streptomycin (CHEBI:17076)

ChEBI > Main

CHEBI:17076 - streptomycin

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	streptomycin

ChEBI ID	CHEBI:17076

Definition	A amino cyclitol glycoside that consists of streptidine having a disaccharyl moiety attached at the 4-position. The parent of the streptomycin class

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:45745, CHEBI:9284, CHEBI:15119, CHEBI:26784

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__852800073936654__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__852800073936654__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:45745","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__852800073936654__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"852800073936654","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__852800073936654__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 07010813553D

starting HoverWatcher_5

Time for openFile(

Marvin 07010813553D

79 81 0 0 1 0 999 V2000

3.5499 1.8919 0.3517 C 0 0 1 0 0 0 0 0 0 0 0 0

4.8831 1.4232 0.5590 O 0 0 0 0 0 0 0 0 0 0 0 0

1.0357 1.3267 0.6611 C 0 0 2 0 0 0 0 0 0 0 0 0

1.8734 2.6398 -1.4601 C 0 0 1 0 0 0 0 0 0 0 0 0

1.6763 2.7013 -2.8774 O 0 0 0 0 0 0 0 0 0 0 0 0

0.7569 1.7663 -0.8153 C 0 0 2 0 0 0 0 0 0 0 0 0

3.3537 2.2823 -1.1438 C 0 0 1 0 0 0 0 0 0 0 0 0

4.1643 3.3345 -1.6136 N 0 0 0 0 0 0 0 0 0 0 0 0

3.6088 5.4794 -1.7619 N 0 0 0 0 0 0 0 0 0 0 0 0

4.2033 4.5371 -1.1279 C 0 0 0 0 0 0 0 0 0 0 0 0

4.7668 4.8050 -0.0135 N 0 0 0 0 0 0 0 0 0 0 0 0

2.5102 0.8600 0.8643 C 0 0 2 0 0 0 0 0 0 0 0 0

2.7733 0.6274 2.2506 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.4717 2.3868 -1.1005 N 0 0 0 0 0 0 0 0 0 0 0 0

-1.1687 3.7554 0.5637 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.8743 3.5359 -0.6582 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.9289 4.5174 -1.4765 N 0 0 0 0 0 0 0 0 0 0 0 0

-3.2097 1.0445 1.8008 C 0 0 2 0 0 0 0 0 0 0 0 0

-3.9889 1.5290 0.5470 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.8144 1.3305 1.6806 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.1875 0.2047 1.0712 C 0 0 1 0 0 0 0 0 0 0 0 0

0.2450 0.2234 1.1551 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.7698 -0.7457 3.4928 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.4241 -1.7090 4.1609 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.2594 -0.4777 2.1546 C 0 0 1 0 0 0 0 0 0 0 0 0

-4.1879 -1.1885 1.3289 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7938 -0.9491 1.8876 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.7467 -2.2326 1.2365 O 0 0 0 0 0 0 0 0 0 0 0 0

0.2194 -2.3581 -0.1974 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.4914 -2.8801 0.9422 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.9436 -3.8989 -1.8015 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.8667 -3.8062 -2.8882 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.6009 -4.5820 -0.5704 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.7796 -5.9715 -0.8465 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.3895 -2.4742 -1.4993 C 0 0 2 0 0 0 0 0 0 0 0 0

0.6730 -2.0473 -2.5450 C 0 0 0 0 0 0 0 0 0 0 0 0

1.8471 -2.8507 -2.4864 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.7594 -4.3958 0.7267 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.4267 -5.0549 1.8779 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.7251 -5.0665 3.1773 C 0 0 0 0 0 0 0 0 0 0 0 0

3.4335 2.7788 0.9775 H 0 0 0 0 0 0 0 0 0 0 0 0

4.9763 0.6229 0.0001 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8760 2.1827 1.3207 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7150 3.6476 -1.0719 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2915 3.3904 -3.2047 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7287 0.8444 -1.3801 H 0 0 0 0 0 0 0 0 0 0 0 0

3.6132 1.4016 -1.7406 H 0 0 0 0 0 0 0 0 0 0 0 0

4.6028 3.1969 -2.4293 H 0 0 0 0 0 0 0 0 0 0 0 0

3.5543 6.3369 -1.3920 H 0 0 0 0 0 0 0 0 0 0 0 0

3.1946 5.3068 -2.5833 H 0 0 0 0 0 0 0 0 0 0 0 0

4.7537 5.6744 0.3301 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6712 -0.0889 0.3424 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1266 -0.0481 2.5428 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9794 2.0009 -1.7868 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4402 4.6001 0.8543 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6862 4.3989 -2.3723 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1739 5.3670 -1.1725 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.5587 1.6793 2.6213 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.0572 1.3415 0.6657 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.6557 1.0241 -0.3610 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.8511 2.6016 0.4010 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4690 0.1064 0.0199 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.4626 -0.1575 3.8935 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.8683 -1.0801 0.4090 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2443 -1.0109 2.8345 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1945 -2.7643 1.7847 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1241 -4.5445 -2.1284 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1368 -4.7240 -3.0956 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5992 -4.1606 -0.4180 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2934 -6.0089 -1.6808 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2152 -1.7571 -1.5379 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2625 -2.0721 -3.5561 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0120 -1.0357 -2.3681 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4910 -2.3997 -3.0723 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2033 -4.8948 0.5710 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5415 -6.0369 1.6169 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2788 -5.7027 3.8673 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6835 -4.0667 3.6112 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2874 -5.4631 3.0809 H 0 0 0 0 0 0 0 0 0 0 0 0

7 4 1 0 0 0 0

7 1 1 0 0 0 0

4 6 1 0 0 0 0

6 3 1 0 0 0 0

3 12 1 0 0 0 0

12 1 1 0 0 0 0

1 2 1 0 0 0 0

3 22 1 0 0 0 0

4 5 1 0 0 0 0

6 14 1 0 0 0 0

7 8 1 0 0 0 0

8 10 1 0 0 0 0

10 9 1 0 0 0 0

10 11 2 0 0 0 0

12 13 1 0 0 0 0

14 16 1 0 0 0 0

16 15 2 0 0 0 0

16 17 1 0 0 0 0

20 18 1 0 0 0 0

20 21 1 0 0 0 0

18 25 1 0 0 0 0

25 27 1 0 0 0 0

27 21 1 0 0 0 0

18 19 1 0 0 0 0

21 22 1 0 0 0 0

25 23 1 0 0 0 0

23 24 2 0 0 0 0

25 26 1 0 0 0 0

27 28 1 0 0 0 0

29 35 1 0 0 0 0

29 30 1 0 0 0 0

35 31 1 0 0 0 0

31 33 1 0 0 0 0

33 38 1 0 0 0 0

38 30 1 0 0 0 0

30 28 1 0 0 0 0

31 32 1 0 0 0 0

33 34 1 0 0 0 0

35 36 1 0 0 0 0

36 37 1 0 0 0 0

38 39 1 0 0 0 0

39 40 1 0 0 0 0

1 41 1 0 0 0 0

2 42 1 0 0 0 0

3 43 1 0 0 0 0

4 44 1 0 0 0 0

5 45 1 0 0 0 0

6 46 1 0 0 0 0

7 47 1 0 0 0 0

8 48 1 0 0 0 0

9 49 1 0 0 0 0

9 50 1 0 0 0 0

11 51 1 0 0 0 0

12 52 1 0 0 0 0

13 53 1 0 0 0 0

14 54 1 0 0 0 0

15 55 1 0 0 0 0

17 56 1 0 0 0 0

17 57 1 0 0 0 0

18 58 1 0 0 0 0

19 59 1 0 0 0 0

19 60 1 0 0 0 0

19 61 1 0 0 0 0

21 62 1 0 0 0 0

23 63 1 0 0 0 0

26 64 1 0 0 0 0

27 65 1 0 0 0 0

30 66 1 0 0 0 0

31 67 1 0 0 0 0

32 68 1 0 0 0 0

33 69 1 0 0 0 0

34 70 1 0 0 0 0

35 71 1 0 0 0 0

36 72 1 0 0 0 0

36 73 1 0 0 0 0

37 74 1 0 0 0 0

38 75 1 0 0 0 0

39 76 1 0 0 0 0

40 77 1 0 0 0 0

40 78 1 0 0 0 0

40 79 1 0 0 0 0

M END): 23 ms

reading 79 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

79 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
[object Object]
Read full article at Wikipedia

Formula

C21H39N7O12

Net Charge

Average Mass

581.57434

Monoisotopic Mass

581.26567

InChI

InChI=1S/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+/m0/s1

InChIKey

UCSJYZPVAKXKNQ-HZYVHMACSA-N

SMILES

CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@H]1[C@@H](O[C@@H](C)[C@]1(O)C=O)O[C@H]1[C@H](O)[C@@H](O)[C@H](NC(N)=N)[C@@H](O)[C@@H]1NC(N)=N

Metabolite of Species	Details
Streptomyces griseus (NCBI:txid1911)	See: PubMed

Roles Classification
Biological Role(s):	protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial drug A drug used to treat or prevent bacterial infections. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. (via carbohydrate-containing antibiotic ) antimicrobial drug A drug used to treat or prevent microbial infections. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. (via antibiotic antifungal drug ) antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. (via antibiotic antifungal agent ) fungicide A substance used to destroy fungal pests. (via antibiotic fungicide )

Application(s):	antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial drug A drug used to treat or prevent microbial infections. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. (via antibiotic antifungal drug ) fungicide A substance used to destroy fungal pests. (via antibiotic fungicide )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	streptomycin (CHEBI:17076) has functional parent streptidine (CHEBI:27405) streptomycin (CHEBI:17076) has role antibacterial drug (CHEBI:36047) streptomycin (CHEBI:17076) has role antifungal agrochemical (CHEBI:86328) streptomycin (CHEBI:17076) has role antimicrobial agent (CHEBI:33281) streptomycin (CHEBI:17076) has role antimicrobial drug (CHEBI:36043) streptomycin (CHEBI:17076) has role bacterial metabolite (CHEBI:76969) streptomycin (CHEBI:17076) has role protein synthesis inhibitor (CHEBI:48001) streptomycin (CHEBI:17076) is a antibiotic antifungal drug (CHEBI:87113) streptomycin (CHEBI:17076) is a antibiotic fungicide (CHEBI:87114) streptomycin (CHEBI:17076) is a streptomycins (CHEBI:26788) streptomycin (CHEBI:17076) is conjugate base of streptomycin(3+) (CHEBI:58007)

Incoming	3''-adenylylstreptomycin (CHEBI:29076) has functional parent streptomycin (CHEBI:17076) 5'-hydroxystreptomycin (CHEBI:24750) has functional parent streptomycin (CHEBI:17076) streptomycin sulfate (CHEBI:32158) has functional parent streptomycin (CHEBI:17076) streptomycin(3+) (CHEBI:58007) is conjugate acid of streptomycin (CHEBI:17076)

IUPAC Name

N,N'''-[(1R,2R,3S,4R,5R,6S)-4-{5-deoxy-2-O-[2-deoxy-2-(methylamino)-α-L-glucopyranosyl]-3-C-formyl-α-L-lyxofuranosyloxy}-2,5,6-trihydroxycyclohexane-1,3-diyl]diguanidine

INN	Source
streptomycin	KEGG DRUG

Synonyms	Sources
2,4-Diguanidino-3,5,6-trihydroxycyclohexyl 5-deoxy-2-O-(2-deoxy-2-methylamino-alpha-L-glucopyranosyl)-3-C-formyl-beta-L-lyxopentanofuranoside	ChemIDplus
[2-deoxy-2-(dimethylamino)-α-L-glucopyranosyl]-(1→2)-[5-deoxy-3-C-formyl-α-L-lyxofuranosyl]-(1→4)-{N',N'''-[(1,3,5/2,4,6)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine}	IUPAC
SM	KEGG DRUG
streomycin	ChEBI
STREPTOMYCIN	PDBeChem

Brand Name	Source
Kantrex	DrugBank

Manual Xrefs	Databases
2481	DrugCentral
C00413	KEGG COMPOUND
D08531	KEGG DRUG
DB01082	DrugBank
HMDB0015214	HMDB
SRY	PDBeChem
streptomycin	Alan Wood's Pesticides
Streptomycin	Wikipedia
STREPTOMYCIN	MetaCyc
View more database links

Registry Numbers	Types	Sources
57-92-1	CAS Registry Number	KEGG COMPOUND
57-92-1	CAS Registry Number	ChemIDplus
74498	Reaxys Registry Number	Reaxys

Citations	Types	Sources
11228320	PubMed citation	Europe PMC
11905029	PubMed citation	Europe PMC
12118520	PubMed citation	Europe PMC
13030054	PubMed citation	Europe PMC
13116094	PubMed citation	Europe PMC
13136149	PubMed citation	Europe PMC
13596285	PubMed citation	Europe PMC
13691614	PubMed citation	Europe PMC
13985260	PubMed citation	Europe PMC
13990247	PubMed citation	Europe PMC
14623118	PubMed citation	Europe PMC
14828344	PubMed citation	Europe PMC
14852338	PubMed citation	Europe PMC
14939639	PubMed citation	Europe PMC
15081082	PubMed citation	Europe PMC
15137533	PubMed citation	Europe PMC
15207172	PubMed citation	Europe PMC
15686853	PubMed citation	Europe PMC
15736038	PubMed citation	Europe PMC
16904706	PubMed citation	Europe PMC
17105735	PubMed citation	Europe PMC
17238915	PubMed citation	Europe PMC
17429930	PubMed citation	Europe PMC
18173084	PubMed citation	Europe PMC
18916143	PubMed citation	Europe PMC
19052412	PubMed citation	Europe PMC
19335957	PubMed citation	Europe PMC
21350946	PubMed citation	Europe PMC
21362244	PubMed citation	Europe PMC
21593257	PubMed citation	Europe PMC
21937264	PubMed citation	Europe PMC
22101040	PubMed citation	Europe PMC

Last Modified

22 February 2017

CHEBI:17076 - streptomycin

ChEBI is part of the ELIXIR infrastructure