guanosine 3'-monophosphate (CHEBI:28072)

ChEBI > Main

CHEBI:28072 - guanosine 3'-monophosphate

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	guanosine 3'-monophosphate

ChEBI ID	CHEBI:28072

Definition	A guanosine 3'-phosphate compound with a monophosphate group at the 3'-position.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:24447, CHEBI:39948, CHEBI:42888, CHEBI:5567

Supplier Information	ChemicalBook:CB6230832, eMolecules:480962, ZINC000000154564

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09130717073D

starting HoverWatcher_5

Time for openFile(

Marvin 09130717073D

38 40 0 0 0 0 999 V2000

1.0750 0.4110 4.1470 P 0 0 2 0 0 0 0 0 0 0 0 0

-0.2000 0.5860 4.8770 O 0 0 0 0 0 0 0 0 0 0 0 0

2.1760 -0.2240 5.1340 O 0 0 0 0 0 0 0 0 0 0 0 0

1.5910 1.8410 3.6160 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.6230 -1.3090 2.6160 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.4790 -0.4840 2.8450 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.3590 -0.8870 1.8850 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.7760 -0.6950 0.5160 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.1370 0.0410 2.0590 C 0 0 1 0 0 0 0 0 0 0 0 0

0.8440 -0.5740 2.8940 O 0 0 0 0 0 0 0 0 0 0 0 0

0.4070 0.2200 0.6220 C 0 0 1 0 0 0 0 0 0 0 0 0

1.7430 -0.2760 0.5280 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.5530 -0.6190 -0.2470 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.7930 0.0470 -1.5300 N 0 0 0 0 0 0 0 0 0 0 0 0

-1.7670 0.9660 -1.7920 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.6900 1.3480 -3.0330 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.6660 0.7000 -3.6400 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.1270 0.7150 -4.9480 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.6050 1.4310 -5.8120 O 0 0 0 0 0 0 0 0 0 0 0 0

0.9320 -0.0780 -5.2140 N 0 0 0 0 0 0 0 0 0 0 0 0

1.4540 -0.8790 -4.2420 C 0 0 0 0 0 0 0 0 0 0 0 0

2.5280 -1.6790 -4.5430 N 0 0 0 0 0 0 0 0 0 0 0 0

0.9630 -0.9020 -3.0230 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.0820 -0.1380 -2.6840 C 0 0 0 0 0 0 0 0 0 0 0 0

2.2830 0.3950 5.8690 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4210 1.6820 3.1470 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1400 -0.6110 3.8730 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7440 0.5590 2.6760 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.3040 -1.0230 3.2400 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0720 -1.9260 2.0510 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.4430 1.0010 2.4750 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3690 1.2690 0.3280 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0290 -0.1380 -0.3850 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1440 -1.6160 -0.4090 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4930 1.3230 -1.0760 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3190 -0.0850 -6.1040 H 0 0 0 0 0 0 0 0 0 0 0 0

2.9130 -2.2510 -3.8610 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8990 -1.6760 -5.4390 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

1 10 1 0 0 0 0

3 25 1 0 0 0 0

4 26 1 0 0 0 0

5 6 1 0 0 0 0

5 29 1 0 0 0 0

6 7 1 0 0 0 0

6 27 1 0 0 0 0

6 28 1 0 0 0 0

7 8 1 0 0 0 0

7 9 1 0 0 0 0

7 30 1 0 0 0 0

8 13 1 0 0 0 0

9 10 1 0 0 0 0

9 11 1 0 0 0 0

9 31 1 0 0 0 0

11 12 1 0 0 0 0

11 13 1 0 0 0 0

11 32 1 0 0 0 0

12 33 1 0 0 0 0

13 14 1 0 0 0 0

13 34 1 0 0 0 0

14 15 4 0 0 0 0

14 24 4 0 0 0 0

15 16 4 0 0 0 0

15 35 1 0 0 0 0

16 17 4 0 0 0 0

17 18 1 0 0 0 0

17 24 4 0 0 0 0

18 19 2 0 0 0 0

18 20 1 0 0 0 0

20 21 1 0 0 0 0

20 36 1 0 0 0 0

21 22 1 0 0 0 0

21 23 2 0 0 0 0

22 37 1 0 0 0 0

22 38 1 0 0 0 0

23 24 1 0 0 0 0

M END): 22 ms

reading 38 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

38 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Jmol JavaScript applet jmolApplet1_object__44117885595963__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet1_object__44117885595963__)

viewerOptions:

{ "name":"jmolApplet1_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:5567","platform":"J.awtjs2d.Platform","fullName":"jmolApplet1_object__44117885595963__","display":"jmolApplet1_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"44117885595963","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet1_object (signed)

starting HoverWatcher_6

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet1_object__44117885595963__ ready

Molfile expand

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__6612842990762484__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__6612842990762484__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:5567","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__6612842990762484__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"6612842990762484","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__6612842990762484__ ready

starting QueueThread0_7

script 1 started

starting HoverWatcher_8

starting HoverWatcher_9

The Resolver thinks Mol

Marvin 09130718373D

starting HoverWatcher_10

Time for openFile(

Marvin 09130718373D

37 39 0 0 0 0 999 V2000

-3.9533 3.0747 2.1453 H 0 0 0 0 0 0 0 0 0 0 0 0

2.5967 -2.3235 -0.5926 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.5156 3.0161 1.5299 H 0 0 0 0 0 0 0 0 0 0 0 0

3.8589 -1.9059 0.5909 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3951 0.3730 -1.7426 H 0 0 0 0 0 0 0 0 0 0 0 0

5.9368 1.7226 -1.2699 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2654 -0.4286 0.7813 C 0 0 1 0 0 0 0 0 0 0 0 0

-4.2868 1.5413 0.8442 C 0 0 0 0 0 0 0 0 0 0 0 0

0.6280 0.4863 -0.0945 C 0 0 1 0 0 0 0 0 0 0 0 0

2.0464 0.1539 0.4344 C 0 0 1 0 0 0 0 0 0 0 0 0

-2.6957 -0.0137 0.2225 C 0 0 0 0 0 0 0 0 0 0 0 0

1.8854 -1.2193 1.1149 C 0 0 2 0 0 0 0 0 0 0 0 0

-3.6250 -0.6532 -0.6059 C 0 0 0 0 0 0 0 0 0 0 0 0

2.8277 -2.2372 0.4691 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.9379 -0.1319 -0.6794 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7597 -1.7442 -0.7713 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.1311 1.3347 0.0257 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.4506 0.0312 1.7521 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3897 1.5378 0.0655 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3661 0.9033 1.1584 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1056 -1.1337 2.1790 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2688 -4.1197 0.6628 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0280 -2.4792 -1.0725 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2373 0.9593 0.0597 N 0 0 0 0 0 0 0 0 0 0 0 0

-4.6180 2.6517 1.5793 N 0 0 0 0 0 0 0 0 0 0 0 0

-3.0636 1.0666 0.9211 N 0 0 0 0 0 0 0 0 0 0 0 0

-2.9924 -1.7026 -1.1850 N 0 0 0 0 0 0 0 0 0 0 0 0

-1.5296 -0.7197 0.1007 N 0 0 0 0 0 0 0 0 0 0 0 0

0.5054 0.1426 -1.4761 O 0 0 0 0 0 0 0 0 0 0 0 0

2.9806 0.0713 -0.6438 O 0 0 0 0 0 0 0 0 0 0 0 0

4.8024 0.7611 0.9614 O 0 0 0 0 0 0 0 0 0 0 0 0

3.5392 2.6041 -0.2130 O 0 0 0 0 0 0 0 0 0 0 0 0

5.2515 1.0810 -1.5017 O 0 0 0 0 0 0 0 0 0 0 0 0

0.5206 -1.6306 0.9297 O 0 0 0 0 0 0 0 0 0 0 0 0

2.6585 -3.5090 1.0983 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.7798 -0.6567 -1.3880 O 0 0 0 0 0 0 0 0 0 0 0 0

4.1576 1.1215 -0.3211 P 0 0 2 0 0 0 0 0 0 0 0 0

7 9 1 0 0 0 0

7 18 1 0 0 0 0

7 28 1 0 0 0 0

7 34 1 0 0 0 0

9 10 1 0 0 0 0

9 19 1 0 0 0 0

9 29 1 0 0 0 0

10 12 1 0 0 0 0

10 20 1 0 0 0 0

10 30 1 0 0 0 0

11 13 4 0 0 0 0

12 14 1 0 0 0 0

12 21 1 0 0 0 0

12 34 1 0 0 0 0

13 15 1 0 0 0 0

14 2 1 0 0 0 0

14 4 1 0 0 0 0

14 35 1 0 0 0 0

15 36 2 0 0 0 0

16 23 1 0 0 0 0

24 8 1 0 0 0 0

24 15 1 0 0 0 0

24 17 1 0 0 0 0

25 1 1 0 0 0 0

25 3 1 0 0 0 0

25 8 1 0 0 0 0

26 8 2 0 0 0 0

26 11 1 0 0 0 0

27 13 4 0 0 0 0

27 16 4 0 0 0 0

28 11 4 0 0 0 0

28 16 4 0 0 0 0

29 5 1 0 0 0 0

33 6 1 0 0 0 0

35 22 1 0 0 0 0

37 30 1 0 0 0 0

37 31 2 0 0 0 0

37 32 1 0 0 0 0

37 33 1 0 0 0 0

M END): 7 ms

reading 37 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

37 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C10H14N5O8P

Net Charge

Average Mass

363.22060

Monoisotopic Mass

363.05800

InChI

InChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-5(17)6(3(1-16)22-9)23-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1

InChIKey

ZDPUTNZENXVHJC-UUOKFMHZSA-N

SMILES

Nc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](CO)[C@@H](OP(O)(O)=O)[C@H]1O

Metabolite of Species	Details
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	guanosine 3'-monophosphate (CHEBI:28072) has role Escherichia coli metabolite (CHEBI:76971) guanosine 3'-monophosphate (CHEBI:28072) is a guanosine 3'-phosphate (CHEBI:37120) guanosine 3'-monophosphate (CHEBI:28072) is a purine ribonucleoside 3'-monophosphate (CHEBI:37020) guanosine 3'-monophosphate (CHEBI:28072) is conjugate acid of guanosine 3'-monophosphate(2−) (CHEBI:60732)

Incoming	guanosine 3'-monophosphate(2−) (CHEBI:60732) is conjugate base of guanosine 3'-monophosphate (CHEBI:28072)

IUPAC Name

3'-guanylic acid

Synonyms	Sources
3'-GMP	KEGG COMPOUND
3'-Guanylic acid	KEGG COMPOUND
Gp	KEGG COMPOUND
Guanosine 3'-phosphate	KEGG COMPOUND
GUANOSINE-3'-MONOPHOSPHATE	PDBeChem
Guo-3'-P	KEGG COMPOUND

Manual Xrefs	Databases
3GP	PDBeChem
C06193	KEGG COMPOUND
DB03315	DrugBank
View more database links

Registry Numbers	Types	Sources
117-68-0	CAS Registry Number	ChemIDplus
59480	Beilstein Registry Number	Beilstein
909702	Gmelin Registry Number	Gmelin

Last Modified

25 January 2016

CHEBI:28072 - guanosine 3'-monophosphate

ChEBI is part of the ELIXIR infrastructure