menaquinone-7 (CHEBI:44245)

ChEBI > Main

CHEBI:44245 - menaquinone-7

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	menaquinone-7

ChEBI ID	CHEBI:44245

Definition	A menaquinone whose side-chain contains seven isoprene units in an all-trans-configutation.

Stars	This entity has been manually annotated by the ChEBI Team.

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

Molfile

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__835582187396015__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__835582187396015__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:44245","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__835582187396015__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"835582187396015","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__835582187396015__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 12051114263D

starting HoverWatcher_5

Time for openFile(

Marvin 12051114263D

112113 0 0 0 0 999 V2000

7.9068 -7.9892 -2.0891 C 0 0 0 0 0 0 0 0 0 0 0 0

7.8890 -8.8078 -1.1916 O 0 0 0 0 0 0 0 0 0 0 0 0

6.7760 -7.8984 -3.0308 C 0 0 0 0 0 0 0 0 0 0 0 0

5.6003 -8.8267 -2.8722 C 0 0 0 0 0 0 0 0 0 0 0 0

6.7796 -7.0012 -4.0260 C 0 0 0 0 0 0 0 0 0 0 0 0

7.9176 -6.0818 -4.2122 C 0 0 0 0 0 0 0 0 0 0 0 0

7.9084 -5.2782 -5.1234 O 0 0 0 0 0 0 0 0 0 0 0 0

9.0666 -6.1388 -3.2850 C 0 0 0 0 0 0 0 0 0 0 0 0

10.1490 -5.2801 -3.4361 C 0 0 0 0 0 0 0 0 0 0 0 0

11.2177 -5.3575 -2.5563 C 0 0 0 0 0 0 0 0 0 0 0 0

11.2139 -6.2828 -1.5295 C 0 0 0 0 0 0 0 0 0 0 0 0

10.1420 -7.1453 -1.3658 C 0 0 0 0 0 0 0 0 0 0 0 0

9.0634 -7.0795 -2.2404 C 0 0 0 0 0 0 0 0 0 0 0 0

5.6087 -6.9354 -4.9712 C 0 0 0 0 0 0 0 0 0 0 0 0

4.5854 -5.9670 -4.4361 C 0 0 0 0 0 0 0 0 0 0 0 0

4.1644 -4.9779 -5.1855 C 0 0 0 0 0 0 0 0 0 0 0 0

4.6199 -4.8724 -6.6178 C 0 0 0 0 0 0 0 0 0 0 0 0

3.2244 -3.9482 -4.6149 C 0 0 0 0 0 0 0 0 0 0 0 0

4.0333 -2.8028 -4.0038 C 0 0 0 0 0 0 0 0 0 0 0 0

3.0938 -1.7723 -3.4335 C 0 0 0 0 0 0 0 0 0 0 0 0

3.2095 -1.4011 -2.1824 C 0 0 0 0 0 0 0 0 0 0 0 0

4.3567 -1.9096 -1.3491 C 0 0 0 0 0 0 0 0 0 0 0 0

2.1947 -0.4662 -1.5765 C 0 0 0 0 0 0 0 0 0 0 0 0

1.0538 -1.2787 -0.9632 C 0 0 0 0 0 0 0 0 0 0 0 0

0.0395 -0.3430 -0.3577 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.2159 -0.4132 -0.7245 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.6251 -1.3409 -1.8393 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.2505 0.4348 -0.0322 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.3797 1.7754 -0.7568 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.4150 2.6240 -0.0640 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.1037 3.8244 0.3558 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7462 4.4017 0.0480 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.1022 4.6283 1.1476 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.9242 4.3392 2.6384 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.9232 5.1432 3.4293 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.7312 4.5425 4.2672 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.5871 3.0643 4.5239 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.8051 5.3293 4.9728 C 0 0 0 0 0 0 0 0 0 0 0 0

-8.0822 5.3187 4.1318 C 0 0 0 0 0 0 0 0 0 0 0 0

-9.1562 6.1055 4.8374 C 0 0 0 0 0 0 0 0 0 0 0 0

-9.7618 7.0889 4.2193 C 0 0 0 0 0 0 0 0 0 0 0 0

-9.4750 7.3528 2.7640 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.7453 7.9551 4.9634 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.0097 9.1402 5.5889 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.9933 10.0063 6.3329 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.7877 10.2961 7.5937 C 0 0 0 0 0 0 0 0 0 0 0 0

-11.8308 11.0560 8.3719 C 0 0 0 0 0 0 0 0 0 0 0 0

-9.5085 9.8692 8.2663 C 0 0 0 0 0 0 0 0 0 0 0 0

5.7672 -9.4827 -2.0179 H 0 0 0 0 0 0 0 0 0 0 0 0

4.6951 -8.2416 -2.7087 H 0 0 0 0 0 0 0 0 0 0 0 0

5.4870 -9.4276 -3.7741 H 0 0 0 0 0 0 0 0 0 0 0 0

10.1569 -4.5550 -4.2361 H 0 0 0 0 0 0 0 0 0 0 0 0

12.0577 -4.6902 -2.6735 H 0 0 0 0 0 0 0 0 0 0 0 0

12.0518 -6.3332 -0.8503 H 0 0 0 0 0 0 0 0 0 0 0 0

10.1447 -7.8654 -0.5617 H 0 0 0 0 0 0 0 0 0 0 0 0

5.1595 -7.9250 -5.0632 H 0 0 0 0 0 0 0 0 0 0 0 0

5.9496 -6.5992 -5.9506 H 0 0 0 0 0 0 0 0 0 0 0 0

4.1981 -6.0883 -3.4352 H 0 0 0 0 0 0 0 0 0 0 0 0

4.1000 -4.0474 -7.1043 H 0 0 0 0 0 0 0 0 0 0 0 0

5.6943 -4.6910 -6.6438 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3961 -5.8011 -7.1408 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6059 -4.4070 -3.8448 H 0 0 0 0 0 0 0 0 0 0 0 0

2.5868 -3.5593 -5.4090 H 0 0 0 0 0 0 0 0 0 0 0 0

4.6523 -2.3432 -4.7742 H 0 0 0 0 0 0 0 0 0 0 0 0

4.6709 -3.1917 -3.2097 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3250 -1.3395 -4.0558 H 0 0 0 0 0 0 0 0 0 0 0 0

5.2982 -1.6814 -1.8495 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3380 -1.4273 -0.3721 H 0 0 0 0 0 0 0 0 0 0 0 0

4.2639 -2.9883 -1.2236 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7975 0.1903 -2.3510 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6706 0.1348 -0.8025 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4510 -1.9344 -0.1899 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5779 -1.8789 -1.7385 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3471 0.3832 0.3777 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4530 -2.3731 -1.5346 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6828 -1.1996 -2.0610 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0358 -1.1217 -2.7294 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9472 0.6080 1.0004 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.2116 -0.0798 -0.0480 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6830 1.6022 -1.7893 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4191 2.2899 -0.7418 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.4140 2.2422 0.0855 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6394 4.5250 -1.0302 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6444 5.3715 0.5358 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9728 3.7280 0.4146 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1123 4.3550 0.8420 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9428 5.6913 0.9618 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9146 4.6126 2.9431 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.0836 3.2770 2.8230 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.9725 6.2147 3.3059 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.6205 2.8694 4.9875 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.3833 2.7333 5.1901 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.6536 2.5243 3.5803 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.4713 6.3564 5.1126 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.0063 4.8779 5.9444 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.4165 4.2908 3.9924 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.8803 5.7695 3.1598 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.4271 5.8579 5.8526 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.6481 6.4451 2.1878 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.1315 8.1442 2.4025 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.4364 7.6629 2.6499 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.2234 7.3691 5.7491 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.5025 8.3215 4.2713 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.5311 9.7263 4.8041 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.2518 8.7732 6.2806 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.8667 10.3884 5.8275 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.4854 11.2027 9.3957 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.9987 12.0248 7.9034 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.7617 10.4908 8.3797 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.6572 10.2441 7.6986 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.4777 10.2734 9.2781 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.4654 8.7813 8.3076 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 3 1 0 0 0 0

1 13 1 0 0 0 0

3 4 1 0 0 0 0

3 5 2 0 0 0 0

4 49 1 0 0 0 0

4 50 1 0 0 0 0

4 51 1 0 0 0 0

5 6 1 0 0 0 0

5 14 1 0 0 0 0

6 7 2 0 0 0 0

6 8 1 0 0 0 0

8 9 4 0 0 0 0

8 13 4 0 0 0 0

9 10 4 0 0 0 0

9 52 1 0 0 0 0

10 11 4 0 0 0 0

10 53 1 0 0 0 0

11 12 4 0 0 0 0

11 54 1 0 0 0 0

12 13 4 0 0 0 0

12 55 1 0 0 0 0

14 15 1 0 0 0 0

14 56 1 0 0 0 0

14 57 1 0 0 0 0

15 16 2 0 0 0 0

15 58 1 0 0 0 0

16 17 1 0 0 0 0

16 18 1 0 0 0 0

17 59 1 0 0 0 0

17 60 1 0 0 0 0

17 61 1 0 0 0 0

18 19 1 0 0 0 0

18 62 1 0 0 0 0

18 63 1 0 0 0 0

19 20 1 0 0 0 0

19 64 1 0 0 0 0

19 65 1 0 0 0 0

20 21 2 0 0 0 0

20 66 1 0 0 0 0

21 22 1 0 0 0 0

21 23 1 0 0 0 0

22 67 1 0 0 0 0

22 68 1 0 0 0 0

22 69 1 0 0 0 0

23 24 1 0 0 0 0

23 70 1 0 0 0 0

23 71 1 0 0 0 0

24 25 1 0 0 0 0

24 72 1 0 0 0 0

24 73 1 0 0 0 0

25 26 2 0 0 0 0

25 74 1 0 0 0 0

26 27 1 0 0 0 0

26 28 1 0 0 0 0

27 75 1 0 0 0 0

27 76 1 0 0 0 0

27 77 1 0 0 0 0

28 29 1 0 0 0 0

28 78 1 0 0 0 0

28 79 1 0 0 0 0

29 30 1 0 0 0 0

29 80 1 0 0 0 0

29 81 1 0 0 0 0

30 31 2 0 0 0 0

30 82 1 0 0 0 0

31 32 1 0 0 0 0

31 33 1 0 0 0 0

32 83 1 0 0 0 0

32 84 1 0 0 0 0

32 85 1 0 0 0 0

33 34 1 0 0 0 0

33 86 1 0 0 0 0

33 87 1 0 0 0 0

34 35 1 0 0 0 0

34 88 1 0 0 0 0

34 89 1 0 0 0 0

35 36 2 0 0 0 0

35 90 1 0 0 0 0

36 37 1 0 0 0 0

36 38 1 0 0 0 0

37 91 1 0 0 0 0

37 92 1 0 0 0 0

37 93 1 0 0 0 0

38 39 1 0 0 0 0

38 94 1 0 0 0 0

38 95 1 0 0 0 0

39 40 1 0 0 0 0

39 96 1 0 0 0 0

39 97 1 0 0 0 0

40 41 2 0 0 0 0

40 98 1 0 0 0 0

41 42 1 0 0 0 0

41 43 1 0 0 0 0

42 99 1 0 0 0 0

42100 1 0 0 0 0

42101 1 0 0 0 0

43 44 1 0 0 0 0

43102 1 0 0 0 0

43103 1 0 0 0 0

44 45 1 0 0 0 0

44104 1 0 0 0 0

44105 1 0 0 0 0

45 46 2 0 0 0 0

45106 1 0 0 0 0

46 47 1 0 0 0 0

46 48 1 0 0 0 0

47107 1 0 0 0 0

47108 1 0 0 0 0

47109 1 0 0 0 0

48110 1 0 0 0 0

48111 1 0 0 0 0

48112 1 0 0 0 0

M END): 21 ms

reading 112 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

112 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C46H64O2

Net Charge

Average Mass

648.99920

Monoisotopic Mass

648.49063

InChI

InChI=1S/C46H64O2/c1-34(2)18-12-19-35(3)20-13-21-36(4)22-14-23-37(5)24-15-25-38(6)26-16-27-39(7)28-17-29-40(8)32-33-42-41(9)45(47)43-30-10-11-31-44(43)46(42)48/h10-11,18,20,22,24,26,28,30-32H,12-17,19,21,23,25,27,29,33H2,1-9H3/b35-20+,36-22+,37-24+,38-26+,39-28+,40-32+

InChIKey

RAKQPZMEYJZGPI-LJWNYQGCSA-N

SMILES

CC(C)=CCC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC1=C(C)C(=O)c2ccccc2C1=O

Metabolite of Species	Details
Bacillus subtilis (NCBI:txid1423)	See: PubMed
Mycoplasma genitalium (NCBI:txid2097)	See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: PubMed
Homo sapiens (NCBI:txid9606)	Found in blood serum (BTO:0000133). See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. (via menaquinone ) human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). (via vitamin K ) fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. (via vitamin K )

Application(s):	bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	menaquinone-7 (CHEBI:44245) has role Escherichia coli metabolite (CHEBI:76971) menaquinone-7 (CHEBI:44245) has role Mycoplasma genitalium metabolite (CHEBI:131604) menaquinone-7 (CHEBI:44245) has role bone density conservation agent (CHEBI:50646) menaquinone-7 (CHEBI:44245) has role cofactor (CHEBI:23357) menaquinone-7 (CHEBI:44245) has role human blood serum metabolite (CHEBI:85234) menaquinone-7 (CHEBI:44245) is a menaquinone (CHEBI:16374)

IUPAC Name

2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-1-yl]-3-methylnaphthalene-1,4-dione

Synonyms	Sources
(all-E)-2-(3,7,11,15,19,23,27-heptamethyl-2,6,10,14,18,22,26-octacosahept-aenyl)-3-methyl-1,4-naphthoquinone	ChemIDplus
(all-E)-2-(3,7,11,15,19,23,27-heptamethyl-2,6,10,14,18,22,26-octacosaheptaenyl)-3-methyl-1,4-naphthalenedione	ChemIDplus
menaquinone 7	ChEBI
menaquinone-7	UniProt
menaquinone-7	ChemIDplus
MK-7	ChEBI
vitamin K₂₍₃₅₎	ChemIDplus
vitamin MK 7	ChemIDplus

Manual Xrefs	Databases
CPD-9718	MetaCyc
DB13075	DrugBank
MQ7	PDBeChem
View more database links

Registry Numbers	Types	Sources
2124-57-4	CAS Registry Number	ChemIDplus
2343160	Reaxys Registry Number	Reaxys

Citations

Last Modified

26 July 2021

CHEBI:44245 - menaquinone-7

ChEBI is part of the ELIXIR infrastructure