(2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800)

ChEBI > Main

CHEBI:44800 - (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	(2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol

ChEBI ID	CHEBI:44800

ChEBI ASCII Name	(2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol

Definition	A tetrahydroxytetrahydrofuran in which the hydroxy groups are located at positions 2, 3, 4, and 4 and which is substituted by a methyl group at position 2 (the 2R,4S diastereoisomer).

Stars	This entity has been manually annotated by the ChEBI Team.

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__9062498416258102__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__9062498416258102__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:44800","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__9062498416258102__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"9062498416258102","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__9062498416258102__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 12041212203D

starting HoverWatcher_5

Time for openFile(

Marvin 12041212203D

20 20 0 0 0 0 999 V2000

-0.2630 -1.3950 1.5290 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.2000 -0.0420 1.0720 C 0 0 2 0 0 0 0 0 0 0 0 0

0.4090 0.8450 2.1590 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.5190 0.4240 0.7430 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7130 0.1810 -0.6660 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.3410 0.5480 -1.2870 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.1430 -0.1370 -2.5260 O 0 0 0 0 0 0 0 0 0 0 0 0

0.6500 0.0380 -0.2090 C 0 0 1 0 0 0 0 0 0 0 0 0

1.7230 0.9660 -0.0380 O 0 0 0 0 0 0 0 0 0 0 0 0

1.1540 -1.2510 -0.5620 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.2000 0.7870 3.0600 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4200 0.5040 2.3810 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4420 1.8770 1.8080 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8080 -1.3950 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9480 -0.8670 -0.8460 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4980 0.8250 -1.0620 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2510 1.6250 -1.4230 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8450 0.1540 -3.1220 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1820 1.0230 -0.8880 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6240 -1.1470 -1.4010 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 14 1 0 0 0 0

2 3 1 0 0 0 0

2 4 1 0 0 0 0

2 8 1 0 0 0 0

3 11 1 0 0 0 0

3 12 1 0 0 0 0

3 13 1 0 0 0 0

4 5 1 0 0 0 0

5 6 1 0 0 0 0

5 15 1 0 0 0 0

5 16 1 0 0 0 0

6 7 1 0 0 0 0

6 8 1 0 0 0 0

6 17 1 0 0 0 0

7 18 1 0 0 0 0

8 9 1 0 0 0 0

8 10 1 0 0 0 0

9 19 1 0 0 0 0

10 20 1 0 0 0 0

M END): 16 ms

reading 20 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

20 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C5H10O5

Net Charge

Average Mass

150.12990

Monoisotopic Mass

150.05282

InChI

InChI=1S/C5H10O5/c1-4(7)5(8,9)3(6)2-10-4/h3,6-9H,2H2,1H3/t3-,4+/m0/s1

InChIKey

BVIYGXUQVXBHQS-IUYQGCFVSA-N

SMILES

C[C@@]1(O)OC[C@H](O)C1(O)O

Roles Classification
Biological Role(s):	autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	(2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) has role autoinducer (CHEBI:71338) (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a cyclic ketal (CHEBI:59779) (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a ketone hydrate (CHEBI:63734) (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a tetrahydroxytetrahydrofuran (CHEBI:47041) (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol (CHEBI:44800) is a tetrol (CHEBI:33573)

IUPAC Name

(2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol

Synonyms	Sources
(2R,4S)-2-METHYL-2,3,3,4-TETRAHYDROXYTETRAHYDROFURAN	PDBeChem
(2R,4S)-2-methyldihydrofuran-2,3,3,4(2H)-tetrol	IUPAC
(2R,4S)-2-methyloxolane-2,3,3,4-tetrol	ChEBI
(2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol	UniProt
(R)-THMF	MetaCyc
AI-2	MetaCyc
auto inducer 2	MetaCyc

Manual Xrefs	Databases
CPD-10774	MetaCyc
PAV	PDBeChem
View more database links

Registry Number	Type	Source
9997002	Reaxys Registry Number	Reaxys

Citation

Miller ST, Xavier KB, Campagna SR, Taga ME, Semmelhack MF, Bassler BL, Hughson FM (2004)
Salmonella typhimurium recognizes a chemically distinct form of the bacterial quorum-sensing signal AI-2.
Molecular cell 15, 677-687 [PubMed:15350213]
[show Abstract]

Last Modified

21 November 2014

CHEBI:44800 - (2R,4S)-2-methyltetrahydrofuran-2,3,3,4-tetrol

ChEBI is part of the ELIXIR infrastructure