2-methyl-1-hydroxypropylthiamine diphosphate (CHEBI:48522)

ChEBI > Main

CHEBI:48522 - 2-methyl-1-hydroxypropylthiamine diphosphate

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	2-methyl-1-hydroxypropylthiamine diphosphate

ChEBI ID	CHEBI:48522

Definition	The diphosphate of thiamine(1+), substituted at C-2 of the thiazole ring by a hydroxylated sec-butyl group.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:45938, CHEBI:29142

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__0364277708009735__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__0364277708009735__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:48522","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__0364277708009735__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"0364277708009735","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__0364277708009735__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09130722143D

starting HoverWatcher_5

Time for openFile(

Marvin 09130722143D

57 58 0 0 0 0 999 V2000

8.4370 0.6100 -0.3780 O 0 0 0 0 0 0 0 0 0 0 0 0

6.9680 0.4260 0.2570 P 0 0 2 0 0 0 0 0 0 0 0 0

6.6970 1.5960 1.3290 O 0 0 0 0 0 0 0 0 0 0 0 0

6.8830 -0.8890 0.9300 O 0 0 0 0 0 0 0 0 0 0 0 0

5.8650 0.5030 -0.9130 O 0 0 0 0 0 0 0 0 0 0 0 0

4.4940 -0.0750 -0.2980 P 0 0 1 0 0 0 0 0 0 0 0 0

4.5880 -1.6780 -0.1880 O 0 0 0 0 0 0 0 0 0 0 0 0

4.2760 0.5000 1.0490 O 0 0 0 0 0 0 0 0 0 0 0 0

3.2640 0.3260 -1.2570 O 0 0 0 0 0 0 0 0 0 0 0 0

2.0710 -0.1090 -0.6020 C 0 0 0 0 0 0 0 0 0 0 0 0

0.8580 0.2430 -1.4660 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.4000 -0.2150 -0.7760 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.1700 0.4500 0.0830 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.8090 1.8590 0.4770 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.2370 -1.7870 -0.9030 S 0 0 0 0 0 0 0 0 0 0 0 0

-2.5830 -1.4430 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.6020 -2.2270 0.5880 C 0 5 0 0 0 0 0 0 0 0 0 0

-3.9320 -2.3430 1.9040 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.3860 -2.9830 -0.4550 C 0 0 1 0 0 0 0 0 0 0 0 0

-3.4490 -3.9260 -1.2130 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.4870 -3.7980 0.2270 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.2890 -0.1370 0.6060 N 0 3 0 0 0 0 0 0 0 0 0 0

-3.1460 0.5810 1.5520 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.7730 3.9030 -1.3150 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.2680 -1.8480 2.4030 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.8350 -2.2770 -1.1530 H 0 0 0 0 0 0 0 0 0 0 0 0

4.7300 -2.0120 -1.0850 H 0 0 0 0 0 0 0 0 0 0 0 0

9.0660 0.5570 0.3550 H 0 0 0 0 0 0 0 0 0 0 0 0

6.7620 2.4340 0.8500 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.1070 1.4590 0.7930 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.7760 2.7610 0.4760 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.6470 3.5050 -0.1930 N 0 0 0 0 0 0 0 0 0 0 0 0

-5.8170 3.0190 -0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.1730 1.7830 -0.2750 N 0 0 0 0 0 0 0 0 0 0 0 0

-5.3520 0.9740 0.3880 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.7310 -0.3260 0.6820 N 0 0 0 0 0 0 0 0 0 0 0 0

1.9850 0.3880 0.3640 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1100 -1.1880 -0.4540 H 0 0 0 0 0 0 0 0 0 0 0 0

0.9440 -0.2530 -2.4330 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8190 1.3230 -1.6140 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2830 2.5610 -0.2100 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1580 2.0530 1.4910 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2730 1.9830 0.4340 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0000 -4.6310 -0.5140 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.0160 -4.4720 -1.9670 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6650 -3.3450 -1.6980 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.0380 -4.5030 0.9260 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.1550 -3.1260 0.7670 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.0540 -4.3440 -0.5270 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.7060 -0.1370 2.1520 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5290 1.1970 2.2050 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8210 3.1700 0.7690 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.5950 3.7960 -2.3850 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.7980 3.6110 -1.0860 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.6170 4.9420 -1.0230 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.4710 -0.7350 0.2070 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2550 -0.8280 1.3630 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 28 1 0 0 0 0

2 3 1 0 0 0 0

2 4 2 0 0 0 0

2 5 1 0 0 0 0

3 29 1 0 0 0 0

5 6 1 0 0 0 0

6 7 1 0 0 0 0

6 8 2 0 0 0 0

6 9 1 0 0 0 0

7 27 1 0 0 0 0

9 10 1 0 0 0 0

10 11 1 0 0 0 0

10 37 1 0 0 0 0

10 38 1 0 0 0 0

11 12 1 0 0 0 0

11 39 1 0 0 0 0

11 40 1 0 0 0 0

12 13 4 0 0 0 0

12 15 4 0 0 0 0

13 14 1 0 0 0 0

13 22 4 0 0 0 0

14 41 1 0 0 0 0

14 42 1 0 0 0 0

14 43 1 0 0 0 0

15 16 4 0 0 0 0

16 17 1 0 0 0 0

16 22 4 0 0 0 0

17 18 1 0 0 0 0

17 19 1 0 0 0 0

18 25 1 0 0 0 0

19 20 1 0 0 0 0

19 21 1 0 0 0 0

19 26 1 0 0 0 0

20 44 1 0 0 0 0

20 45 1 0 0 0 0

20 46 1 0 0 0 0

21 47 1 0 0 0 0

21 48 1 0 0 0 0

21 49 1 0 0 0 0

22 23 1 0 0 0 0

23 30 1 0 0 0 0

23 50 1 0 0 0 0

23 51 1 0 0 0 0

24 53 1 0 0 0 0

24 54 1 0 0 0 0

24 55 1 0 0 0 0

30 31 4 0 0 0 0

30 35 4 0 0 0 0

31 32 4 0 0 0 0

31 52 1 0 0 0 0

32 33 4 0 0 0 0

33 24 1 0 0 0 0

33 34 4 0 0 0 0

34 35 4 0 0 0 0

35 36 1 0 0 0 0

36 56 1 0 0 0 0

36 57 1 0 0 0 0

M CHG 2 17 -1 22 1

M END): 20 ms

reading 57 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

57 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C16H27N4O8P2S

Net Charge

Average Mass

497.42000

Monoisotopic Mass

497.10194

InChI

InChI=1S/C16H26N4O8P2S/c1-9(2)14(21)16-20(8-12-7-18-11(4)19-15(12)17)10(3)13(31-16)5-6-27-30(25,26)28-29(22,23)24/h7,9,14,21H,5-6,8H2,1-4H3,(H4-,17,18,19,22,23,24,25,26)/p+1

InChIKey

SSYCSHKTIOHFEZ-UHFFFAOYSA-O

SMILES

CC(C)C(O)c1sc(CCOP(O)(=O)OP(O)(O)=O)c(C)[n+]1Cc1cnc(C)nc1N

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed

Roles Classification
Chemical Role(s):	Bronsted base A molecular entity capable of accepting a hydron from a donor (Bronsted acid). (via organic amino compound )

Biological Role(s):	mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	2-methyl-1-hydroxypropylthiamine diphosphate (CHEBI:48522) has role mouse metabolite (CHEBI:75771) 2-methyl-1-hydroxypropylthiamine diphosphate (CHEBI:48522) is a 1,3-thiazolium cation (CHEBI:63048) 2-methyl-1-hydroxypropylthiamine diphosphate (CHEBI:48522) is a aminopyrimidine (CHEBI:38338) 2-methyl-1-hydroxypropylthiamine diphosphate (CHEBI:48522) is a thiamine phosphate (CHEBI:26945)

IUPAC Name

3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(1-hydroxy-2-methylpropyl)-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium

Synonyms	Sources
1-hydroxy-2-methylpropyl-thiamine diphosphate	ChEBI
1-hydroxy-2-methylpropyl-thiamine pyrophosphate	ChEBI
2-methyl-1-hydroxypropyl-thiamine diphosphate	ChEBI
2-methyl-1-hydroxypropyl-thiamine pyrophosphate	ChEBI
2-Methyl-1-hydroxypropyl-ThPP	KEGG COMPOUND
2-Methyl-1-hydroxypropyl-TPP	KEGG COMPOUND
3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-diphosphoethyl)-2-(1-hydroxy-2-methylpropyl)-4-methyl-1,3-thiazol-3-ium	ChEBI

Manual Xrefs	Databases
C15976	KEGG COMPOUND
THV	PDBeChem
View more database links

Last Modified

25 October 2017

General Comment
2005-10-13	Cited in Reactome

CHEBI:48522 - 2-methyl-1-hydroxypropylthiamine diphosphate

ChEBI is part of the ELIXIR infrastructure