UDP-alpha-D-xylose (CHEBI:16082)

ChEBI > Main

CHEBI:16082 - UDP-α-D-xylose

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	UDP-α-D-xylose

ChEBI ID	CHEBI:16082

ChEBI ASCII Name	UDP-alpha-D-xylose

Definition	A UDP-sugar having α-xylose as the sugar component. It is an important metabolite in the nucleotide sugar metabolism in animals, plants, fungi, and bacteria.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:46260, CHEBI:13490, CHEBI:9813, CHEBI:22105

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__977551849455233__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__977551849455233__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:46260","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__977551849455233__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"977551849455233","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__977551849455233__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 03141114093D

starting HoverWatcher_5

Time for openFile(

Marvin 03141114093D

56 58 0 0 0 0 999 V2000

-0.1860 -0.5900 5.3700 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.2460 0.2260 6.6630 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.3660 1.1130 6.6160 O 0 0 0 0 0 0 0 0 0 0 0 0

1.0470 1.0370 6.8040 C 0 0 1 0 0 0 0 0 0 0 0 0

1.0680 1.6890 8.0750 O 0 0 0 0 0 0 0 0 0 0 0 0

2.2390 0.0810 6.6880 C 0 0 2 0 0 0 0 0 0 0 0 0

3.4540 0.8320 6.6650 O 0 0 0 0 0 0 0 0 0 0 0 0

2.1110 -0.7250 5.3940 C 0 0 0 0 0 0 0 0 0 0 0 0

0.9120 -1.4970 5.4230 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.7390 -0.4070 2.9990 P 0 0 2 0 0 0 0 0 0 0 0 0

-2.1740 -0.6110 3.2990 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0440 -1.8300 2.7070 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0210 0.2920 4.2590 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.5910 0.5370 1.7040 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.3270 -0.2190 0.4880 P 0 0 2 0 0 0 0 0 0 0 0 0

-2.7520 -0.4260 0.8270 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.6220 -1.6450 0.2390 O 0 0 0 0 0 0 0 0 0 0 0 0

0.9230 0.5690 -5.5090 N 0 0 0 0 0 0 0 0 0 0 0 0

1.5840 1.4430 -6.3290 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4950 -0.5900 -5.1400 C 0 0 0 0 0 0 0 0 0 0 0 0

0.8890 -1.3520 -4.4110 O 0 0 0 0 0 0 0 0 0 0 0 0

2.7240 -0.9240 -5.5750 N 0 0 0 0 0 0 0 0 0 0 0 0

3.4090 -0.0910 -6.3840 C 0 0 0 0 0 0 0 0 0 0 0 0

4.5230 -0.3900 -6.7740 O 0 0 0 0 0 0 0 0 0 0 0 0

2.8200 1.1350 -6.7760 C 0 0 0 0 0 0 0 0 0 0 0 0

3.1200 -1.7670 -5.3020 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1140 -1.1510 5.2530 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2170 0.6740 -0.8450 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.8850 -0.0460 -1.8820 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.8160 0.7520 -3.1850 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.4460 0.9250 -3.5810 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.5280 -0.0200 -4.3120 C 0 0 1 0 0 0 0 0 0 0 0 0

-3.6170 0.7390 -4.8390 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.4280 -0.2130 -5.3890 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.9590 -0.0120 -6.7000 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.4180 0.9040 -5.0240 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.3480 -0.4450 7.5150 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1550 0.5620 6.5220 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1000 1.7820 6.0100 H 0 0 0 0 0 0 0 0 0 0 0 0

1.8970 2.1850 8.1210 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2460 -0.5970 7.5420 H 0 0 0 0 0 0 0 0 0 0 0 0

4.1770 0.1940 6.5890 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0820 -0.0430 4.5440 H 0 0 0 0 0 0 0 0 0 0 0 0

2.9680 -1.3900 5.2950 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8860 -1.6520 2.5160 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3020 -1.4650 0.0210 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4000 -1.0120 -2.0230 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9280 -0.1990 -1.6040 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2880 1.7250 -3.0480 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8790 -0.9860 -3.9480 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9810 0.2310 -5.5770 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9670 -1.1970 -5.3040 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5770 -0.7370 -6.8650 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.7430 1.8620 -5.4290 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1190 2.3740 -6.6180 H 0 0 0 0 0 0 0 0 0 0 0 0

3.3530 1.8150 -7.4240 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 9 1 0 0 0 0

1 13 1 0 0 0 0

1 27 1 0 0 0 0

2 3 1 0 0 0 0

2 4 1 0 0 0 0

2 37 1 0 0 0 0

3 38 1 0 0 0 0

4 5 1 0 0 0 0

4 6 1 0 0 0 0

4 39 1 0 0 0 0

5 40 1 0 0 0 0

6 7 1 0 0 0 0

6 8 1 0 0 0 0

6 41 1 0 0 0 0

7 42 1 0 0 0 0

8 9 1 0 0 0 0

8 43 1 0 0 0 0

8 44 1 0 0 0 0

10 11 2 0 0 0 0

10 12 1 0 0 0 0

10 13 1 0 0 0 0

10 14 1 0 0 0 0

12 45 1 0 0 0 0

14 15 1 0 0 0 0

15 16 2 0 0 0 0

15 17 1 0 0 0 0

15 28 1 0 0 0 0

17 46 1 0 0 0 0

18 19 1 0 0 0 0

18 20 1 0 0 0 0

19 25 2 0 0 0 0

19 55 1 0 0 0 0

20 21 2 0 0 0 0

20 22 1 0 0 0 0

22 23 1 0 0 0 0

22 26 1 0 0 0 0

23 24 2 0 0 0 0

23 25 1 0 0 0 0

25 56 1 0 0 0 0

28 29 1 0 0 0 0

29 30 1 0 0 0 0

29 47 1 0 0 0 0

29 48 1 0 0 0 0

30 31 1 0 0 0 0

30 32 1 0 0 0 0

30 49 1 0 0 0 0

31 36 1 0 0 0 0

32 33 1 0 0 0 0

32 34 1 0 0 0 0

32 50 1 0 0 0 0

33 51 1 0 0 0 0

34 35 1 0 0 0 0

34 36 1 0 0 0 0

34 52 1 0 0 0 0

35 53 1 0 0 0 0

36 18 1 0 0 0 0

36 54 1 0 0 0 0

M END): 22 ms

reading 56 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

56 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C14H22N2O16P2

Net Charge

Average Mass

536.27580

Monoisotopic Mass

536.04446

InChI

InChI=1S/C14H22N2O16P2/c17-5-3-28-13(11(22)8(5)19)31-34(26,27)32-33(24,25)29-4-6-9(20)10(21)12(30-6)16-2-1-7(18)15-14(16)23/h1-2,5-6,8-13,17,19-22H,3-4H2,(H,24,25)(H,26,27)(H,15,18,23)/t5-,6-,8+,9-,10-,11-,12-,13-/m1/s1

InChIKey

DQQDLYVHOTZLOR-OCIMBMBZSA-N

SMILES

O[C@@H]1CO[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)n2ccc(=O)[nH]c2=O)[C@H](O)[C@H]1O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed

Roles Classification
Biological Role(s):	fundamental metabolite Any metabolite produced by all living cells.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	UDP-α-D-xylose (CHEBI:16082) has role fundamental metabolite (CHEBI:78675) UDP-α-D-xylose (CHEBI:16082) is a UDP-sugar (CHEBI:17297) UDP-α-D-xylose (CHEBI:16082) is conjugate acid of UDP-α-D-xylose(2−) (CHEBI:57632)

Incoming	UDP-α-D-xylose(2−) (CHEBI:57632) is conjugate base of UDP-α-D-xylose (CHEBI:16082)

IUPAC Name

uridine 5'-[3-(α-D-xylopyranosyl) dihydrogen diphosphate]

Synonyms	Sources
Udp xylose	ChemIDplus
UDP-alpha-D-xylose	KEGG COMPOUND
UDP-D-xylose	KEGG COMPOUND
UDP-xylose	ChEBI
UDP-xylose	KEGG COMPOUND
UDPxylose	KEGG COMPOUND
Uridine 5'-(trihydrogen diphosphate), P'-alpha-D-xylopyranosyl ester	ChemIDplus
Uridine diphosphate xylose	ChemIDplus
URIDINE-5'-DIPHOSPHATE-XYLOPYRANOSE	PDBeChem

Manual Xrefs	Databases
C00190	KEGG COMPOUND
G10613	KEGG GLYCAN
HMDB0001018	HMDB
UDX	PDBeChem
View more database links

Registry Numbers	Types	Sources
101812	Reaxys Registry Number	Reaxys
3616-06-6	CAS Registry Number	ChemIDplus

Citations

Han SH, Kim BG, Yoon JA, Chong Y, Ahn JH (2014)
Synthesis of flavonoid O-pentosides by Escherichia coli through engineering of nucleotide sugar pathways and glycosyltransferase.
Applied and environmental microbiology 80, 2754-2762 [PubMed:24561591]
[show Abstract]

Pandey RP, Malla S, Simkhada D, Kim BG, Sohng JK (2013)
Production of 3-O-xylosyl quercetin in Escherichia coli.
Applied microbiology and biotechnology 97, 1889-1901 [PubMed:23053089]
[show Abstract]

Rosenberger AF, Hangelmann L, Hofinger A, Wilson IB (2012)
UDP-xylose and UDP-galactose synthesis in Trichomonas vaginalis.
Molecular and biochemical parasitology 181, 53-56 [PubMed:22008417]
[show Abstract]

Gu X, Lee SG, Bar-Peled M (2011)
Biosynthesis of UDP-xylose and UDP-arabinose in Sinorhizobium meliloti 1021: first characterization of a bacterial UDP-xylose synthase, and UDP-xylose 4-epimerase.
Microbiology (Reading, England) 157, 260-269 [PubMed:20847005]
[show Abstract]

Harper AD, Bar-Peled M (2002)
Biosynthesis of UDP-xylose. Cloning and characterization of a novel Arabidopsis gene family, UXS, encoding soluble and putative membrane-bound UDP-glucuronic acid decarboxylase isoforms.
Plant physiology 130, 2188-2198 [PubMed:12481102]
[show Abstract]

Last Modified

27 January 2016

CHEBI:16082 - UDP-α-D-xylose

ChEBI is part of the ELIXIR infrastructure