362	KEGG COMPOUND
DB04457	DrugBank
Deoxyguanosine_monophosphate	Wikipedia
DGMP	MetaCyc
DGP	PDBeChem
ECMDB01044	ECMDB
HMDB0001044	HMDB
YMDB00506	YMDB
View more database links

Registry Numbers	Types	Sources
58430	Reaxys Registry Number	Reaxys
902-04-5	CAS Registry Number	KEGG COMPOUND
902-04-5	CAS Registry Number	ChemIDplus

Citations	Types	Sources
13610867	PubMed citation	Europe PMC
20085298	PubMed citation	Europe PMC
21720611	PubMed citation	Europe PMC
23365666	PubMed citation	Europe PMC
2559771	PubMed citation	Europe PMC
9858930	PubMed citation	Europe PMC

Last Modified

05 December 2017

CHEBI:16192 - 2'-deoxyguanosine 5'-monophosphate

ChEBI is part of the ELIXIR infrastructure