6-methylthioinosine (CHEBI:44081)

ChEBI > Main

CHEBI:44081 - 6-methylthioinosine

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	6-methylthioinosine

ChEBI ID	CHEBI:44081

Definition	A thiopurine that is inosine in which the aromatic hydroxy group is replaced by a methylsulfanediyl group.

Stars	This entity has been manually annotated by the ChEBI Team.

Supplier Information	ChemicalBook:CB4360391, eMolecules:1058989, ZINC000000519128

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__8576769827138424__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__8576769827138424__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:44081","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__8576769827138424__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"8576769827138424","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__8576769827138424__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 04291314403D

starting HoverWatcher_5

Time for openFile(

Marvin 04291314403D

34 36 0 0 0 0 999 V2000

-4.9720 -2.3010 0.9520 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.7660 -1.3810 -0.1210 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.7580 -0.3130 0.3090 C 0 0 1 0 0 0 0 0 0 0 0 0

-2.4550 -0.9020 0.5100 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.5220 0.1960 0.4180 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.1770 -0.3010 0.1160 N 0 0 0 0 0 0 0 0 0 0 0 0

0.1300 -1.4960 -0.4630 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4200 -1.6130 -0.5830 N 0 0 0 0 0 0 0 0 0 0 0 0

2.0210 -0.5020 -0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0

3.3550 -0.0790 0.0420 C 0 0 0 0 0 0 0 0 0 0 0 0

4.6850 -1.0970 -0.5040 S 0 0 0 0 0 0 0 0 0 0 0 0

6.0880 -0.0380 -0.0760 C 0 0 0 0 0 0 0 0 0 0 0 0

3.5890 1.1100 0.5910 N 0 0 0 0 0 0 0 0 0 0 0 0

2.5980 1.8790 1.0030 C 0 0 0 0 0 0 0 0 0 0 0 0

1.3350 1.5220 0.8980 N 0 0 0 0 0 0 0 0 0 0 0 0

1.0040 0.3520 0.3630 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.0470 1.0680 -0.7440 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.8650 2.4560 -0.4590 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.5530 0.7230 -0.8190 C 0 0 2 0 0 0 0 0 0 0 0 0

-4.3470 1.8870 -0.5790 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.6120 -2.9560 0.6400 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.7120 -0.9050 -0.3780 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.3800 -1.9150 -0.9890 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.0950 0.1810 1.2210 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5150 0.7660 1.3470 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.5920 -2.2370 -0.7750 H 0 0 0 0 0 0 0 0 0 0 0 0

6.0870 0.1510 0.9980 H 0 0 0 0 0 0 0 0 0 0 0 0

7.0170 -0.5340 -0.3560 H 0 0 0 0 0 0 0 0 0 0 0 0

6.0060 0.9090 -0.6110 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8330 2.8370 1.4430 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5480 0.8010 -1.6760 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2660 2.9460 -1.1900 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.7990 0.2870 -1.7870 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2700 1.6000 -0.5770 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 21 1 0 0 0 0

2 3 1 0 0 0 0

2 22 1 0 0 0 0

2 23 1 0 0 0 0

3 4 1 0 0 0 0

3 19 1 0 0 0 0

3 24 1 0 0 0 0

4 5 1 0 0 0 0

5 6 1 0 0 0 0

5 17 1 0 0 0 0

5 25 1 0 0 0 0

6 7 4 0 0 0 0

6 16 4 0 0 0 0

7 8 4 0 0 0 0

7 26 1 0 0 0 0

8 9 4 0 0 0 0

9 10 4 0 0 0 0

9 16 4 0 0 0 0

10 11 1 0 0 0 0

10 13 4 0 0 0 0

11 12 1 0 0 0 0

12 27 1 0 0 0 0

12 28 1 0 0 0 0

12 29 1 0 0 0 0

13 14 4 0 0 0 0

14 15 4 0 0 0 0

14 30 1 0 0 0 0

15 16 4 0 0 0 0

17 18 1 0 0 0 0

17 19 1 0 0 0 0

17 31 1 0 0 0 0

18 32 1 0 0 0 0

19 20 1 0 0 0 0

19 33 1 0 0 0 0

20 34 1 0 0 0 0

M END): 19 ms

reading 34 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

34 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C11H14N4O4S

Net Charge

Average Mass

298.31800

Monoisotopic Mass

298.07358

InChI

InChI=1S/C11H14N4O4S/c1-20-10-6-9(12-3-13-10)15(4-14-6)11-8(18)7(17)5(2-16)19-11/h3-5,7-8,11,16-18H,2H2,1H3/t5-,7-,8-,11-/m1/s1

InChIKey

ZDRFDHHANOYUTE-IOSLPCCCSA-N

SMILES

CSc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O

ChEBI Ontology
Outgoing	6-methylthioinosine (CHEBI:44081) is a purine ribonucleoside (CHEBI:26399) 6-methylthioinosine (CHEBI:44081) is a thiopurine (CHEBI:35666)

IUPAC Name

6-(methylsulfanyl)-9-β-D-ribofuranosyl-9H-purine

Synonyms	Sources
2-HYDROXYMETHYL-5-(6-METHYLSULFANYL-PURIN-9-YL)-TETRAHYDRO-FURAN-3,4-DIOL	PDBeChem
6-(methylthio)purine ribonucleoside	ChemIDplus
6-methyl MP riboside	ChemIDplus
6-methyl MP-riboside	ChemIDplus
6-methyl-9-ribofuranosylpurine-6-thiol	ChemIDplus
6-methylmercaptopurine ribonucleoside	ChemIDplus
6-methylmercaptopurine riboside	ChemIDplus
6-methylthiopurine riboside	ChemIDplus
6-MMPR	ChemIDplus
6-S-methyl-6-thioinosine	ChEBI
Me6MPR	ChemIDplus
methylmercaptopurine riboside	ChemIDplus
methylthioinosine	ChemIDplus
MMPR	ChemIDplus

Manual Xrefs	Databases
DB02896	DrugBank
MTP	PDBeChem
View more database links

Registry Numbers	Types	Sources
342-69-8	CAS Registry Number	ChemIDplus
42871	Reaxys Registry Number	Reaxys

Citation

Akiyama SI, Kuwano M, Komiyama S, Saneyoshi M (1980)
Antitumor effect of a combination of 6-methylthioinosine and amphotericin B on mouse leukemia L1210.
Cancer letters 9, 305-311 [PubMed:7397683]
[show Abstract]

Last Modified

29 April 2013

CHEBI:44081 - 6-methylthioinosine

ChEBI is part of the ELIXIR infrastructure