phenylacetyl-CoA (CHEBI:15537)

ChEBI > Main

CHEBI:15537 - phenylacetyl-CoA

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	phenylacetyl-CoA

ChEBI ID	CHEBI:15537

Definition	An acyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of phenylacetic acid.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:8086, CHEBI:14780, CHEBI:25980

Supplier Information	ChemicalBook:CB4368670, eMolecules:497148, ZINC000000901020

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__714839057474124__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__714839057474124__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:8086","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__714839057474124__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"714839057474124","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__714839057474124__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

FAQ - Ideal conformer

Mrv1927 06092110503D

starting HoverWatcher_5

Time for openFile(FAQ - Ideal conformer

Mrv1927 06092110503D

99102 0 0 0 0 999 V2000

-7.2960 -7.6530 0.1890 N 0 0 0 0 0 0 0 0 0 0 0 0

-5.3960 2.7100 2.4040 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.9470 2.7240 0.9930 P 0 0 1 0 0 5 0 0 0 0 0 0

13.3180 -1.7460 -0.9550 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.1980 -2.4970 -0.4280 C 0 0 1 0 0 0 0 0 0 0 0 0

12.3560 -0.7500 -1.9610 S 0 0 0 0 0 0 0 0 0 0 0 0

-7.4010 -6.9530 -0.9260 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.5020 4.0490 0.2660 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.1890 3.4490 1.8020 P 0 0 2 0 0 5 0 0 0 0 0 0

14.5590 -2.3990 -1.5070 C 0 0 1 0 0 0 0 0 0 0 0 0

-8.6660 -2.0660 -0.6430 C 0 0 2 0 0 0 0 0 0 0 0 0

-9.1820 -2.6340 -1.8490 O 0 0 0 0 0 0 0 0 0 0 0 0

11.0630 -0.2740 -0.7870 C 0 0 1 0 0 0 0 0 0 0 0 0

-7.3600 -5.6370 -0.9410 N 0 0 0 0 0 0 0 0 0 0 0 0

-3.3380 2.7190 0.9430 O 0 0 0 0 0 0 0 0 0 0 0 0

15.2200 -3.2160 -0.4270 C 0 0 0 0 0 0 0 0 0 0 0 0

-8.5930 -0.5270 -0.7570 C 0 0 2 0 0 0 0 0 0 0 0 0

-9.0620 -0.0970 -2.0370 O 0 0 0 0 0 0 0 0 0 0 0 0

-10.2970 0.9190 -2.2220 P 0 0 1 0 0 5 0 0 0 0 0 0

10.0570 0.6460 -1.4820 C 0 0 1 0 0 0 0 0 0 0 0 0

-7.2090 -4.9520 0.1880 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.9650 2.6540 3.1840 O 0 0 0 0 0 0 0 0 0 0 0 0

14.8760 -4.5440 -0.2570 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.0900 -0.2100 -0.5970 C 0 0 2 0 0 0 0 0 0 0 0 0

-6.5510 -1.3340 0.1330 O 0 0 0 0 0 0 0 0 0 0 0 0

9.0100 1.0310 -0.5310 N 0 0 0 0 0 0 0 0 0 0 0 0

13.0010 -1.9260 0.2020 O 0 0 0 0 0 0 0 0 0 0 0 0

-7.0940 -5.6510 1.4010 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6020 4.8400 2.0950 O 0 0 0 0 0 0 0 0 0 0 0 0

15.4820 -5.2940 0.7340 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.9000 1.0830 0.2000 C 0 0 1 0 0 0 0 0 0 0 0 0

-5.5120 1.4200 0.2370 O 0 0 0 0 0 0 0 0 0 0 0 0

8.0090 1.8440 -0.9240 C 0 0 0 0 0 0 0 0 0 0 0 0

7.9750 2.2570 -2.0640 O 0 0 0 0 0 0 0 0 0 0 0 0

-7.1430 -7.0550 1.3650 C 0 0 0 0 0 0 0 0 0 0 0 0

-7.0340 -7.7980 2.5280 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.8160 3.4630 0.9620 O 0 0 0 0 0 0 0 0 0 0 0 0

16.1740 -2.6390 0.3910 C 0 0 0 0 0 0 0 0 0 0 0 0

6.9330 2.2410 0.0530 C 0 0 1 0 0 0 0 0 0 0 0 0

-6.9510 -4.7280 2.3820 N 0 0 0 0 0 0 0 0 0 0 0 0

-11.6470 0.2250 -1.6860 O 0 0 0 0 0 0 0 0 0 0 0 0

16.7790 -3.3880 1.3810 C 0 0 0 0 0 0 0 0 0 0 0 0

5.9270 3.1610 -0.6410 C 0 0 1 0 0 0 0 0 0 0 0 0

-6.9710 -3.5350 1.8610 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.0390 2.1550 -1.4510 O 0 0 0 0 0 0 0 0 0 0 0 0

16.4320 -4.7150 1.5550 C 0 0 0 0 0 0 0 0 0 0 0 0

4.8810 3.5460 0.3090 N 0 0 0 0 0 0 0 0 0 0 0 0

-7.1280 -3.6210 0.5100 N 0 0 0 0 0 0 0 0 0 0 0 0

-10.4630 1.2830 -3.7810 O 0 0 0 0 0 0 0 0 0 0 0 0

3.8800 4.3590 -0.0840 C 0 0 0 0 0 0 0 0 0 0 0 0

3.8950 4.8460 -1.1940 O 0 0 0 0 0 0 0 0 0 0 0 0

2.7430 4.6620 0.8570 C 0 0 2 0 0 0 0 0 0 0 0 0

3.0770 4.2100 2.1710 O 0 0 0 0 0 0 0 0 0 0 0 0

1.4790 3.9460 0.3780 C 0 0 1 0 0 0 0 0 0 0 0 0

0.3640 4.1320 1.4100 C 0 0 1 0 0 0 0 0 0 0 0 0

1.0360 4.5350 -0.9630 C 0 0 0 0 0 0 0 0 0 0 0 0

1.7720 2.4540 0.2070 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.7360 -2.7670 -1.3780 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.5250 -7.4790 -1.8610 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2460 4.1240 -0.6630 H 0 0 0 0 0 0 0 0 0 0 0 0

14.2880 -3.0490 -2.3390 H 0 0 0 0 0 0 0 0 0 0 0 0

15.2500 -1.6310 -1.8550 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.2790 -2.3600 0.2090 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.1930 -3.6010 -1.8550 H 0 0 0 0 0 0 0 0 0 0 0 0

10.5510 -1.1670 -0.4280 H 0 0 0 0 0 0 0 0 0 0 0 0

11.5130 0.2510 0.0560 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.1700 -0.0580 0.0400 H 0 0 0 0 0 0 0 0 0 0 0 0

10.5680 1.5390 -1.8400 H 0 0 0 0 0 0 0 0 0 0 0 0

9.6070 0.1220 -2.3250 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6920 1.7330 3.0680 H 0 0 0 0 0 0 0 0 0 0 0 0

14.1340 -4.9960 -0.8980 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.6130 -0.1280 -1.5730 H 0 0 0 0 0 0 0 0 0 0 0 0

9.0380 0.7020 0.3800 H 0 0 0 0 0 0 0 0 0 0 0 0

15.2130 -6.3310 0.8670 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.4570 1.8890 -0.2780 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.2670 0.9400 1.2160 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.9220 -7.3490 3.3810 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.0700 -8.7660 2.4900 H 0 0 0 0 0 0 0 0 0 0 0 0

16.4450 -1.6030 0.2550 H 0 0 0 0 0 0 0 0 0 0 0 0

6.4220 1.3480 0.4120 H 0 0 0 0 0 0 0 0 0 0 0 0

7.3830 2.7650 0.8960 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.8790 -0.5930 -2.1470 H 0 0 0 0 0 0 0 0 0 0 0 0

17.5250 -2.9380 2.0200 H 0 0 0 0 0 0 0 0 0 0 0 0

6.4390 4.0540 -1.0000 H 0 0 0 0 0 0 0 0 0 0 0 0

5.4770 2.6360 -1.4840 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.8780 -2.6140 2.4170 H 0 0 0 0 0 0 0 0 0 0 0 0

16.9050 -5.3010 2.3290 H 0 0 0 0 0 0 0 0 0 0 0 0

4.9080 3.2160 1.2210 H 0 0 0 0 0 0 0 0 0 0 0 0

-11.1910 1.8930 -3.9670 H 0 0 0 0 0 0 0 0 0 0 0 0

2.5650 5.7380 0.8770 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2490 3.2600 2.2280 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1550 5.1950 1.5310 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6800 3.7120 2.3650 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7960 4.3340 -1.7170 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0930 4.0800 -1.2670 H 0 0 0 0 0 0 0 0 0 0 0 0

0.9020 5.6120 -0.8600 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0880 2.0340 1.1620 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8720 1.9440 -0.1350 H 0 0 0 0 0 0 0 0 0 0 0 0

2.5660 2.3220 -0.5280 H 0 0 0 0 0 0 0 0 0 0 0 0

35 1 2 0 0 0 0

1 7 1 0 0 0 0

2 3 2 0 0 0 0

3 8 1 6 0 0 0

3 15 1 0 0 0 0

3 32 1 0 0 0 0

6 4 1 0 0 0 0

4 10 1 0 0 0 0

4 27 2 0 0 0 0

11 5 1 0 0 0 0

5 25 1 0 0 0 0

5 48 1 0 0 0 0

5 58 1 6 0 0 0

6 13 1 0 0 0 0

14 7 2 0 0 0 0

7 59 1 0 0 0 0

8 60 1 0 0 0 0

29 9 2 0 0 0 0

9 37 1 6 0 0 0

9 22 1 0 0 0 0

9 15 1 0 0 0 0

10 16 1 0 0 0 0

10 61 1 0 0 0 0

10 62 1 0 0 0 0

17 11 1 0 0 0 0

11 12 1 0 0 0 0

11 63 1 1 0 0 0

12 64 1 0 0 0 0

20 13 1 0 0 0 0

13 65 1 0 0 0 0

13 66 1 0 0 0 0

21 14 1 0 0 0 0

16 23 2 0 0 0 0

16 38 1 0 0 0 0

17 24 1 0 0 0 0

17 18 1 0 0 0 0

17 67 1 1 0 0 0

19 18 1 0 0 0 0

45 19 2 0 0 0 0

19 49 1 0 0 0 0

19 41 1 0 0 0 0

26 20 1 0 0 0 0

20 68 1 0 0 0 0

20 69 1 0 0 0 0

48 21 1 0 0 0 0

28 21 2 0 0 0 0

22 70 1 0 0 0 0

23 30 1 0 0 0 0

23 71 1 0 0 0 0

31 24 1 0 0 0 0

24 25 1 0 0 0 0

24 72 1 6 0 0 0

33 26 1 0 0 0 0

26 73 1 0 0 0 0

40 28 1 0 0 0 0

28 35 1 0 0 0 0

30 46 2 0 0 0 0

30 74 1 0 0 0 0

32 31 1 0 0 0 0

31 75 1 0 0 0 0

31 76 1 0 0 0 0

39 33 1 0 0 0 0

33 34 2 0 0 0 0

36 35 1 0 0 0 0

36 77 1 0 0 0 0

36 78 1 0 0 0 0

37 55 1 0 0 0 0

38 42 2 0 0 0 0

38 79 1 0 0 0 0

43 39 1 0 0 0 0

39 80 1 0 0 0 0

39 81 1 0 0 0 0

44 40 2 0 0 0 0

41 82 1 0 0 0 0

42 46 1 0 0 0 0

42 83 1 0 0 0 0

47 43 1 0 0 0 0

43 84 1 0 0 0 0

43 85 1 0 0 0 0

44 48 1 0 0 0 0

44 86 1 0 0 0 0

46 87 1 0 0 0 0

50 47 1 0 0 0 0

47 88 1 0 0 0 0

49 89 1 0 0 0 0

51 50 2 0 0 0 0

52 50 1 0 0 0 0

52 54 1 0 0 0 0

52 53 1 0 0 0 0

52 90 1 1 0 0 0

53 91 1 0 0 0 0

57 54 1 0 0 0 0

55 54 1 0 0 0 0

54 56 1 0 0 0 0

55 92 1 0 0 0 0

55 93 1 0 0 0 0

56 94 1 0 0 0 0

56 95 1 0 0 0 0

56 96 1 0 0 0 0

57 97 1 0 0 0 0

57 98 1 0 0 0 0

57 99 1 0 0 0 0

M END): 22 ms

reading 99 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

99 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Ethyl carbamate (also called urethane) is an organic compound with the formula CH3CH2OC(O)NH2. It is an ester of carbamic acid and a white solid. Despite its name, it is not a component of polyurethanes. Because it is a carcinogen, it is rarely used, but naturally forms in low quantities in many types of fermented foods and drinks.
Read full article at Wikipedia

Formula

C29H42N7O17P3S

Net Charge

Average Mass

885.670

Monoisotopic Mass

885.15708

InChI

InChI=1S/C29H42N7O17P3S/c1-29(2,24(40)27(41)32-9-8-19(37)31-10-11-57-20(38)12-17-6-4-3-5-7-17)14-50-56(47,48)53-55(45,46)49-13-18-23(52-54(42,43)44)22(39)28(51-18)36-16-35-21-25(30)33-15-34-26(21)36/h3-7,15-16,18,22-24,28,39-40H,8-14H2,1-2H3,(H,31,37)(H,32,41)(H,45,46)(H,47,48)(H2,30,33,34)(H2,42,43,44)/t18-,22-,23-,24+,28-/m1/s1

InChIKey

ZIGIFDRJFZYEEQ-CECATXLMSA-N

SMILES

CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)N1C=NC2=C1N=CN=C2N)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CC1=CC=CC=C1

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed

Roles Classification
Chemical Role(s):	acyl donor Any donor that can transfer acyl groups between molecular entities. (via acyl-CoA )

Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	phenylacetyl-CoA (CHEBI:15537) has functional parent acetyl-CoA (CHEBI:15351) phenylacetyl-CoA (CHEBI:15537) has functional parent phenylacetic acid (CHEBI:30745) phenylacetyl-CoA (CHEBI:15537) has role Escherichia coli metabolite (CHEBI:76971) phenylacetyl-CoA (CHEBI:15537) has role metabolite (CHEBI:25212) phenylacetyl-CoA (CHEBI:15537) has role mouse metabolite (CHEBI:75771) phenylacetyl-CoA (CHEBI:15537) is a acyl-CoA (CHEBI:17984) phenylacetyl-CoA (CHEBI:15537) is conjugate acid of phenylacetyl-CoA(4−) (CHEBI:57390)

Incoming	4-hydroxyphenylacetyl-CoA (CHEBI:28773) has functional parent phenylacetyl-CoA (CHEBI:15537) phenylacetyl-CoA(4−) (CHEBI:57390) is conjugate base of phenylacetyl-CoA (CHEBI:15537)

IUPAC Name

3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(phenylacetyl)sulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate}

Synonyms	Sources
Coenzyme A, S-(benzeneacetate)	ChemIDplus
Phenylacetyl coenzyme A	KEGG COMPOUND
Phenylacetyl-CoA	KEGG COMPOUND
Phenylacetyl-coa	ChemIDplus
Phenylacetyl-coenzyme A	ChemIDplus

Manual Xrefs	Databases
145148	ChemSpider
C00007536	KNApSAcK
C00582	KEGG COMPOUND
FAQ	PDBeChem
FDB023945	FooDB
HMDB0006503	HMDB
Phenylacetyl-CoA	Wikipedia
View more database links

Registry Numbers	Types	Sources
7532-39-0	CAS Registry Number	ChemIDplus
8399067	Reaxys Registry Number	Reaxys

Citations	Types	Sources
11010921	PubMed citation	Europe PMC
11260461	PubMed citation	Europe PMC
15028709	PubMed citation	Europe PMC
16788190	PubMed citation	Europe PMC
16997993	PubMed citation	Europe PMC
18544072	PubMed citation	Europe PMC
2009287	PubMed citation	Europe PMC
20823522	PubMed citation	Europe PMC
21247899	PubMed citation	Europe PMC
21511027	PubMed citation	Europe PMC
21519854	PubMed citation	Europe PMC
21725002	PubMed citation	Europe PMC
24055609	PubMed citation	Europe PMC
2553650	PubMed citation	Europe PMC
26538563	PubMed citation	Europe PMC
29867833	PubMed citation	Europe PMC
31585996	PubMed citation	Europe PMC
457678	PubMed citation	Europe PMC
6142928	PubMed citation	Europe PMC
666745	PubMed citation	Europe PMC
6838224	PubMed citation	Europe PMC
8002592	PubMed citation	Europe PMC
8352646	PubMed citation	Europe PMC
9297469	PubMed citation	Europe PMC
IND500707503	Agricola citation	Europe PMC

Last Modified

09 June 2021

General Comment
2011-05-20	A neutotoxic metabolite of phenylacetate, it acts by strong inhibition of choline acetyltransferase through competition for acetyl-CoA.

CHEBI:15537 - phenylacetyl-CoA

ChEBI is part of the ELIXIR infrastructure