(R)-dihydrolipoamide (CHEBI:43711)

ChEBI > Main

CHEBI:43711 - (R)-dihydrolipoamide

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	(R)-dihydrolipoamide

ChEBI ID	CHEBI:43711

ChEBI ASCII Name	(R)-dihydrolipoamide

Stars	This entity has been manually annotated by the ChEBI Team.

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__102769472953832__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__102769472953832__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:43711","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__102769472953832__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"102769472953832","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__102769472953832__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09150814253D

starting HoverWatcher_5

Time for openFile(

Marvin 09150814253D

29 28 0 0 0 0 999 V2000

2.3105 3.2282 -1.2912 C 0 0 0 0 0 0 0 0 0 0 0 0

1.3442 3.9587 -1.2223 O 0 0 0 0 0 0 0 0 0 0 0 0

3.4785 3.7011 -1.7669 N 0 0 0 0 0 0 0 0 0 0 0 0

2.2024 1.7940 -0.8444 C 0 0 0 0 0 0 0 0 0 0 0 0

0.7810 1.5164 -0.3530 C 0 0 0 0 0 0 0 0 0 0 0 0

0.6723 0.0601 0.1014 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.7485 -0.2168 0.5924 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.8579 -1.6731 1.0455 C 0 0 1 0 0 0 0 0 0 0 0 0

0.3185 -1.9776 2.3921 S 0 0 0 0 0 0 0 0 0 0 0 0

-2.2794 -1.9502 1.5378 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.3880 -3.4070 1.9914 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.0739 -3.7356 2.5748 S 0 0 0 0 0 0 0 0 0 0 0 0

3.5487 4.6244 -2.0544 H 0 0 0 0 0 0 0 0 0 0 0 0

4.2525 3.1189 -1.8180 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4312 1.1347 -1.6827 H 0 0 0 0 0 0 0 0 0 0 0 0

2.9094 1.6107 -0.0359 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5522 2.1756 0.4853 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0748 1.6992 -1.1611 H 0 0 0 0 0 0 0 0 0 0 0 0

0.9011 -0.5991 -0.7369 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3785 -0.1227 0.9095 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9773 0.4425 1.4307 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4555 -0.0335 -0.2161 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6292 -2.3319 0.2081 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1285 -1.0890 3.2976 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5081 -1.2915 2.3753 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9856 -1.7674 0.7297 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1593 -4.0657 1.1539 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6819 -3.5893 2.8003 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9550 -5.0311 2.9164 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

3 13 1 0 0 0 0

3 14 1 0 0 0 0

4 5 1 0 0 0 0

4 15 1 0 0 0 0

4 16 1 0 0 0 0

5 6 1 0 0 0 0

5 17 1 0 0 0 0

5 18 1 0 0 0 0

6 7 1 0 0 0 0

6 19 1 0 0 0 0

6 20 1 0 0 0 0

7 8 1 0 0 0 0

7 21 1 0 0 0 0

7 22 1 0 0 0 0

8 9 1 0 0 0 0

8 10 1 0 0 0 0

8 23 1 0 0 0 0

9 24 1 0 0 0 0

10 11 1 0 0 0 0

10 25 1 0 0 0 0

10 26 1 0 0 0 0

11 12 1 0 0 0 0

11 27 1 0 0 0 0

11 28 1 0 0 0 0

12 29 1 0 0 0 0

M END): 18 ms

reading 29 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

29 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C8H17NOS2

Net Charge

Average Mass

207.35872

Monoisotopic Mass

207.07516

InChI

InChI=1S/C8H17NOS2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H2,9,10)/t7-/m1/s1

InChIKey

VLYUGYAKYZETRF-SSDOTTSWSA-N

SMILES

NC(=O)CCCC[C@@H](S)CCS

Roles Classification
Biological Role(s):	Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). (via dihydrolipoamide ) human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). (via dihydrolipoamide ) cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). (via dihydrolipoamide ) mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). (via dihydrolipoamide )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	(R)-dihydrolipoamide (CHEBI:43711) is a dihydrolipoamide (CHEBI:17694)

Incoming	(R)-S⁶-acetyldihydrolipoamide (CHEBI:83096) has functional parent (R)-dihydrolipoamide (CHEBI:43711)

IUPAC Name

(6R)-6,8-disulfanyloctanamide

Synonyms	Sources
(R)-dihydrolipoamide	UniProt
6,8-DIMERCAPTO-OCTANOIC ACID AMIDE	PDBeChem

Manual Xrefs	Databases
DB08120	DrugBank
LPM	PDBeChem
View more database links

Last Modified

24 November 2014

CHEBI:43711 - (R)-dihydrolipoamide

ChEBI is part of the ELIXIR infrastructure