triphosphoric acid (CHEBI:39949)

ChEBI > Main

CHEBI:39949 - triphosphoric acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	triphosphoric acid

ChEBI ID	CHEBI:39949

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:39942, CHEBI:29203

Supplier Information	ZINC000006827739

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__648061616961568__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__648061616961568__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:39949","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__648061616961568__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"648061616961568","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__648061616961568__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 01230822373D

starting HoverWatcher_5

Time for openFile(

Marvin 01230822373D

18 17 0 0 0 0 999 V2000

1.8416 2.6379 -1.6821 O 0 0 0 0 0 0 0 0 0 0 0 0

2.2548 1.7752 0.4307 O 0 0 0 0 0 0 0 0 0 0 0 0

0.0855 2.4407 -0.1575 O 0 0 0 0 0 0 0 0 0 0 0 0

1.2908 1.8086 -0.6406 P 0 0 1 0 0 0 0 0 0 0 0 0

1.0198 0.4847 -1.1855 O 0 0 0 0 0 0 0 0 0 0 0 0

1.5265 -1.1884 0.4102 O 0 0 0 0 0 0 0 0 0 0 0 0

0.3337 -1.7331 -1.4967 O 0 0 0 0 0 0 0 0 0 0 0 0

0.5208 -0.7025 -0.5039 P 0 0 2 0 0 0 0 0 0 0 0 0

-0.7494 -0.4133 0.1531 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.8172 -1.5169 2.2798 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.7060 -0.4613 1.4538 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.5406 -1.2168 1.0699 P 0 0 1 0 0 0 0 0 0 0 0 0

-1.9712 -2.4509 0.4586 O 0 0 0 0 0 0 0 0 0 0 0 0

2.6153 2.4327 -2.0495 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1311 3.1442 0.3687 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0216 -2.1942 -1.7963 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6202 0.2767 1.9279 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2369 -3.1232 0.9594 H 0 0 0 0 0 0 0 0 0 0 0 0

4 1 1 0 0 0 0

4 2 2 0 0 0 0

4 3 1 0 0 0 0

4 5 1 0 0 0 0

8 5 1 0 0 0 0

8 6 2 0 0 0 0

8 7 1 0 0 0 0

8 9 1 0 0 0 0

12 9 1 0 0 0 0

12 10 2 0 0 0 0

12 11 1 0 0 0 0

12 13 1 0 0 0 0

1 14 1 0 0 0 0

3 15 1 0 0 0 0

7 16 1 0 0 0 0

11 17 1 0 0 0 0

13 18 1 0 0 0 0

M END): 16 ms

reading 18 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

18 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Triphosphoric acid (also tripolyphosphoric acid), with formula H5P3O10, is a condensed form of phosphoric acid. In the family of phosphoric acids, it is the next polyphosphoric acid after pyrophosphoric acid, H4P2O7, also called diphosphoric acid. Compounds such as ATP (adenosine triphosphate) are esters of triphosphoric acid. Triphosphoric acid has not been obtained in crystalline form. The equilibrium mixture with an overall composition corresponding to H5P3O10 contains about 20% of triphosphoric acid. A solution of the pure species can be obtained by ion exchange of the sodium salt, sodium triphosphate, at 0 °C. Triphosporic acid is a pentaprotic acid, meaning that it can release five protons in basic enough conditions. Sources differ on the corresponding pKa values: 1.0; 2.2; 2.3; 5.7; 8.5 1.0; 2.2; 2.3; 3.7; 8.5 small; small; 2.30; 6.50; 9.24
Read full article at Wikipedia

Formula

H5O10P3

Net Charge

Average Mass

257.95498

Monoisotopic Mass

257.90956

InChI

InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6)

InChIKey

UNXRWKVEANCORM-UHFFFAOYSA-N

SMILES

OP(O)(=O)OP(O)(=O)OP(O)(O)=O

Roles Classification
Chemical Role(s):	inorganic acid A Bronsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. (via pnictogen oxoacid ) Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	triphosphoric acid (CHEBI:39949) is a acyclic phosphorus acid anhydride (CHEBI:37786) triphosphoric acid (CHEBI:39949) is a phosphorus oxoacid (CHEBI:33457) triphosphoric acid (CHEBI:39949) is conjugate acid of triphosphate(1−) (CHEBI:48313)

Incoming	triphosphate(1−) (CHEBI:48313) is conjugate base of triphosphoric acid (CHEBI:39949) triphosphate group (CHEBI:32959) is substituent group from triphosphoric acid (CHEBI:39949)

IUPAC Names

1,7-dihydrido-2,4,6-trihydroxido-2,4,6-trioxido-1,3,5,7-tetraoxy-2,4,6-triphosphy-[7]catena

bis(dihydroxidodioxidophosphato)hydroxidooxidophosphorus

μ-[hydroxidotrioxidophosphato(2−)-1κO,2κO]-bis(dihydroxidooxidophosphorus)

pentahydroxido-1κ²O,2κO,3κ²O-di-μ-oxido-trioxido-1κO,2κO,3κO-triphosphorus

Synonyms	Sources
acide triphosphorique	ChEBI
catena-triphosphoric acid	IUPAC
H₅P₃O₁₀	IUPAC
Inorganic triphosphate	KEGG COMPOUND
TRIPHOSPHATE	PDBeChem
Triphosphoric acid	KEGG COMPOUND
Triphosphorsäure	ChEBI
tripolyphosphoric acid	ChEBI

Manual Xrefs	Databases
3PO	PDBeChem
C00536	KEGG COMPOUND
DB03896	DrugBank
FDB028913	FooDB
HMDB0003379	HMDB
Triphosphoric_acid	Wikipedia
View more database links

Registry Numbers	Types	Sources
10380-08-2	CAS Registry Number	ChemIDplus
185379	Gmelin Registry Number	Gmelin

Last Modified

15 May 2024

CHEBI:39949 - triphosphoric acid

ChEBI is part of the ELIXIR infrastructure